97 lines
2.1 KiB
C++
97 lines
2.1 KiB
C++
#ifndef CONTROLLER_HPP
|
|
#define CONTROLLER_HPP
|
|
|
|
#include <stdint.h>
|
|
#include "IndSensorMap.hpp"
|
|
|
|
// PIN MAPPING
|
|
#define dirFR 2
|
|
#define pwmFR 3
|
|
#define dirBR 4
|
|
#define pwmBR 5
|
|
#define pwmFL 6
|
|
#define dirFL 7
|
|
#define dirBL 8
|
|
#define pwmBL 9
|
|
|
|
#define CAP 250
|
|
|
|
typedef struct Constants {
|
|
float kp;
|
|
float ki;
|
|
float kd;
|
|
} Constants;
|
|
|
|
typedef struct K_MAP {
|
|
Constants repelling;
|
|
Constants attracting;
|
|
} K_MAP;
|
|
|
|
typedef struct FullConsts {
|
|
K_MAP avg;
|
|
K_MAP lColl; // repelling is applied to attracting and vice versa for the Right and Back collectives.
|
|
K_MAP fColl;
|
|
} FullConsts;
|
|
|
|
typedef struct Errors {
|
|
float e;
|
|
float eDiff;
|
|
float eInt;
|
|
} Errors;
|
|
|
|
class FullController {
|
|
public:
|
|
bool oor;
|
|
bool outputOn;
|
|
|
|
FullController(IndSensor& l, IndSensor& r, IndSensor& f, IndSensor& b,
|
|
FullConsts fullConsts, float avgRef, float lrDiffRef, float fbDiffRef, float slewRate)
|
|
: Left(l), Right(r), Front(f), Back(b), AvgRef(avgRef), LRDiffRef(lrDiffRef),
|
|
FBDiffRef(fbDiffRef), avgConsts(fullConsts.avg), LConsts(fullConsts.lColl),
|
|
FConsts(fullConsts.fColl), avgError({0,0,0}), LRDiffErr({0,0,0}),
|
|
FBDiffErr({0,0,0}), oor(false), outputOn(false) {}
|
|
|
|
void update();
|
|
void zeroPWMs();
|
|
void sendOutputs();
|
|
void report();
|
|
|
|
private:
|
|
void avgControl();
|
|
void LRControl();
|
|
void FBControl();
|
|
int16_t pwmFunc(K_MAP consts, Errors errs);
|
|
int16_t slewLimit(int16_t target, int16_t prev);
|
|
|
|
IndSensor& Front;
|
|
IndSensor& Back;
|
|
IndSensor& Right;
|
|
IndSensor& Left;
|
|
|
|
K_MAP avgConsts;
|
|
K_MAP LConsts;
|
|
K_MAP FConsts;
|
|
|
|
Errors avgError;
|
|
Errors LRDiffErr;
|
|
Errors FBDiffErr;
|
|
|
|
float AvgRef;
|
|
float LRDiffRef;
|
|
float FBDiffRef;
|
|
float avg;
|
|
|
|
int16_t avgPWM;
|
|
int16_t LDiffPWM;
|
|
int16_t RDiffPWM;
|
|
int16_t FDiffPWM;
|
|
int16_t BDiffPWM;
|
|
// Initially, I was going to make the Right and Back just the negatives,
|
|
// but having separate control functions running for each of these outputs might prove useful.
|
|
|
|
int16_t FLPWM;
|
|
int16_t BLPWM;
|
|
int16_t FRPWM;
|
|
int16_t BRPWM;
|
|
};
|
|
#endif // CONTROLLER_HPP
|