Compare commits

...

12 Commits

88 changed files with 10376 additions and 1883 deletions

3
.gitignore vendored
View File

@@ -4,4 +4,5 @@ __pycache__/
sim_results/
sim_results_multi/
tuningTrials/
# RL_Trials/
# RL_Trials/
venv/

View File

@@ -0,0 +1,152 @@
// A0CalibrationSketch
// ────────────────────────────────────────────────────────────
// Trimmed-down calibration streamer. Continuously outputs
// "<mm>, <a0_raw>" lines over serial, where <mm> is the
// position measured by one of the two known sensors (A2, A3)
// and <a0_raw> is the raw ADC count from the unknown sensor
// on A0. A companion Python notebook buckets these points
// into 0.05mm intervals and exports an Excel calibration.
//
// Handshake protocol (restartable without re-uploading):
// Wake byte : 'S' Python -> Arduino (start/restart streaming)
// Stop byte : 'X' Python -> Arduino (stop streaming, return to idle)
//
// Idle state : Arduino waits for 'S', ignores all other bytes.
// Stream state: Arduino emits data lines, watches for 'X'.
// On 'X' it returns to idle state.
//
// Python connect sequence (works regardless of current Arduino state):
// 1. Send 'X' (stops streaming if running; no-op if idle)
// 2. sleep 200 ms + flush (drain any in-flight data lines)
// 3. Send 'S' (Arduino: 1 s settle, then prints #READY)
// 4. Wait for '#READY'
//
// Data lines: <float_mm>, <int_a0_raw>\n — no other output ever.
// ────────────────────────────────────────────────────────────
#include <Arduino.h>
#include <util/atomic.h>
// ── ADC Interrupt-driven 3-channel read (A2, A3, A0) ─────────
// Channel index: 0 → A2 (sensor 0), 1 → A3 (sensor 1), 2 → A0 (unknown)
static const uint8_t adc_mux[3] = {2, 3, 1};
volatile uint16_t adc_result[3] = {0, 0, 0};
volatile bool adc_ready[3] = {false, false, false};
volatile uint8_t adc_channel = 0;
void setupADC() {
ADMUX = (1 << REFS0) | adc_mux[0]; // AVCC ref, start on A2
ADCSRA = (1 << ADEN) | (1 << ADIE) | (1 << ADPS2); // /16 prescaler
ADCSRA |= (1 << ADSC);
}
// ── OOR digital inputs ───────────────────────────────────────
#define OOR_PIN_0 12 // HIGH = out of range, sensor 0 (A2)
#define OOR_PIN_1 13 // HIGH = out of range, sensor 1 (A3)
volatile bool OOR[2];
ISR(ADC_vect) {
uint16_t sample = ADC;
uint8_t ch = adc_channel;
uint8_t next = (ch + 1) % 3;
if (ch < 2) {
OOR[ch] = digitalRead(ch == 0 ? OOR_PIN_0 : OOR_PIN_1);
if (!OOR[ch]) {
adc_result[ch] = sample;
adc_ready[ch] = true;
}
} else {
// A0: no OOR, always store
adc_result[2] = sample;
adc_ready[2] = true;
}
ADMUX = (ADMUX & 0xF0) | adc_mux[next];
adc_channel = next;
ADCSRA |= (1 << ADSC);
}
// ── ADC → mm linear mappings (raw range: 1626 mm) ──────────
// Kept identical to AltSensorTesting.ino so calibration is
// performed in the same position frame.
#define adcToMM0(adc) ((float)map(adc, 178, 895, 1600, 2600) / 100.0f)
#define adcToMM1(adc) ((float)map(adc, 176, 885, 1600, 2600) / 100.0f)
// Mounting offsets so sensor 0 → 010 mm, sensor 1 → 1020 mm
#define OFFSET_MM0 15.6f
#define OFFSET_MM1 6.2f
// ── Streaming state ──────────────────────────────────────────
bool streaming = false;
// Enter idle: wait for the 'S' wake byte (all other bytes ignored).
// Then settle, clear stale ADC flags, announce #READY, and set streaming.
// Can be called from both setup() and loop() for restartable sessions.
void waitForWake() {
streaming = false;
while (true) {
if (Serial.available()) {
char c = Serial.read();
if (c == 'S') break;
// Any other byte (e.g. stray 'X') is silently discarded.
}
}
delay(1000); // ADC reference settle
ATOMIC_BLOCK(ATOMIC_RESTORESTATE) {
adc_ready[0] = adc_ready[1] = adc_ready[2] = false;
}
Serial.println(F("#READY"));
streaming = true;
}
// ═════════════════════════════════════════════════════════════
void setup() {
Serial.begin(2000000);
pinMode(OOR_PIN_0, INPUT);
pinMode(OOR_PIN_1, INPUT);
setupADC(); // ADC runs continuously; emission is gated by streaming flag
waitForWake();
}
void loop() {
// Check for stop byte before doing any work.
if (Serial.available()) {
char c = Serial.read();
if (c == 'X') {
waitForWake(); // returns only after next 'S' + #READY
return;
}
}
if (!streaming) return;
uint16_t val[3];
bool ready[3];
ATOMIC_BLOCK(ATOMIC_RESTORESTATE) {
for (uint8_t i = 0; i < 3; i++) {
ready[i] = adc_ready[i];
val[i] = adc_result[i];
adc_ready[i] = false;
}
}
if (!ready[0] && !ready[1]) return;
// Emit one line per in-range sensor sample, paired with the
// most recent A0 raw ADC count (val[2] is always fresh).
if (ready[0]) {
float mm = adcToMM0(val[0]) - OFFSET_MM0;
Serial.print(mm, 3);
Serial.print(F(", "));
Serial.println(val[2]);
}
if (ready[1]) {
float mm = adcToMM1(val[1]) - OFFSET_MM1;
Serial.print(mm, 3);
Serial.print(F(", "));
Serial.println(val[2]);
}
}

View File

@@ -0,0 +1,483 @@
{
"cells": [
{
"cell_type": "markdown",
"metadata": {},
"source": [
"# A0 Sensor Calibration\n",
"\n",
"Streams `mm, a0_raw` lines from the `A0CalibrationSketch` Arduino sketch, buckets them into 0.05 mm intervals (±0.02 mm acceptance window), and exports a calibration table to `data/` as a timestamped Excel file.\n",
"\n",
"**Workflow**\n",
"1. Upload `A0CalibrationSketch/A0CalibrationSketch.ino` to the Arduino.\n",
"2. Run the **Config** and **Connect** cells below.\n",
"3. Run the **Collect** cell and sweep the target slowly through the full 020 mm range. The cell terminates automatically once every bucket has ≥50 samples, or press **Stop Collection** to halt early.\n",
"4. Run the **Export** cell.\n"
]
},
{
"cell_type": "code",
"execution_count": 4,
"id": "83a5e59e",
"metadata": {},
"outputs": [
{
"name": "stdout",
"output_type": "stream",
"text": [
"401 buckets from 0.0 to 20.0 mm (step 0.05 mm)\n",
"Acceptance window: +/-0.02 mm from each bucket center\n",
"Target: >= 50 samples per bucket\n"
]
}
],
"source": [
"# === Config ===\n",
"SERIAL_PORT = None # e.g. '/dev/cu.usbmodem14101'; None -> auto-detect\n",
"BAUD_RATE = 115200\n",
"\n",
"MM_MIN = 0.0\n",
"MM_MAX = 20.0\n",
"BUCKET_STEP = 0.05 # bucket spacing (mm)\n",
"BUCKET_WINDOW = 0.02 # accept samples within +/- WINDOW of bucket center\n",
"MIN_SAMPLES = 50 # each bucket must reach this count to auto-stop\n",
"\n",
"from pathlib import Path\n",
"DATA_DIR = Path('data')\n",
"DATA_DIR.mkdir(exist_ok=True)\n",
"\n",
"import numpy as np\n",
"\n",
"N_BUCKETS = int(round((MM_MAX - MM_MIN) / BUCKET_STEP)) + 1\n",
"bucket_centers = np.round(MM_MIN + np.arange(N_BUCKETS) * BUCKET_STEP, 4)\n",
"\n",
"print(f\"{N_BUCKETS} buckets from {MM_MIN} to {MM_MAX} mm (step {BUCKET_STEP} mm)\")\n",
"print(f\"Acceptance window: +/-{BUCKET_WINDOW} mm from each bucket center\")\n",
"print(f\"Target: >= {MIN_SAMPLES} samples per bucket\")\n"
]
},
{
"cell_type": "markdown",
"id": "7b88a837",
"metadata": {},
"source": [
"## 1. Connect to Arduino"
]
},
{
"cell_type": "code",
"execution_count": 5,
"id": "bee575ca",
"metadata": {},
"outputs": [
{
"name": "stdout",
"output_type": "stream",
"text": [
"Opening /dev/cu.usbmodem11301 @ 115200...\n",
"Sending wake signal...\n",
"Waiting for #READY marker...\n",
"Arduino ready - streaming.\n"
]
}
],
"source": [
"import serial\n",
"import serial.tools.list_ports\n",
"import time\n",
"\n",
"def find_port():\n",
" if SERIAL_PORT is not None:\n",
" return SERIAL_PORT\n",
" ports = list(serial.tools.list_ports.comports())\n",
" for p in ports:\n",
" dev = p.device\n",
" desc = (p.description or '').lower()\n",
" if ('usbmodem' in dev or 'usbserial' in dev.lower()\n",
" or 'arduino' in desc or 'wch' in desc):\n",
" return dev\n",
" if ports:\n",
" return ports[0].device\n",
" raise RuntimeError(\"No serial ports found. Set SERIAL_PORT manually.\")\n",
"\n",
"port = find_port()\n",
"print(f\"Opening {port} @ {BAUD_RATE}...\")\n",
"\n",
"# Close any previously-held handle if this cell is re-run.\n",
"try:\n",
" if ser.is_open:\n",
" ser.close()\n",
"except NameError:\n",
" pass\n",
"\n",
"ser = serial.Serial(port, BAUD_RATE, timeout=0.1)\n",
"\n",
"# Opening the port may or may not reset the board.\n",
"# Either way, the Arduino is in idle state (waiting for 'S') after boot.\n",
"# Wait for reset/boot to finish, then flush anything printed before we opened.\n",
"time.sleep(3.0)\n",
"ser.reset_input_buffer()\n",
"\n",
"# Send 'X' first: stops any ongoing stream if the Arduino was already running.\n",
"# If it's in idle state, 'X' is silently ignored.\n",
"ser.write(b'X')\n",
"time.sleep(0.2)\n",
"ser.reset_input_buffer()\n",
"\n",
"# Send the wake byte. Arduino will settle for 1 s then print #READY.\n",
"print(\"Sending wake signal...\")\n",
"ser.write(b'S')\n",
"\n",
"print(\"Waiting for #READY marker...\")\n",
"deadline = time.time() + 15.0\n",
"seen_ready = False\n",
"while time.time() < deadline:\n",
" raw = ser.readline()\n",
" if not raw:\n",
" continue\n",
" if raw.strip() == b'#READY':\n",
" seen_ready = True\n",
" break\n",
"\n",
"if not seen_ready:\n",
" raise RuntimeError(\n",
" \"Did not receive #READY within 15s. \"\n",
" \"Check sketch is uploaded and SERIAL_PORT is correct.\"\n",
" )\n",
"\n",
"# Discard one line to ensure we start reading on a clean boundary.\n",
"_ = ser.readline()\n",
"print(\"Arduino ready - streaming.\")\n"
]
},
{
"cell_type": "markdown",
"id": "f4955b1c",
"metadata": {},
"source": [
"## 2. Collect calibration data\n",
"\n",
"Run this cell and slowly sweep the target through the full 020 mm range. The cell drains the serial stream in a background thread, buckets each valid sample, and updates the plot every ~0.3 s.\n",
"\n",
"Press **Stop Collection** to halt early, or let it run until every bucket has reached the target.\n"
]
},
{
"cell_type": "code",
"execution_count": 6,
"id": "1207881e",
"metadata": {},
"outputs": [
{
"data": {
"application/vnd.jupyter.widget-view+json": {
"model_id": "0aa7a77335254ed68cf8461be35468c7",
"version_major": 2,
"version_minor": 0
},
"text/plain": [
"VBox(children=(HBox(children=(Button(button_style='danger', description='Stop Collection', icon='stop', style=…"
]
},
"metadata": {},
"output_type": "display_data"
},
{
"ename": "CancelledError",
"evalue": "",
"output_type": "error",
"traceback": [
"\u001b[31m---------------------------------------------------------------------------\u001b[39m",
"\u001b[31mCancelledError\u001b[39m Traceback (most recent call last)",
"\u001b[36mCell\u001b[39m\u001b[36m \u001b[39m\u001b[32mIn[6]\u001b[39m\u001b[32m, line 174\u001b[39m\n\u001b[32m 170\u001b[39m \u001b[38;5;28;01mbreak\u001b[39;00m\n\u001b[32m 171\u001b[39m \n\u001b[32m 172\u001b[39m \u001b[38;5;28;01mawait\u001b[39;00m asyncio.sleep(\u001b[32m0.05\u001b[39m)\n\u001b[32m 173\u001b[39m \n\u001b[32m--> \u001b[39m\u001b[32m174\u001b[39m \u001b[38;5;28;01mawait\u001b[39;00m collect()\n\u001b[32m 175\u001b[39m \n\u001b[32m 176\u001b[39m \u001b[38;5;66;03m# Tell the Arduino to stop streaming and return to idle,\u001b[39;00m\n\u001b[32m 177\u001b[39m \u001b[38;5;66;03m# so the connect cell can restart without re-uploading the sketch.\u001b[39;00m\n",
"\u001b[36mCell\u001b[39m\u001b[36m \u001b[39m\u001b[32mIn[6]\u001b[39m\u001b[32m, line 172\u001b[39m, in \u001b[36mcollect\u001b[39m\u001b[34m()\u001b[39m\n\u001b[32m 168\u001b[39m \u001b[38;5;28;01mif\u001b[39;00m filled == N_BUCKETS:\n\u001b[32m 169\u001b[39m status_label.value += \u001b[33m' -- target reached'\u001b[39m\n\u001b[32m 170\u001b[39m \u001b[38;5;28;01mbreak\u001b[39;00m\n\u001b[32m 171\u001b[39m \n\u001b[32m--> \u001b[39m\u001b[32m172\u001b[39m \u001b[38;5;28;01mawait\u001b[39;00m asyncio.sleep(\u001b[32m0.05\u001b[39m)\n",
"\u001b[36mFile \u001b[39m\u001b[32m/Library/Frameworks/Python.framework/Versions/3.13/lib/python3.13/asyncio/tasks.py:718\u001b[39m, in \u001b[36msleep\u001b[39m\u001b[34m(delay, result)\u001b[39m\n\u001b[32m 714\u001b[39m h = loop.call_later(delay,\n\u001b[32m 715\u001b[39m futures._set_result_unless_cancelled,\n\u001b[32m 716\u001b[39m future, result)\n\u001b[32m 717\u001b[39m \u001b[38;5;28;01mtry\u001b[39;00m:\n\u001b[32m--> \u001b[39m\u001b[32m718\u001b[39m \u001b[38;5;28;01mreturn\u001b[39;00m \u001b[38;5;28;01mawait\u001b[39;00m future\n\u001b[32m 719\u001b[39m \u001b[38;5;28;01mfinally\u001b[39;00m:\n\u001b[32m 720\u001b[39m h.cancel()\n",
"\u001b[31mCancelledError\u001b[39m: "
]
}
],
"source": [
"import re\n",
"import queue\n",
"import threading\n",
"import asyncio\n",
"import time\n",
"import matplotlib.pyplot as plt\n",
"import ipywidgets as widgets\n",
"from IPython.display import display, clear_output\n",
"\n",
"# === Bucket state (reset on each run of this cell) ===\n",
"counts = np.zeros(N_BUCKETS, dtype=np.int64)\n",
"means = np.zeros(N_BUCKETS, dtype=np.float64)\n",
"\n",
"# Matches \"<float>, <int>\" with optional leading sign and whitespace.\n",
"LINE_RE = re.compile(r'^\\s*(-?\\d+\\.?\\d*)\\s*,\\s*(\\d+)\\s*$')\n",
"\n",
"def update_bucket(mm, adc):\n",
" idx = int(round((mm - MM_MIN) / BUCKET_STEP))\n",
" if idx < 0 or idx >= N_BUCKETS:\n",
" return False\n",
" if abs(mm - bucket_centers[idx]) > BUCKET_WINDOW + 1e-9:\n",
" return False # falls into the gap between bucket windows\n",
" counts[idx] += 1\n",
" # Welford-style incremental mean (numerically stable, no accumulator overflow)\n",
" means[idx] += (adc - means[idx]) / counts[idx]\n",
" return True\n",
"\n",
"# === Serial reader thread ===\n",
"# If this cell is re-run, stop the previous reader first so we don't end up\n",
"# with two threads racing on ser.readline().\n",
"try:\n",
" _reader_stop.set()\n",
" _reader_thread.join(timeout=1.0)\n",
"except NameError:\n",
" pass\n",
"\n",
"_reader_stop = threading.Event()\n",
"line_queue = queue.Queue()\n",
"\n",
"def _reader_loop(stop_ev, q, s):\n",
" while not stop_ev.is_set():\n",
" try:\n",
" raw = s.readline() # returns after timeout=0.1s if no data\n",
" except Exception:\n",
" break\n",
" if raw:\n",
" q.put(raw)\n",
"\n",
"_reader_thread = threading.Thread(\n",
" target=_reader_loop, args=(_reader_stop, line_queue, ser), daemon=True,\n",
")\n",
"_reader_thread.start()\n",
"\n",
"# === UI widgets ===\n",
"stop_button = widgets.Button(\n",
" description='Stop Collection', button_style='danger', icon='stop',\n",
")\n",
"progress = widgets.IntProgress(\n",
" min=0, max=N_BUCKETS, value=0,\n",
" description='Buckets @target:', bar_style='info',\n",
" style={'description_width': 'initial'},\n",
" layout=widgets.Layout(width='500px'),\n",
")\n",
"status_label = widgets.Label(value='Starting...')\n",
"plot_out = widgets.Output()\n",
"\n",
"stop_requested = False\n",
"def _on_stop(_b):\n",
" global stop_requested\n",
" stop_requested = True\n",
" stop_button.description = 'Stopping...'\n",
" stop_button.disabled = True\n",
"stop_button.on_click(_on_stop)\n",
"\n",
"display(widgets.VBox([\n",
" widgets.HBox([stop_button, progress]),\n",
" status_label,\n",
" plot_out,\n",
"]))\n",
"\n",
"# === Live plot ===\n",
"plt.ioff()\n",
"fig, (ax1, ax2) = plt.subplots(2, 1, figsize=(10, 6), sharex=True)\n",
"plt.close(fig) # prevent implicit display; we manage display manually\n",
"\n",
"def _draw():\n",
" ax1.clear(); ax2.clear()\n",
" filled = counts > 0\n",
" if filled.any():\n",
" ax1.plot(bucket_centers[filled], means[filled], 'b.-', markersize=3)\n",
" ax1.set_ylabel('Avg A0 ADC')\n",
" ax1.set_title('Calibration curve (filled buckets)')\n",
" ax1.grid(True, alpha=0.3)\n",
"\n",
" colors = [\n",
" '#2ecc71' if c >= MIN_SAMPLES\n",
" else '#f39c12' if c > 0\n",
" else '#e74c3c'\n",
" for c in counts\n",
" ]\n",
" ax2.bar(bucket_centers, counts, width=BUCKET_STEP * 0.9, color=colors)\n",
" ax2.axhline(\n",
" MIN_SAMPLES, color='red', linestyle='--', linewidth=1,\n",
" label=f'target = {MIN_SAMPLES}',\n",
" )\n",
" ax2.set_xlabel('Position (mm)')\n",
" ax2.set_ylabel('Sample count')\n",
" ax2.set_title('Bucket fill progress (green = done, orange = partial, red = empty)')\n",
" ax2.legend(loc='upper right', fontsize=8)\n",
" ax2.grid(True, alpha=0.3)\n",
"\n",
" fig.tight_layout()\n",
" with plot_out:\n",
" clear_output(wait=True)\n",
" display(fig)\n",
"\n",
"_draw()\n",
"\n",
"# === Collection loop ===\n",
"total_parsed = 0\n",
"total_bucketed = 0\n",
"total_malformed = 0\n",
"last_draw = time.monotonic()\n",
"DRAW_INTERVAL = 0.3 # seconds\n",
"\n",
"async def collect():\n",
" global total_parsed, total_bucketed, total_malformed, last_draw\n",
"\n",
" while not stop_requested:\n",
" # Drain whatever came in since last tick.\n",
" try:\n",
" while True:\n",
" raw = line_queue.get_nowait()\n",
" try:\n",
" txt = raw.decode('ascii', errors='replace').strip()\n",
" except Exception:\n",
" total_malformed += 1\n",
" continue\n",
" if not txt or txt.startswith('#'):\n",
" continue # stray marker or blank line\n",
" m = LINE_RE.match(txt)\n",
" if not m:\n",
" total_malformed += 1\n",
" continue\n",
" total_parsed += 1\n",
" mm = float(m.group(1))\n",
" adc = int(m.group(2))\n",
" if update_bucket(mm, adc):\n",
" total_bucketed += 1\n",
" except queue.Empty:\n",
" pass\n",
"\n",
" filled = int(np.sum(counts >= MIN_SAMPLES))\n",
"\n",
" now = time.monotonic()\n",
" if now - last_draw >= DRAW_INTERVAL:\n",
" last_draw = now\n",
" progress.value = filled\n",
" status_label.value = (\n",
" f\"filled={filled}/{N_BUCKETS} \"\n",
" f\"min_count={int(counts.min())} \"\n",
" f\"parsed={total_parsed} \"\n",
" f\"bucketed={total_bucketed} \"\n",
" f\"malformed={total_malformed}\"\n",
" )\n",
" _draw()\n",
"\n",
" if filled == N_BUCKETS:\n",
" status_label.value += ' -- target reached'\n",
" break\n",
"\n",
" await asyncio.sleep(0.05)\n",
"\n",
"await collect()\n",
"\n",
"# Tell the Arduino to stop streaming and return to idle,\n",
"# so the connect cell can restart without re-uploading the sketch.\n",
"try:\n",
" ser.write(b'X')\n",
" time.sleep(0.1)\n",
" ser.reset_input_buffer()\n",
"except Exception:\n",
" pass\n",
"\n",
"# Clean shutdown of the reader thread.\n",
"_reader_stop.set()\n",
"\n",
"_draw()\n",
"filled_final = int(np.sum(counts >= MIN_SAMPLES))\n",
"status_label.value = (\n",
" f\"DONE. filled={filled_final}/{N_BUCKETS} \"\n",
" f\"parsded={total_parsed} bucketed={total_bucketed} malformed={total_malformed}\"\n",
")\n",
"stop_button.description = 'Stopped'\n"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"## 3. Export to Excel"
]
},
{
"cell_type": "code",
"execution_count": null,
"metadata": {},
"outputs": [],
"source": [
"from datetime import datetime\n",
"import pandas as pd\n",
"\n",
"ts = datetime.now().strftime('%Y%m%d_%H%M%S')\n",
"out_path = DATA_DIR / f'a0_calibration_{ts}.xlsx'\n",
"\n",
"has_data = counts > 0\n",
"df = pd.DataFrame({\n",
" 'mm_val': bucket_centers[has_data],\n",
" 'avg_adc': np.round(means[has_data], 3),\n",
"})\n",
"\n",
"df.to_excel(out_path, index=False)\n",
"print(f\"Exported {len(df)} rows -> {out_path.resolve()}\")\n",
"\n",
"short = (counts > 0) & (counts < MIN_SAMPLES)\n",
"empty = counts == 0\n",
"if short.any():\n",
" print(f\" Note: {int(short.sum())} buckets have data but < {MIN_SAMPLES} samples.\")\n",
"if empty.any():\n",
" print(f\" Note: {int(empty.sum())} buckets had no data and are omitted from the export.\")\n",
"\n",
"df.head()\n"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"## 4. Cleanup (optional — run when done)"
]
},
{
"cell_type": "code",
"execution_count": null,
"metadata": {},
"outputs": [],
"source": [
"try:\n",
" _reader_stop.set()\n",
" _reader_thread.join(timeout=1.0)\n",
"except NameError:\n",
" pass\n",
"\n",
"try:\n",
" if ser.is_open:\n",
" ser.close()\n",
" print(\"Serial port closed.\")\n",
"except NameError:\n",
" pass\n"
]
}
],
"metadata": {
"kernelspec": {
"display_name": "venv",
"language": "python",
"name": "python3"
},
"language_info": {
"codemirror_mode": {
"name": "ipython",
"version": 3
},
"file_extension": ".py",
"mimetype": "text/x-python",
"name": "python",
"nbconvert_exporter": "python",
"pygments_lexer": "ipython3",
"version": "3.13.7"
}
},
"nbformat": 4,
"nbformat_minor": 5
}

View File

@@ -0,0 +1,447 @@
#!/usr/bin/env python3
"""
A0 Calibration — standalone tkinter GUI
Usage: python calibrate_a0.py
Deps: pyserial numpy pandas openpyxl matplotlib
"""
import re
import time
import threading
from datetime import datetime
from pathlib import Path
import numpy as np
import tkinter as tk
from tkinter import ttk, messagebox
import matplotlib
matplotlib.use('TkAgg')
from matplotlib.figure import Figure
from matplotlib.backends.backend_tkagg import FigureCanvasTkAgg
import serial
import serial.tools.list_ports
import pandas as pd
# ── Configuration ─────────────────────────────────────────────
BAUD_RATE = 2_000_000
MM_MIN = 0.0
MM_MAX = 20.0
BUCKET_STEP = 0.05
BUCKET_WINDOW = 0.02
MIN_SAMPLES = 50
DATA_DIR = Path(__file__).parent / 'data'
DRAW_INTERVAL_MS = 300 # GUI redraw period — worker is never throttled by this
DATA_DIR.mkdir(exist_ok=True)
N_BUCKETS = int(round((MM_MAX - MM_MIN) / BUCKET_STEP)) + 1
bucket_centers = np.round(MM_MIN + np.arange(N_BUCKETS) * BUCKET_STEP, 4)
# Bytes regex: avoids decode overhead on every line in the hot path
LINE_RE = re.compile(rb'^\s*(-?\d+\.?\d*)\s*,\s*(\d+)\s*$')
class CalibrationApp:
def __init__(self, root: tk.Tk):
self.root = root
self.root.title('A0 Sensor Calibration')
self.root.minsize(900, 650)
# ── Shared bucket state (worker writes, GUI reads snapshots) ──
self.counts = np.zeros(N_BUCKETS, dtype=np.int64)
self.means = np.zeros(N_BUCKETS, dtype=np.float64)
self.data_lock = threading.Lock()
# ── Display stats: written by worker, read by GUI ──
self._stat_parsed = 0
self._stat_bucketed = 0
self._stat_malformed = 0
self._stats_lock = threading.Lock()
# ── Thread / connection state ──
self.ser = None
self.worker_thread = None
self.worker_stop = threading.Event()
self.collecting = False
self._build_ui()
self._refresh_ports()
self._schedule_draw()
# ── UI construction ───────────────────────────────────────
def _build_ui(self):
# Connection bar
top = ttk.Frame(self.root, padding=(6, 6, 6, 2))
top.pack(fill='x')
ttk.Label(top, text='Port:').pack(side='left')
self.port_var = tk.StringVar()
self.port_cb = ttk.Combobox(top, textvariable=self.port_var,
width=30, state='readonly')
self.port_cb.pack(side='left', padx=(4, 6))
ttk.Button(top, text='', width=3,
command=self._refresh_ports).pack(side='left', padx=2)
self.conn_btn = ttk.Button(top, text='Connect',
command=self._toggle_connect)
self.conn_btn.pack(side='left', padx=2)
self.conn_label = ttk.Label(top, text='● Disconnected',
foreground='#888')
self.conn_label.pack(side='left', padx=8)
# Control bar
ctrl = ttk.Frame(self.root, padding=(6, 2, 6, 2))
ctrl.pack(fill='x')
self.start_btn = ttk.Button(ctrl, text='Start Collection',
command=self._start, state='disabled')
self.start_btn.pack(side='left', padx=2)
self.stop_btn = ttk.Button(ctrl, text='Stop Collection',
command=self._stop, state='disabled')
self.stop_btn.pack(side='left', padx=2)
ttk.Button(ctrl, text='Export Excel',
command=self._export).pack(side='left', padx=(14, 2))
ttk.Separator(ctrl, orient='vertical').pack(side='left',
fill='y', padx=8)
self.progress_var = tk.IntVar(value=0)
self.progress_bar = ttk.Progressbar(ctrl, variable=self.progress_var,
maximum=N_BUCKETS, length=260)
self.progress_bar.pack(side='left')
self.progress_lbl = ttk.Label(ctrl, text=f' 0 / {N_BUCKETS} buckets')
self.progress_lbl.pack(side='left')
# Stats bar
sbar = ttk.Frame(self.root, padding=(6, 0, 6, 2))
sbar.pack(fill='x')
self.stats_lbl = ttk.Label(sbar,
text='parsed=0 bucketed=0 malformed=0',
foreground='#555')
self.stats_lbl.pack(side='left')
# Matplotlib canvas
self.fig = Figure(tight_layout=True)
self.ax1 = self.fig.add_subplot(2, 1, 1)
self.ax2 = self.fig.add_subplot(2, 1, 2, sharex=self.ax1)
self.ax1.set_ylabel('Avg A0 ADC')
self.ax1.set_title('Calibration curve')
self.ax1.grid(True, alpha=0.3)
self.ax2.set_xlabel('Position (mm)')
self.ax2.set_ylabel('Sample count')
self.ax2.set_title(
'Bucket fill progress (green = done, orange = partial, red = empty)')
self.ax2.axhline(MIN_SAMPLES, color='red', linestyle='--',
linewidth=1, label=f'target = {MIN_SAMPLES}')
self.ax2.legend(fontsize=8, loc='upper right')
self.ax2.grid(True, alpha=0.3)
# Create empty line and bar artists to update later
self.line, = self.ax1.plot([], [], 'b.-', markersize=3)
self.bars = self.ax2.bar(bucket_centers, np.zeros(N_BUCKETS), width=BUCKET_STEP * 0.9)
self.canvas = FigureCanvasTkAgg(self.fig, master=self.root)
self.canvas.get_tk_widget().pack(fill='both', expand=True,
padx=6, pady=(2, 6))
# ── Port management ───────────────────────────────────────
def _refresh_ports(self):
ports = list(serial.tools.list_ports.comports())
self.port_cb['values'] = [p.device for p in ports]
if not ports:
return
for p in ports:
d = (p.description or '').lower()
if ('usbmodem' in p.device or 'usbserial' in p.device.lower()
or 'arduino' in d or 'wch' in d):
self.port_var.set(p.device)
return
if not self.port_var.get():
self.port_var.set(ports[0].device)
# ── Connection ────────────────────────────────────────────
def _toggle_connect(self):
if self.ser and self.ser.is_open:
self._disconnect()
else:
self._connect()
def _connect(self):
port = self.port_var.get()
if not port:
messagebox.showerror('No port', 'Select a serial port first.')
return
try:
# timeout=0.05: readline() returns within 50 ms when no data,
# so the worker's stop-event check is always responsive.
self.ser = serial.Serial(port, BAUD_RATE, timeout=0.05)
except serial.SerialException as e:
messagebox.showerror('Connect failed', str(e))
return
self.conn_btn.config(state='disabled')
self.conn_label.config(text='⏳ Connecting…', foreground='orange')
threading.Thread(target=self._handshake, daemon=True).start()
def _handshake(self):
"""Runs in a daemon thread so the GUI stays responsive during waits."""
try:
time.sleep(3.0) # cover Arduino reset/boot
self.ser.reset_input_buffer()
self.ser.write(b'X') # stop stream if already running
time.sleep(0.2)
self.ser.reset_input_buffer()
self.ser.write(b'S') # send wake byte
deadline = time.time() + 15.0
while time.time() < deadline:
raw = self.ser.readline()
if raw.strip() == b'#READY':
self.ser.readline() # discard potential partial first line
self.root.after(0, self._on_connected)
return
self.root.after(0, lambda: self._on_connect_failed(
'Did not receive #READY within 15 s.\n'
'Check sketch upload and baud rate.'))
except Exception as e:
self.root.after(0, lambda err=str(e): self._on_connect_failed(err))
def _on_connected(self):
self.conn_label.config(text='● Connected', foreground='green')
self.conn_btn.config(text='Disconnect', state='normal')
self.start_btn.config(state='normal')
def _on_connect_failed(self, msg):
messagebox.showerror('Connection failed', msg)
try:
self.ser.close()
except Exception:
pass
self.ser = None
self.conn_label.config(text='● Disconnected', foreground='#888')
self.conn_btn.config(text='Connect', state='normal')
def _disconnect(self):
self._stop()
try:
if self.ser and self.ser.is_open:
self.ser.write(b'X')
self.ser.close()
except Exception:
pass
self.ser = None
self.conn_label.config(text='● Disconnected', foreground='#888')
self.conn_btn.config(text='Connect', state='normal')
self.start_btn.config(state='disabled')
self.stop_btn.config(state='disabled')
# ── Collection control ────────────────────────────────────
def _start(self):
if self.collecting:
return
with self.data_lock:
self.counts[:] = 0
self.means[:] = 0.0
with self._stats_lock:
self._stat_parsed = self._stat_bucketed = self._stat_malformed = 0
self.collecting = True
self.worker_stop.clear()
self.worker_thread = threading.Thread(
target=self._worker, daemon=True, name='serial-worker')
self.worker_thread.start()
self.start_btn.config(state='disabled')
self.stop_btn.config(state='normal')
def _stop(self):
if not self.collecting:
return
self.collecting = False
self.worker_stop.set()
if self.worker_thread:
self.worker_thread.join(timeout=1.0)
self.start_btn.config(
state='normal' if (self.ser and self.ser.is_open) else 'disabled')
self.stop_btn.config(state='disabled')
def _auto_complete(self):
"""Called from worker via root.after — runs on the GUI thread."""
self._stop()
messagebox.showinfo(
'Collection complete',
f'All {N_BUCKETS} buckets reached ≥{MIN_SAMPLES} samples.\n'
'Click Export Excel to save.')
# ── Serial worker ─────────────────────────────────────────
#
# Design priorities:
# 1. Never miss a byte — reads everything in the OS buffer each wake
# 2. Never wait on the GUI — lock hold-time is a single array update
# 3. Auto-complete in O(1) — tracks filled count incrementally
#
def _worker(self):
ser = self.ser
stop = self.worker_stop
counts = self.counts
means = self.means
lock = self.data_lock
centers = bucket_centers
parsed = bucketed = malformed = filled_count = 0
buf = bytearray()
STAT_EVERY = 500 # flush display stats every N parsed lines
while not stop.is_set():
waiting = ser.in_waiting
if waiting:
try:
buf += ser.read(waiting) # single syscall for all bytes
except serial.SerialException:
break
# Process every complete line accumulated in the buffer
while b'\n' in buf:
line, buf = buf.split(b'\n', 1)
line = line.strip()
if not line or line[0:1] == b'#':
continue
m = LINE_RE.match(line)
if not m:
malformed += 1
continue
parsed += 1
mm = float(m.group(1))
adc = int(m.group(2))
idx = int(round((mm - MM_MIN) / BUCKET_STEP))
if (0 <= idx < N_BUCKETS
and abs(mm - centers[idx]) <= BUCKET_WINDOW + 1e-9):
with lock:
counts[idx] += 1
means[idx] += (adc - means[idx]) / counts[idx]
just_filled = (counts[idx] == MIN_SAMPLES)
if just_filled:
filled_count += 1
if filled_count == N_BUCKETS:
# Flush final stats then signal the GUI
with self._stats_lock:
self._stat_parsed = parsed
self._stat_bucketed = bucketed + 1
self._stat_malformed = malformed
self.root.after(0, self._auto_complete)
return
bucketed += 1
if parsed % STAT_EVERY == 0:
with self._stats_lock:
self._stat_parsed = parsed
self._stat_bucketed = bucketed
self._stat_malformed = malformed
else:
# Serial quiet — yield briefly so stop_event can be noticed
time.sleep(0.0005)
# Final stats flush on manual stop
with self._stats_lock:
self._stat_parsed = parsed
self._stat_bucketed = bucketed
self._stat_malformed = malformed
# ── GUI draw (runs on main thread via root.after) ─────────
def _schedule_draw(self):
self._draw()
self.root.after(DRAW_INTERVAL_MS, self._schedule_draw)
def _draw(self):
with self.data_lock:
counts = self.counts.copy()
means = self.means.copy()
with self._stats_lock:
parsed = self._stat_parsed
bucketed = self._stat_bucketed
malformed = self._stat_malformed
filled = int(np.sum(counts >= MIN_SAMPLES))
self.progress_var.set(filled)
self.progress_lbl.config(text=f' {filled} / {N_BUCKETS} buckets')
self.stats_lbl.config(
text=f'parsed={parsed} bucketed={bucketed} malformed={malformed}')
# --- NEW: Update existing artists instead of clearing axes ---
has = counts > 0
if has.any():
self.line.set_data(bucket_centers[has], means[has])
self.ax1.relim() # Recalculate limits
self.ax1.autoscale_view() # Rescale axes
colors = [
'#2ecc71' if c >= MIN_SAMPLES
else '#f39c12' if c > 0
else '#e74c3c'
for c in counts
]
# Update each bar's height and color
for bar, count, color in zip(self.bars, counts, colors):
bar.set_height(count)
bar.set_facecolor(color)
self.ax2.relim()
self.ax2.autoscale_view()
self.canvas.draw_idle()
# ── Export ────────────────────────────────────────────────
def _export(self):
with self.data_lock:
counts = self.counts.copy()
means = self.means.copy()
if not counts.any():
messagebox.showwarning('No data', 'No data collected yet.')
return
ts = datetime.now().strftime('%Y%m%d_%H%M%S')
out_path = DATA_DIR / f'a0_calibration_{ts}.xlsx'
has = counts > 0
pd.DataFrame({
'mm_val': bucket_centers[has],
'avg_adc': np.round(means[has], 3),
}).to_excel(out_path, index=False)
short = int(np.sum((counts > 0) & (counts < MIN_SAMPLES)))
empty = int(np.sum(counts == 0))
msg = f'Exported {int(has.sum())} rows to:\n{out_path}'
if short:
msg += f'\n\n{short} bucket(s) have data but < {MIN_SAMPLES} samples.'
if empty:
msg += f'\n{empty} empty bucket(s) omitted.'
messagebox.showinfo('Exported', msg)
# ── Cleanup ───────────────────────────────────────────────
def on_close(self):
self._stop()
try:
if self.ser and self.ser.is_open:
self.ser.write(b'X')
self.ser.close()
except Exception:
pass
self.root.destroy()
if __name__ == '__main__':
root = tk.Tk()
app = CalibrationApp(root)
root.protocol('WM_DELETE_WINDOW', app.on_close)
root.mainloop()

Binary file not shown.

Binary file not shown.

Binary file not shown.

Binary file not shown.

View File

@@ -1,176 +0,0 @@
#include <Arduino.h>
#include "IndSensorMap.hpp"
#include "Controller.hpp"
#include "ADC.hpp"
#include "FastPWM.hpp"
// K, Ki, Kd Constants
Constants repelling = {250, 0, 1000};
Constants attracting = {250, 0, 1000};
Constants RollLeftUp = {0, 0, 100};
Constants RollLeftDown = {0, 0, 100};
Constants RollFrontUp = {0, 0, 500};
Constants RollFrontDown = {0, 0, 500};
// Reference values for average dist,
float avgRef = 11.0; // TBD: what is our equilibrium height with this testrig?
float LRDiffRef = -2.0; // TBD: what is our left-right balance equilibrium? Positive -> left is above right
float FBDiffRef = 0.0; // TBD: what is front-back balance equilibrium? Positive -> front above back.
// Might be useful for things like jitter or lag.
#define sampling_rate 1000 // Hz
// EMA filter alpha value (all sensors use same alpha)
#define alphaVal 0.3f
// ABOVE THIS LINE IS TUNING VALUES ONLY, BELOW IS ACTUAL CODE.
unsigned long tprior;
unsigned int tDiffMicros;
FullConsts fullConsts = {
{repelling, attracting},
{RollLeftDown, RollLeftUp},
{RollFrontDown, RollFrontUp}
};
FullController controller(indL, indR, indF, indB, fullConsts, avgRef, LRDiffRef, FBDiffRef);
const int dt_micros = 1e6/sampling_rate;
#define LEV_ON
int ON = 0;
void setup() {
Serial.begin(2000000);
setupADC();
setupFastPWM();
indL.alpha = alphaVal;
indR.alpha = alphaVal;
indF.alpha = alphaVal;
indB.alpha = alphaVal;
tprior = micros();
pinMode(dirFL, OUTPUT);
pinMode(pwmFL, OUTPUT);
pinMode(dirBL, OUTPUT);
pinMode(pwmBL, OUTPUT);
pinMode(dirFR, OUTPUT);
pinMode(pwmFR, OUTPUT);
pinMode(dirBR, OUTPUT);
pinMode(pwmBR, OUTPUT);
}
void loop() {
if (Serial.available() > 0) {
String cmd = Serial.readStringUntil('\n');
cmd.trim();
// Check if it's a reference update command (format: REF,avgRef,lrDiffRef,fbDiffRef)
if (cmd.startsWith("REF,")) {
int firstComma = cmd.indexOf(',');
int secondComma = cmd.indexOf(',', firstComma + 1);
int thirdComma = cmd.indexOf(',', secondComma + 1);
if (firstComma > 0 && secondComma > 0 && thirdComma > 0) {
float newAvgRef = cmd.substring(firstComma + 1, secondComma).toFloat();
float newLRDiffRef = cmd.substring(secondComma + 1, thirdComma).toFloat();
float newFBDiffRef = cmd.substring(thirdComma + 1).toFloat();
avgRef = newAvgRef;
LRDiffRef = newLRDiffRef;
FBDiffRef = newFBDiffRef;
controller.updateReferences(avgRef, LRDiffRef, FBDiffRef);
Serial.print("Updated References: Avg=");
Serial.print(avgRef);
Serial.print(", LR=");
Serial.print(LRDiffRef);
Serial.print(", FB=");
Serial.println(FBDiffRef);
}
}
// Check if it's a PID tuning command (format: PID,mode,kp,ki,kd)
else if (cmd.startsWith("PID,")) {
int firstComma = cmd.indexOf(',');
int secondComma = cmd.indexOf(',', firstComma + 1);
int thirdComma = cmd.indexOf(',', secondComma + 1);
int fourthComma = cmd.indexOf(',', thirdComma + 1);
if (firstComma > 0 && secondComma > 0 && thirdComma > 0 && fourthComma > 0) {
int mode = cmd.substring(firstComma + 1, secondComma).toInt();
float kp = cmd.substring(secondComma + 1, thirdComma).toFloat();
float ki = cmd.substring(thirdComma + 1, fourthComma).toFloat();
float kd = cmd.substring(fourthComma + 1).toFloat();
Constants newConst = {kp, ki, kd};
// Mode mapping:
// 0: Repelling
// 1: Attracting
// 2: RollLeftDown
// 3: RollLeftUp
// 4: RollFrontDown
// 5: RollFrontUp
switch(mode) {
case 0: // Repelling
repelling = newConst;
controller.updateAvgPID(repelling, attracting);
Serial.println("Updated Repelling PID");
break;
case 1: // Attracting
attracting = newConst;
controller.updateAvgPID(repelling, attracting);
Serial.println("Updated Attracting PID");
break;
case 2: // RollLeftDown
RollLeftDown = newConst;
controller.updateLRPID(RollLeftDown, RollLeftUp);
Serial.println("Updated RollLeftDown PID");
break;
case 3: // RollLeftUp
RollLeftUp = newConst;
controller.updateLRPID(RollLeftDown, RollLeftUp);
Serial.println("Updated RollLeftUp PID");
break;
case 4: // RollFrontDown
RollFrontDown = newConst;
controller.updateFBPID(RollFrontDown, RollFrontUp);
Serial.println("Updated RollFrontDown PID");
break;
case 5: // RollFrontUp
RollFrontUp = newConst;
controller.updateFBPID(RollFrontDown, RollFrontUp);
Serial.println("Updated RollFrontUp PID");
break;
default:
Serial.println("Invalid mode");
break;
}
}
} else {
// Original control on/off command
controller.outputOn = (cmd.charAt(0) != '0');
}
}
tDiffMicros = micros() - tprior;
if (tDiffMicros >= dt_micros){
controller.update();
controller.report();
controller.sendOutputs();
// this and the previous line can be switched if you want the PWMs to display 0 when controller off.
tprior = micros(); // maybe we have to move this line to before the update commands?
// since the floating point arithmetic may take a while...
}
//Serial.println(telapsed);
}

View File

@@ -0,0 +1,196 @@
#include <Arduino.h>
#include <util/atomic.h>
// ── ADC Interrupt-driven 3-channel read (A2, A3, A0) ─────────
// Channel index: 0 → A2 (sensor 0), 1 → A3 (sensor 1), 2 → A0 (raw ref)
static const uint8_t adc_mux[3] = {2, 3, 0};
volatile uint16_t adc_result[3] = {0, 0, 0};
volatile bool adc_ready[3] = {false, false, false};
volatile uint8_t adc_channel = 0;
void setupADC() {
ADMUX = (1 << REFS0) | adc_mux[0]; // AVCC ref, start on A2
ADCSRA = (1 << ADEN) | (1 << ADIE) | (1 << ADPS2); // /16 prescaler
ADCSRA |= (1 << ADSC);
}
// ── OOR digital inputs ───────────────────────────────────────
#define OOR_PIN_0 12 // HIGH = out of range, sensor 0 (A2)
#define OOR_PIN_1 13 // HIGH = out of range, sensor 1 (A3)
volatile bool OOR[2];
ISR(ADC_vect) {
uint16_t sample = ADC;
uint8_t ch = adc_channel;
uint8_t next = (ch + 1) % 3;
if (ch < 2) {
// Sensor channels: filter by OOR
OOR[ch] = digitalRead(ch == 0 ? OOR_PIN_0 : OOR_PIN_1);
if (!OOR[ch]) {
adc_result[ch] = sample;
adc_ready[ch] = true;
}
} else {
// A0: no OOR, always store
adc_result[2] = sample;
adc_ready[2] = true;
}
ADMUX = (ADMUX & 0xF0) | adc_mux[next];
adc_channel = next;
ADCSRA |= (1 << ADSC);
}
// ── ADC → mm linear mappings (raw range: 1626 mm) ──────────
#define adcToMM0(adc) ((float)map(adc, 178, 895, 1600, 2600) / 100.0f)
#define adcToMM1(adc) ((float)map(adc, 176, 885, 1600, 2600) / 100.0f)
// Subtract mounting offsets so both sensors share the same position frame:
// Sensor 0 raw 1626 mm 16 → 010 mm
// Sensor 1 raw 1626 mm 6 → 1020 mm
#define OFFSET_MM0 15.6f
#define OFFSET_MM1 6.2f
// ── Boundary tracking (in-range only, per sensor) ────────────
#define TRACK_N 10
uint16_t lowestVals[2][TRACK_N];
uint16_t highestVals[2][TRACK_N];
uint8_t lowestCount[2] = {0, 0};
uint8_t highestCount[2] = {0, 0};
static void trackLowest(uint8_t s, uint16_t val) {
uint16_t *lv = lowestVals[s];
uint8_t &lc = lowestCount[s];
if (lc < TRACK_N) {
uint8_t i = lc;
while (i > 0 && lv[i - 1] > val) { lv[i] = lv[i - 1]; i--; }
lv[i] = val;
lc++;
} else if (val < lv[TRACK_N - 1]) {
uint8_t i = TRACK_N - 1;
while (i > 0 && lv[i - 1] > val) { lv[i] = lv[i - 1]; i--; }
lv[i] = val;
}
}
static void trackHighest(uint8_t s, uint16_t val) {
uint16_t *hv = highestVals[s];
uint8_t &hc = highestCount[s];
if (hc < TRACK_N) {
uint8_t i = hc;
while (i > 0 && hv[i - 1] < val) { hv[i] = hv[i - 1]; i--; }
hv[i] = val;
hc++;
} else if (val > hv[TRACK_N - 1]) {
uint8_t i = TRACK_N - 1;
while (i > 0 && hv[i - 1] < val) { hv[i] = hv[i - 1]; i--; }
hv[i] = val;
}
}
static void resetTracking() {
lowestCount[0] = highestCount[0] = 0;
lowestCount[1] = highestCount[1] = 0;
}
static void printBoundaries() {
for (uint8_t s = 0; s < 2; s++) {
Serial.print(F("--- Sensor "));
Serial.print(s);
Serial.println(F(": 10 Lowest In-Range ADC Values ---"));
for (uint8_t i = 0; i < lowestCount[s]; i++) Serial.println(lowestVals[s][i]);
Serial.print(F("--- Sensor "));
Serial.print(s);
Serial.println(F(": 10 Highest In-Range ADC Values ---"));
for (uint8_t i = 0; i < highestCount[s]; i++) Serial.println(highestVals[s][i]);
}
}
// ── State ────────────────────────────────────────────────────
bool sampling = false;
bool rawMode = false;
// ═════════════════════════════════════════════════════════════
void setup() {
Serial.begin(115200);
pinMode(OOR_PIN_0, INPUT);
pinMode(OOR_PIN_1, INPUT);
setupADC();
Serial.println(F("Send '1' to start sampling, '0' to stop and print bounds, '2' for raw ADC output."));
}
void loop() {
// ── Serial command handling ──────────────────────────────
if (Serial.available() > 0) {
String cmd = Serial.readStringUntil('\n');
cmd.trim();
if (cmd.charAt(0) == '1') {
sampling = true;
rawMode = false;
resetTracking();
Serial.println(F("Sampling started."));
} else if (cmd.charAt(0) == '2') {
sampling = true;
rawMode = true;
Serial.println(F("Raw ADC output started."));
} else if (cmd.charAt(0) == '0') {
sampling = false;
rawMode = false;
Serial.println(F("Sampling stopped."));
printBoundaries();
}
}
// ── Main sample path ────────────────────────────────────
if (!sampling) return;
uint16_t val[3];
bool ready[3];
ATOMIC_BLOCK(ATOMIC_RESTORESTATE) {
for (uint8_t i = 0; i < 3; i++) {
ready[i] = adc_ready[i];
val[i] = adc_result[i];
adc_ready[i] = false;
}
}
if (!ready[0] && !ready[1]) return;
if (rawMode) {
if (ready[0]) {
Serial.print(adcToMM0(val[0]) - OFFSET_MM0);
Serial.print(F(", "));
Serial.println(val[2]);
}
if (ready[1]) {
Serial.print(adcToMM1(val[1]) - OFFSET_MM1);
Serial.print(F(", "));
Serial.println(val[2]);
}
return;
}
// Apply offset for whichever sensor(s) are in range
if (ready[0]) {
float mm = adcToMM0(val[0]) - OFFSET_MM0;
trackLowest(0, val[0]);
trackHighest(0, val[0]);
Serial.print(val[0]);
Serial.print(F(", "));
Serial.print(mm, 2);
Serial.println(F(" mm (s0)"));
}
if (ready[1]) {
float mm = adcToMM1(val[1]) - OFFSET_MM1;
trackLowest(1, val[1]);
trackHighest(1, val[1]);
Serial.print(val[1]);
Serial.print(F(", "));
Serial.print(mm, 2);
Serial.println(F(" mm (s1)"));
}
}

View File

@@ -1,47 +0,0 @@
import numpy as np
import matplotlib.pyplot as plt
from scipy.signal import TransferFunction, lsim
# ---- Parameters (edit these) ----
R = 1.5 # ohms
L = 0.0025 # henries
V = 12.0 # volts
# Time base
t_end = 0.2
dt = 1e-4
t = np.arange(0, t_end, dt)
# ---- Define a duty command D(t) ----
# Example: start at 0, step to 0.2 at 20 ms, then to 0.6 at 80 ms, then to 1.0 at 140 ms (DC full on)
D = np.zeros_like(t)
D[t >= 0.020] = 0.2
D[t >= 0.080] = 0.6
D[t >= 0.140] = 1.0 # "straight DC" case (100% duty)
# Clamp just in case
D = np.clip(D, 0.0, 1.0)
# ---- Transfer function I(s)/D(s) = V / (L s + R) ----
# In scipy.signal.TransferFunction, numerator/denominator are polynomials in s
G = TransferFunction([V], [L, R])
# Simulate i(t) response to input D(t)
tout, i, _ = lsim(G, U=D, T=t)
# ---- Print steady-state expectations ----
# For constant duty D0, steady-state i_ss = (V/R)*D0
print("Expected steady-state currents (V/R * D):")
for D0 in [0.0, 0.2, 0.6, 1.0]:
print(f" D={D0:.1f} -> i_ss ~ {(V/R)*D0:.3f} A")
# ---- Plot ----
plt.figure()
plt.plot(tout, D, label="Duty D(t)")
plt.plot(tout, i, label="Current i(t) [A]")
plt.xlabel("Time [s]")
plt.grid(True)
plt.legend()
plt.show()

View File

@@ -1,787 +0,0 @@
{
"cells": [
{
"cell_type": "markdown",
"metadata": {},
"source": [
"# PID Control Testing for Maglev Pod\n",
"\n",
"This notebook provides a PID control interface for the `LevPodEnv` simulation environment.\n",
"\n",
"## Control Architecture\n",
"- **Height PID**: Controls average gap height → base PWM for all coils\n",
"- **Roll PID**: Corrects roll angle → differential left/right adjustment\n",
"- **Pitch PID**: Corrects pitch angle → differential front/back adjustment\n",
"\n",
"The outputs combine: `coil_pwm = height_output ± roll_adjustment ± pitch_adjustment`"
]
},
{
"cell_type": "code",
"execution_count": null,
"metadata": {},
"outputs": [],
"source": [
"import numpy as np\n",
"import matplotlib.pyplot as plt\n",
"from lev_pod_env import LevPodEnv, TARGET_GAP\n",
"\n",
"# Set plot style for better aesthetics\n",
"plt.style.use('seaborn-v0_8-whitegrid')\n",
"plt.rcParams['figure.facecolor'] = 'white'\n",
"plt.rcParams['axes.facecolor'] = 'white'\n",
"plt.rcParams['font.size'] = 11\n",
"plt.rcParams['axes.titlesize'] = 14\n",
"plt.rcParams['axes.labelsize'] = 12\n",
"\n",
"print(f\"Target Gap Height: {TARGET_GAP * 1000:.2f} mm\")"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"---\n",
"## PID Controller Class"
]
},
{
"cell_type": "code",
"execution_count": null,
"metadata": {},
"outputs": [],
"source": [
"class PIDController:\n",
" \"\"\"Simple PID controller with anti-windup.\"\"\"\n",
" \n",
" def __init__(self, kp: float, ki: float, kd: float, \n",
" output_min: float = -1.0, output_max: float = 1.0,\n",
" integral_limit: float = np.inf):\n",
" self.kp = kp\n",
" self.ki = ki\n",
" self.kd = kd\n",
" self.output_min = output_min\n",
" self.output_max = output_max\n",
" self.integral_limit = integral_limit if integral_limit else abs(output_max) * 2\n",
" \n",
" self.integral = 0.0\n",
" self.prev_error = 0.0\n",
" self.first_update = True\n",
" \n",
" def reset(self):\n",
" \"\"\"Reset controller state.\"\"\"\n",
" self.integral = 0.0\n",
" self.prev_error = 0.0\n",
" self.first_update = True\n",
" \n",
" def update(self, error: float, dt: float) -> float:\n",
" \"\"\"Compute PID output.\n",
" \n",
" Args:\n",
" error: Current error (setpoint - measurement)\n",
" dt: Time step in seconds\n",
" \n",
" Returns:\n",
" Control output (clamped to output limits)\n",
" \"\"\"\n",
" # Proportional term\n",
" p_term = self.kp * error\n",
" \n",
" # Integral term with anti-windup\n",
" self.integral += error * dt\n",
" self.integral = np.clip(self.integral, -self.integral_limit, self.integral_limit)\n",
" i_term = self.ki * self.integral\n",
" \n",
" # Derivative term (skip on first update to avoid spike)\n",
" if self.first_update:\n",
" d_term = 0.0\n",
" self.first_update = False\n",
" else:\n",
" d_term = self.kd * (error - self.prev_error) / dt\n",
" \n",
" self.prev_error = error\n",
" \n",
" # Compute and clamp output\n",
" output = p_term + i_term + d_term\n",
" return np.clip(output, self.output_min, self.output_max)"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"---\n",
"## PID Gains Configuration\n",
"\n",
"**Modify these values to tune the controller.**\n",
"\n",
"- **Height PID**: Controls vertical position (gap height)\n",
"- **Roll PID**: Corrects side-to-side tilt\n",
"- **Pitch PID**: Corrects front-to-back tilt"
]
},
{
"cell_type": "code",
"execution_count": null,
"metadata": {},
"outputs": [],
"source": [
"# ============================================================\n",
"# HEIGHT PID GAINS\n",
"# ============================================================\n",
"# Controls average gap height. Positive error = pod too low.\n",
"# Output: base PWM applied to all coils (positive = more lift)\n",
"\n",
"HEIGHT_KP = 50.0 # Proportional gain\n",
"HEIGHT_KI = 5.0 # Integral gain \n",
"HEIGHT_KD = 10.0 # Derivative gain\n",
"\n",
"# ============================================================\n",
"# ROLL PID GAINS\n",
"# ============================================================\n",
"# Corrects roll angle (rotation about X-axis).\n",
"# Positive roll = right side lower → increase right coils\n",
"# Output: differential adjustment to left/right coils\n",
"\n",
"ROLL_KP = 2.0 # Proportional gain\n",
"ROLL_KI = 0.5 # Integral gain\n",
"ROLL_KD = 0.5 # Derivative gain\n",
"\n",
"# ============================================================\n",
"# PITCH PID GAINS \n",
"# ============================================================\n",
"# Corrects pitch angle (rotation about Y-axis).\n",
"# Positive pitch = back lower → increase back coils\n",
"# Output: differential adjustment to front/back coils\n",
"\n",
"PITCH_KP = 2.0 # Proportional gain\n",
"PITCH_KI = 0.5 # Integral gain\n",
"PITCH_KD = 0.5 # Derivative gain\n",
"\n",
"print(\"PID Gains Configured:\")\n",
"print(f\" Height: Kp={HEIGHT_KP}, Ki={HEIGHT_KI}, Kd={HEIGHT_KD}\")\n",
"print(f\" Roll: Kp={ROLL_KP}, Ki={ROLL_KI}, Kd={ROLL_KD}\")\n",
"print(f\" Pitch: Kp={PITCH_KP}, Ki={PITCH_KI}, Kd={PITCH_KD}\")"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"---\n",
"## Simulation Runner"
]
},
{
"cell_type": "code",
"execution_count": null,
"metadata": {},
"outputs": [],
"source": [
"def run_pid_simulation(\n",
" initial_gap_mm: float = 14.0,\n",
" max_steps: int = 2000,\n",
" use_gui: bool = False,\n",
" disturbance_step: int = None,\n",
" disturbance_force: float = 0.0,\n",
" disturbance_force_std: float = 0.0,\n",
" verbose: bool = True\n",
") -> dict:\n",
" \"\"\"\n",
" Run a PID-controlled simulation of the maglev pod.\n",
"\n",
" Args:\n",
" initial_gap_mm: Starting gap height in millimeters\n",
" max_steps: Maximum simulation steps (each step is 1/240 second)\n",
" use_gui: Whether to show PyBullet GUI visualization\n",
" disturbance_step: Step at which to apply impulse disturbance (None = no impulse)\n",
" disturbance_force: Impulse force in Newtons at disturbance_step (positive = upward)\n",
" disturbance_force_std: Standard deviation of continuous stochastic noise (Newtons)\n",
" verbose: Print progress updates\n",
"\n",
" Returns:\n",
" Dictionary containing time series data for plotting\n",
" \"\"\"\n",
" # Create environment with stochastic disturbance if specified\n",
" env = LevPodEnv(\n",
" use_gui=use_gui,\n",
" initial_gap_mm=initial_gap_mm,\n",
" max_steps=max_steps,\n",
" disturbance_force_std=disturbance_force_std\n",
" )\n",
" dt = env.dt # 1/240 seconds\n",
"\n",
" # Initialize PID controllers\n",
" height_pid = PIDController(HEIGHT_KP, HEIGHT_KI, HEIGHT_KD, output_min=-1.0, output_max=1.0)\n",
" roll_pid = PIDController(ROLL_KP, ROLL_KI, ROLL_KD, output_min=-0.5, output_max=0.5)\n",
" pitch_pid = PIDController(PITCH_KP, PITCH_KI, PITCH_KD, output_min=-0.5, output_max=0.5)\n",
"\n",
" # Data storage\n",
" data = {\n",
" 'time': [],\n",
" 'gap_front': [],\n",
" 'gap_back': [],\n",
" 'gap_avg': [],\n",
" 'roll_deg': [],\n",
" 'pitch_deg': [],\n",
" 'current_FL': [],\n",
" 'current_FR': [],\n",
" 'current_BL': [],\n",
" 'current_BR': [],\n",
" 'current_total': [],\n",
" 'pwm_FL': [],\n",
" 'pwm_FR': [],\n",
" 'pwm_BL': [],\n",
" 'pwm_BR': [],\n",
" }\n",
"\n",
" # Reset environment\n",
" obs, _ = env.reset()\n",
"\n",
" target_gap = TARGET_GAP # meters\n",
"\n",
" if verbose:\n",
" print(f\"Starting simulation: initial_gap={initial_gap_mm}mm, target={target_gap*1000:.2f}mm\")\n",
" if disturbance_step:\n",
" print(f\" Impulse disturbance: {disturbance_force}N at step {disturbance_step}\")\n",
" if disturbance_force_std > 0:\n",
" print(f\" Stochastic noise: std={disturbance_force_std}N\")\n",
"\n",
" for step in range(max_steps):\n",
" t = step * dt\n",
"\n",
" # Extract gap heights from observation (first 4 values are normalized gaps)\n",
" # These are sensor readings (may include noise in future)\n",
" gaps_normalized = obs[:4] # [center_right, center_left, front, back]\n",
" gaps = gaps_normalized * env.gap_scale + TARGET_GAP\n",
"\n",
" gap_front = gaps[2] # Front sensor\n",
" gap_back = gaps[3] # Back sensor\n",
" gap_left = gaps[1] # Center_Left sensor\n",
" gap_right = gaps[0] # Center_Right sensor\n",
"\n",
" gap_avg = (gap_front + gap_back + gap_left + gap_right) / 4\n",
"\n",
" # Calculate roll and pitch from sensor gaps (for PID control)\n",
" y_distance = 0.1016 # Left to right distance (m)\n",
" x_distance = 0.2518 # Front to back distance (m)\n",
"\n",
" roll_angle = np.arcsin(np.clip((gap_left - gap_right) / y_distance, -1, 1))\n",
" pitch_angle = np.arcsin(np.clip((gap_back - gap_front) / x_distance, -1, 1))\n",
"\n",
" # Compute PID outputs\n",
" height_error = target_gap - gap_avg # Positive = too low, need more lift\n",
" roll_error = -roll_angle # Target is 0, negative feedback\n",
" pitch_error = -pitch_angle # Target is 0, negative feedback\n",
"\n",
" height_output = height_pid.update(height_error, dt)\n",
" roll_output = roll_pid.update(roll_error, dt)\n",
" pitch_output = pitch_pid.update(pitch_error, dt)\n",
"\n",
" # Combine outputs into 4 coil PWM commands\n",
" # Coil layout: front_left (+x,+y), front_right (+x,-y), back_left (-x,+y), back_right (-x,-y)\n",
" # Roll correction: positive roll_output → increase right side (FR, BR)\n",
" # Pitch correction: positive pitch_output → increase back side (BL, BR)\n",
"\n",
" pwm_FL = np.clip(height_output - roll_output - pitch_output, -1, 1)\n",
" pwm_FR = np.clip(height_output + roll_output - pitch_output, -1, 1)\n",
" pwm_BL = np.clip(height_output - roll_output + pitch_output, -1, 1)\n",
" pwm_BR = np.clip(height_output + roll_output + pitch_output, -1, 1)\n",
"\n",
" action = np.array([pwm_FL, pwm_FR, pwm_BL, pwm_BR], dtype=np.float32)\n",
"\n",
" # Apply impulse disturbance if specified (uses environment method)\n",
" if disturbance_step and step == disturbance_step:\n",
" env.apply_impulse(disturbance_force)\n",
" if verbose:\n",
" print(f\" Applied {disturbance_force}N impulse at step {step}\")\n",
"\n",
" # Step environment (stochastic disturbance applied internally if enabled)\n",
" obs, _, terminated, truncated, info = env.step(action)\n",
"\n",
" # Store ground truth data from environment info (not sensor observations)\n",
" data['time'].append(t)\n",
" data['gap_front'].append(info['gap_front_yoke'] * 1000) # Convert to mm\n",
" data['gap_back'].append(info['gap_back_yoke'] * 1000)\n",
" data['gap_avg'].append(info['gap_avg'] * 1000) # Use ground truth from info\n",
" data['roll_deg'].append(np.degrees(info['roll']))\n",
" data['pitch_deg'].append(np.degrees(info['pitch'])) # Use ground truth from info\n",
" data['current_FL'].append(info['curr_front_L'])\n",
" data['current_FR'].append(info['curr_front_R'])\n",
" data['current_BL'].append(info['curr_back_L'])\n",
" data['current_BR'].append(info['curr_back_R'])\n",
" data['current_total'].append(\n",
" abs(info['curr_front_L']) + abs(info['curr_front_R']) +\n",
" abs(info['curr_back_L']) + abs(info['curr_back_R'])\n",
" )\n",
" data['pwm_FL'].append(pwm_FL)\n",
" data['pwm_FR'].append(pwm_FR)\n",
" data['pwm_BL'].append(pwm_BL)\n",
" data['pwm_BR'].append(pwm_BR)\n",
"\n",
" if terminated or truncated:\n",
" if verbose:\n",
" print(f\" Simulation ended at step {step} (terminated={terminated})\")\n",
" break\n",
"\n",
" env.close()\n",
"\n",
" # Convert to numpy arrays\n",
" for key in data:\n",
" data[key] = np.array(data[key])\n",
"\n",
" if verbose:\n",
" print(f\"Simulation complete: {len(data['time'])} steps, {data['time'][-1]:.2f}s\")\n",
" print(f\" Final gap: {data['gap_avg'][-1]:.2f}mm (target: {target_gap*1000:.2f}mm)\")\n",
" print(f\" Final roll: {data['roll_deg'][-1]:.3f}°, pitch: {data['pitch_deg'][-1]:.3f}°\")\n",
"\n",
" return data"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"---\n",
"## Plotting Functions"
]
},
{
"cell_type": "code",
"execution_count": null,
"metadata": {},
"outputs": [],
"source": [
"def plot_results(data: dict, title_suffix: str = \"\"):\n",
" \"\"\"\n",
" Create aesthetic plots of simulation results.\n",
" \n",
" Args:\n",
" data: Dictionary from run_pid_simulation()\n",
" title_suffix: Optional suffix for plot titles\n",
" \"\"\"\n",
" fig, axes = plt.subplots(2, 2, figsize=(14, 10))\n",
" fig.suptitle(f'PID Control Performance{title_suffix}', fontsize=16, fontweight='bold', y=1.02)\n",
" \n",
" target_gap_mm = TARGET_GAP * 1000\n",
" time = data['time']\n",
" \n",
" # Color palette\n",
" colors = {\n",
" 'primary': '#2563eb', # Blue\n",
" 'secondary': '#7c3aed', # Purple\n",
" 'accent1': '#059669', # Green\n",
" 'accent2': '#dc2626', # Red\n",
" 'target': '#f59e0b', # Orange\n",
" 'grid': '#e5e7eb'\n",
" }\n",
" \n",
" # ========== Gap Height Plot ==========\n",
" ax1 = axes[0, 0]\n",
" ax1.plot(time, data['gap_avg'], color=colors['primary'], linewidth=2, label='Average Gap')\n",
" ax1.plot(time, data['gap_front'], color=colors['secondary'], linewidth=1, alpha=0.6, label='Front Yoke')\n",
" ax1.plot(time, data['gap_back'], color=colors['accent1'], linewidth=1, alpha=0.6, label='Back Yoke')\n",
" ax1.axhline(y=target_gap_mm, color=colors['target'], linestyle='--', linewidth=2, label=f'Target ({target_gap_mm:.1f}mm)')\n",
" \n",
" ax1.set_xlabel('Time (s)')\n",
" ax1.set_ylabel('Gap Height (mm)')\n",
" ax1.set_title('Gap Height Over Time', fontweight='bold')\n",
" ax1.legend(loc='best', framealpha=0.9)\n",
" ax1.set_ylim([0, max(35, max(data['gap_avg']) * 1.1)])\n",
" ax1.grid(True, alpha=0.3)\n",
" \n",
" # Add settling info\n",
" final_error = abs(data['gap_avg'][-1] - target_gap_mm)\n",
" ax1.text(0.98, 0.02, f'Final error: {final_error:.2f}mm', \n",
" transform=ax1.transAxes, ha='right', va='bottom',\n",
" fontsize=10, bbox=dict(boxstyle='round', facecolor='white', alpha=0.8))\n",
" \n",
" # ========== Roll Angle Plot ==========\n",
" ax2 = axes[0, 1]\n",
" ax2.plot(time, data['roll_deg'], color=colors['primary'], linewidth=2)\n",
" ax2.axhline(y=0, color=colors['target'], linestyle='--', linewidth=1.5, alpha=0.7)\n",
" ax2.fill_between(time, data['roll_deg'], 0, alpha=0.2, color=colors['primary'])\n",
" \n",
" ax2.set_xlabel('Time (s)')\n",
" ax2.set_ylabel('Roll Angle (degrees)')\n",
" ax2.set_title('Roll Angle Over Time', fontweight='bold')\n",
" ax2.grid(True, alpha=0.3)\n",
" \n",
" max_roll = max(abs(data['roll_deg'].min()), abs(data['roll_deg'].max()))\n",
" ax2.set_ylim([-max(1, max_roll * 1.2), max(1, max_roll * 1.2)])\n",
" \n",
" # ========== Pitch Angle Plot ==========\n",
" ax3 = axes[1, 0]\n",
" ax3.plot(time, data['pitch_deg'], color=colors['secondary'], linewidth=2)\n",
" ax3.axhline(y=0, color=colors['target'], linestyle='--', linewidth=1.5, alpha=0.7)\n",
" ax3.fill_between(time, data['pitch_deg'], 0, alpha=0.2, color=colors['secondary'])\n",
" \n",
" ax3.set_xlabel('Time (s)')\n",
" ax3.set_ylabel('Pitch Angle (degrees)')\n",
" ax3.set_title('Pitch Angle Over Time', fontweight='bold')\n",
" ax3.grid(True, alpha=0.3)\n",
" \n",
" max_pitch = max(abs(data['pitch_deg'].min()), abs(data['pitch_deg'].max()))\n",
" ax3.set_ylim([-max(1, max_pitch * 1.2), max(1, max_pitch * 1.2)])\n",
" \n",
" # ========== Current Draw Plot ==========\n",
" ax4 = axes[1, 1]\n",
" ax4.plot(time, data['current_FL'], linewidth=1.5, label='Front Left', alpha=0.8)\n",
" ax4.plot(time, data['current_FR'], linewidth=1.5, label='Front Right', alpha=0.8)\n",
" ax4.plot(time, data['current_BL'], linewidth=1.5, label='Back Left', alpha=0.8)\n",
" ax4.plot(time, data['current_BR'], linewidth=1.5, label='Back Right', alpha=0.8)\n",
" ax4.plot(time, data['current_total'], color='black', linewidth=2, label='Total', linestyle='--')\n",
" \n",
" ax4.set_xlabel('Time (s)')\n",
" ax4.set_ylabel('Current (A)')\n",
" ax4.set_title('Coil Current Draw Over Time', fontweight='bold')\n",
" ax4.legend(loc='best', framealpha=0.9, ncol=2)\n",
" ax4.grid(True, alpha=0.3)\n",
" \n",
" # Add average power info\n",
" avg_total_current = np.mean(data['current_total'])\n",
" ax4.text(0.98, 0.98, f'Avg total: {avg_total_current:.2f}A', \n",
" transform=ax4.transAxes, ha='right', va='top',\n",
" fontsize=10, bbox=dict(boxstyle='round', facecolor='white', alpha=0.8))\n",
" \n",
" plt.tight_layout()\n",
" plt.show()\n",
" \n",
" return fig"
]
},
{
"cell_type": "code",
"execution_count": null,
"metadata": {},
"outputs": [],
"source": [
"def plot_control_signals(data: dict):\n",
" \"\"\"\n",
" Plot the PWM control signals sent to each coil.\n",
" \n",
" Args:\n",
" data: Dictionary from run_pid_simulation()\n",
" \"\"\"\n",
" fig, ax = plt.subplots(figsize=(12, 5))\n",
" \n",
" time = data['time']\n",
" \n",
" ax.plot(time, data['pwm_FL'], label='Front Left', linewidth=1.5, alpha=0.8)\n",
" ax.plot(time, data['pwm_FR'], label='Front Right', linewidth=1.5, alpha=0.8)\n",
" ax.plot(time, data['pwm_BL'], label='Back Left', linewidth=1.5, alpha=0.8)\n",
" ax.plot(time, data['pwm_BR'], label='Back Right', linewidth=1.5, alpha=0.8)\n",
" \n",
" ax.axhline(y=0, color='gray', linestyle='-', linewidth=0.5)\n",
" ax.axhline(y=1, color='red', linestyle='--', linewidth=1, alpha=0.5, label='Saturation')\n",
" ax.axhline(y=-1, color='red', linestyle='--', linewidth=1, alpha=0.5)\n",
" \n",
" ax.set_xlabel('Time (s)')\n",
" ax.set_ylabel('PWM Duty Cycle')\n",
" ax.set_title('Control Signals (PWM)', fontsize=14, fontweight='bold')\n",
" ax.legend(loc='best', framealpha=0.9)\n",
" ax.set_ylim([-1.2, 1.2])\n",
" ax.grid(True, alpha=0.3)\n",
" \n",
" plt.tight_layout()\n",
" plt.show()\n",
" \n",
" return fig"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"---\n",
"## Run Simulation\n",
"\n",
"**Configure the simulation parameters below and run the cell.**"
]
},
{
"cell_type": "code",
"execution_count": null,
"metadata": {},
"outputs": [],
"source": [
"# ============================================================\n",
"# SIMULATION PARAMETERS\n",
"# ============================================================\n",
"\n",
"INITIAL_GAP_MM = 14.0 # Starting gap height (mm). Target is ~16.49mm\n",
"MAX_STEPS = 2000 # Simulation steps (240 steps = 1 second)\n",
"USE_GUI = False # Set to True to see PyBullet visualization\n",
"\n",
"# Impulse disturbance (one-time force at a specific step)\n",
"DISTURBANCE_STEP = None # Step at which to apply impulse (e.g., 500). None = disabled\n",
"DISTURBANCE_FORCE = 0.0 # Impulse force in Newtons (positive = upward push)\n",
"\n",
"# Stochastic disturbance (continuous random noise each step)\n",
"DISTURBANCE_FORCE_STD = 0.0 # Std dev of random force noise (Newtons). 0 = disabled\n",
"\n",
"# ============================================================\n",
"\n",
"# Run simulation\n",
"results = run_pid_simulation(\n",
" initial_gap_mm=INITIAL_GAP_MM,\n",
" max_steps=MAX_STEPS,\n",
" use_gui=USE_GUI,\n",
" disturbance_step=DISTURBANCE_STEP,\n",
" disturbance_force=DISTURBANCE_FORCE,\n",
" disturbance_force_std=DISTURBANCE_FORCE_STD,\n",
" verbose=True\n",
")"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"---\n",
"## View Results"
]
},
{
"cell_type": "code",
"execution_count": null,
"metadata": {},
"outputs": [],
"source": [
"# Plot main performance metrics\n",
"plot_results(results)"
]
},
{
"cell_type": "code",
"execution_count": null,
"metadata": {},
"outputs": [],
"source": [
"# Plot control signals (optional)\n",
"plot_control_signals(results)"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"---\n",
"## Compare Multiple Initial Conditions\n",
"\n",
"Run this cell to test the controller with different starting heights."
]
},
{
"cell_type": "code",
"execution_count": null,
"metadata": {},
"outputs": [],
"source": [
"def compare_initial_conditions(initial_gaps_mm: list, max_steps: int = 2000):\n",
" \"\"\"\n",
" Compare PID performance across different initial conditions.\n",
" \n",
" Args:\n",
" initial_gaps_mm: List of starting gap heights to test\n",
" max_steps: Maximum steps per simulation\n",
" \"\"\"\n",
" fig, axes = plt.subplots(2, 2, figsize=(14, 10))\n",
" fig.suptitle('PID Performance Comparison: Different Initial Conditions', \n",
" fontsize=16, fontweight='bold', y=1.02)\n",
" \n",
" target_gap_mm = TARGET_GAP * 1000\n",
" colors = plt.cm.viridis(np.linspace(0, 0.8, len(initial_gaps_mm)))\n",
" \n",
" all_results = []\n",
" \n",
" for i, gap in enumerate(initial_gaps_mm):\n",
" print(f\"Running simulation {i+1}/{len(initial_gaps_mm)}: initial_gap={gap}mm\")\n",
" data = run_pid_simulation(initial_gap_mm=gap, max_steps=max_steps, verbose=False)\n",
" all_results.append((gap, data))\n",
" \n",
" label = f'{gap}mm'\n",
" \n",
" # Gap height\n",
" axes[0, 0].plot(data['time'], data['gap_avg'], color=colors[i], \n",
" linewidth=2, label=label)\n",
" \n",
" # Roll\n",
" axes[0, 1].plot(data['time'], data['roll_deg'], color=colors[i], \n",
" linewidth=2, label=label)\n",
" \n",
" # Pitch\n",
" axes[1, 0].plot(data['time'], data['pitch_deg'], color=colors[i], \n",
" linewidth=2, label=label)\n",
" \n",
" # Total current\n",
" axes[1, 1].plot(data['time'], data['current_total'], color=colors[i], \n",
" linewidth=2, label=label)\n",
" \n",
" # Add target line to gap plot\n",
" axes[0, 0].axhline(y=target_gap_mm, color='red', linestyle='--', \n",
" linewidth=2, label=f'Target ({target_gap_mm:.1f}mm)')\n",
" \n",
" # Configure axes\n",
" axes[0, 0].set_xlabel('Time (s)')\n",
" axes[0, 0].set_ylabel('Gap Height (mm)')\n",
" axes[0, 0].set_title('Average Gap Height', fontweight='bold')\n",
" axes[0, 0].legend(loc='best')\n",
" axes[0, 0].grid(True, alpha=0.3)\n",
" \n",
" axes[0, 1].axhline(y=0, color='gray', linestyle='--', linewidth=1)\n",
" axes[0, 1].set_xlabel('Time (s)')\n",
" axes[0, 1].set_ylabel('Roll Angle (degrees)')\n",
" axes[0, 1].set_title('Roll Angle', fontweight='bold')\n",
" axes[0, 1].legend(loc='best')\n",
" axes[0, 1].grid(True, alpha=0.3)\n",
" \n",
" axes[1, 0].axhline(y=0, color='gray', linestyle='--', linewidth=1)\n",
" axes[1, 0].set_xlabel('Time (s)')\n",
" axes[1, 0].set_ylabel('Pitch Angle (degrees)')\n",
" axes[1, 0].set_title('Pitch Angle', fontweight='bold')\n",
" axes[1, 0].legend(loc='best')\n",
" axes[1, 0].grid(True, alpha=0.3)\n",
" \n",
" axes[1, 1].set_xlabel('Time (s)')\n",
" axes[1, 1].set_ylabel('Total Current (A)')\n",
" axes[1, 1].set_title('Total Current Draw', fontweight='bold')\n",
" axes[1, 1].legend(loc='best')\n",
" axes[1, 1].grid(True, alpha=0.3)\n",
" \n",
" plt.tight_layout()\n",
" plt.show()\n",
" \n",
" return all_results"
]
},
{
"cell_type": "code",
"execution_count": null,
"metadata": {},
"outputs": [],
"source": [
"# Compare different starting heights\n",
"# Uncomment and run to test multiple initial conditions\n",
"\n",
"# comparison_results = compare_initial_conditions(\n",
"# initial_gaps_mm=[10.0, 14.0, 18.0, 22.0],\n",
"# max_steps=2000\n",
"# )"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"---\n",
"## Test Disturbance Rejection\n",
"\n",
"Apply a sudden force disturbance and observe recovery."
]
},
{
"cell_type": "code",
"execution_count": null,
"metadata": {},
"outputs": [],
"source": [
"# Test disturbance rejection\n",
"# Uncomment and run to test disturbance response\n",
"\n",
"# Example 1: Impulse disturbance (one-time force)\n",
"# disturbance_results = run_pid_simulation(\n",
"# initial_gap_mm=16.5, # Start near target\n",
"# max_steps=3000,\n",
"# use_gui=False,\n",
"# disturbance_step=720, # Apply at 3 seconds\n",
"# disturbance_force=-20.0, # 20N downward push\n",
"# verbose=True\n",
"# )\n",
"# plot_results(disturbance_results, title_suffix=' (with 20N impulse at t=3s)')\n",
"\n",
"# Example 2: Continuous stochastic noise\n",
"# noisy_results = run_pid_simulation(\n",
"# initial_gap_mm=16.5,\n",
"# max_steps=3000,\n",
"# use_gui=False,\n",
"# disturbance_force_std=2.0, # 2N standard deviation continuous noise\n",
"# verbose=True\n",
"# )\n",
"# plot_results(noisy_results, title_suffix=' (with 2N std continuous noise)')"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"---\n",
"## Summary Statistics"
]
},
{
"cell_type": "code",
"execution_count": null,
"metadata": {},
"outputs": [],
"source": [
"def print_summary(data: dict):\n",
" \"\"\"Print summary statistics for a simulation run.\"\"\"\n",
" target_gap_mm = TARGET_GAP * 1000\n",
" \n",
" # Calculate settling time (within 2% of target)\n",
" tolerance = 0.02 * target_gap_mm\n",
" settled_idx = None\n",
" for i in range(len(data['gap_avg'])):\n",
" if abs(data['gap_avg'][i] - target_gap_mm) < tolerance:\n",
" # Check if it stays settled\n",
" if all(abs(data['gap_avg'][j] - target_gap_mm) < tolerance \n",
" for j in range(i, min(i+100, len(data['gap_avg'])))):\n",
" settled_idx = i\n",
" break\n",
" \n",
" print(\"=\" * 50)\n",
" print(\"SIMULATION SUMMARY\")\n",
" print(\"=\" * 50)\n",
" print(f\"Duration: {data['time'][-1]:.2f} seconds ({len(data['time'])} steps)\")\n",
" print(f\"Target gap: {target_gap_mm:.2f} mm\")\n",
" print()\n",
" print(\"Gap Height:\")\n",
" print(f\" Initial: {data['gap_avg'][0]:.2f} mm\")\n",
" print(f\" Final: {data['gap_avg'][-1]:.2f} mm\")\n",
" print(f\" Error: {abs(data['gap_avg'][-1] - target_gap_mm):.3f} mm\")\n",
" print(f\" Max: {max(data['gap_avg']):.2f} mm\")\n",
" print(f\" Min: {min(data['gap_avg']):.2f} mm\")\n",
" if settled_idx:\n",
" print(f\" Settling time (2%): {data['time'][settled_idx]:.3f} s\")\n",
" else:\n",
" print(f\" Settling time: Not settled within tolerance\")\n",
" print()\n",
" print(\"Orientation (final):\")\n",
" print(f\" Roll: {data['roll_deg'][-1]:+.3f} degrees\")\n",
" print(f\" Pitch: {data['pitch_deg'][-1]:+.3f} degrees\")\n",
" print()\n",
" print(\"Current Draw:\")\n",
" print(f\" Average total: {np.mean(data['current_total']):.2f} A\")\n",
" print(f\" Peak total: {max(data['current_total']):.2f} A\")\n",
" print(\"=\" * 50)\n",
"\n",
"# Print summary for last simulation\n",
"print_summary(results)"
]
}
],
"metadata": {
"kernelspec": {
"display_name": "Python 3",
"language": "python",
"name": "python3"
},
"language_info": {
"name": "python",
"version": "3.11.0"
}
},
"nbformat": 4,
"nbformat_minor": 4
}

Binary file not shown.

View File

@@ -1,156 +0,0 @@
annotated-types==0.7.0
anyio==4.10.0
appnope==0.1.4
argon2-cffi==25.1.0
argon2-cffi-bindings==25.1.0
arrow==1.3.0
asttokens==3.0.0
async-lru==2.0.5
attrs==25.3.0
babel==2.17.0
beautifulsoup4==4.13.5
bleach==6.2.0
cachetools==6.2.1
certifi==2025.8.3
cffi==1.17.1
charset-normalizer==3.4.3
click==8.3.0
comm==0.2.3
contourpy==1.3.3
cycler==0.12.1
debugpy==1.8.16
decorator==5.2.1
defusedxml==0.7.1
executing==2.2.1
fastapi==0.115.0
fastjsonschema==2.21.2
fonttools==4.59.2
fqdn==1.5.1
future==1.0.0
google-ai-generativelanguage==0.6.10
google-api-core==2.26.0
google-api-python-client==2.185.0
google-auth==2.41.1
google-auth-httplib2==0.2.0
google-generativeai==0.8.3
googleapis-common-protos==1.70.0
grpcio==1.75.1
grpcio-status==1.71.2
h11==0.16.0
httpcore==1.0.9
httplib2==0.31.0
httpx==0.27.2
idna==3.10
ipykernel==6.30.1
ipython==9.5.0
ipython_pygments_lexers==1.1.1
ipywidgets==8.1.7
iso8601==2.1.0
isoduration==20.11.0
jedi==0.19.2
Jinja2==3.1.6
json5==0.12.1
jsonpointer==3.0.0
jsonschema==4.25.1
jsonschema-specifications==2025.4.1
jupyter==1.1.1
jupyter-console==6.6.3
jupyter-events==0.12.0
jupyter-lsp==2.3.0
jupyter_client==8.6.3
jupyter_core==5.8.1
jupyter_server==2.17.0
jupyter_server_terminals==0.5.3
jupyterlab==4.4.7
jupyterlab_pygments==0.3.0
jupyterlab_server==2.27.3
jupyterlab_widgets==3.0.15
kiwisolver==1.4.9
lark==1.2.2
lazy_loader==0.4
MarkupSafe==3.0.2
matplotlib==3.10.6
matplotlib-inline==0.1.7
mistune==3.1.4
mne==1.10.2
mpmath==1.3.0
nbclient==0.10.2
nbconvert==7.16.6
nbformat==5.10.4
nest-asyncio==1.6.0
notebook==7.4.5
notebook_shim==0.2.4
numpy==2.3.2
packaging==25.0
pandas==2.3.3
pandocfilters==1.5.1
parso==0.8.5
pexpect==4.9.0
pillow==11.3.0
platformdirs==4.4.0
pooch==1.8.2
prometheus_client==0.22.1
prompt_toolkit==3.0.52
proto-plus==1.26.1
protobuf==5.29.5
psutil==7.0.0
ptyprocess==0.7.0
pure_eval==0.2.3
pyasn1==0.6.1
pyasn1_modules==0.4.2
pycparser==2.22
pydantic==2.9.2
pydantic-settings==2.6.0
pydantic_core==2.23.4
Pygments==2.19.2
pyparsing==3.2.3
PyQt6==6.10.0
PyQt6-Qt6==6.10.0
PyQt6_sip==13.10.2
pyqtgraph==0.13.7
pyserial==3.5
PySide6==6.10.0
PySide6_Addons==6.10.0
PySide6_Essentials==6.10.0
python-dateutil==2.9.0.post0
python-dotenv==1.0.1
python-json-logger==3.3.0
pytz==2025.2
PyYAML==6.0.2
pyzmq==27.0.2
referencing==0.36.2
requests==2.32.5
rfc3339-validator==0.1.4
rfc3986-validator==0.1.1
rfc3987-syntax==1.1.0
rpds-py==0.27.1
rsa==4.9.1
scipy==1.16.3
Send2Trash==1.8.3
serial==0.0.97
setuptools==80.9.0
shiboken6==6.10.0
six==1.17.0
sniffio==1.3.1
soupsieve==2.8
stack-data==0.6.3
starlette==0.38.6
sympy==1.14.0
terminado==0.18.1
tinycss2==1.4.0
tornado==6.5.2
tqdm==4.67.1
traitlets==5.14.3
types-python-dateutil==2.9.0.20250822
typing_extensions==4.15.0
tzdata==2025.2
uri-template==1.3.0
uritemplate==4.2.0
urllib3==2.5.0
uvicorn==0.32.0
wcwidth==0.2.13
webcolors==24.11.1
webencodings==0.5.1
websocket-client==1.8.0
websockets==15.0.1
widgetsnbextension==4.0.14

115
ReadMe.md
View File

@@ -1,6 +1,115 @@
# Levitation Control Repository
This Repo contains the code and data from sensor calibration as well as arduino code for 4-point control on the 2-yoke test rig in the ```PIDTesting-2yoke4coil``` directory.
This code is property of Texas Guadaloop, a student-led hyperloop team from the University of Texas at Austin.
This repository contains embedded firmware, sensor characterization tooling, and a physics-based simulation stack as well as control algorithm trials for the Texas Guadaloop maglev system.
To be able to run all python files in the repo, run ```pip install -r requirements.txt```
This code is property of **Texas Guadaloop**, a student-led hyperloop team from the University of Texas at Austin.
---
## Repository Structure
```
.
├── AltSensorTesting/ # Arduino firmware for Baumer inductive sensor characterization
├── sensor/ # Python scripts to collect and fit sensor calibration data
├── loadCellCode/ # Arduino firmware for HX711 load-cell calibration
├── TwoCellMagChar/ # Two-cell magnetic characterization rig (validates Ansys data)
├── lev_sim/ # PyBullet simulation driven by Ansys sweep data
├── MAGLEV_DIGITALTWIN_PYTHON/ # Earlier single-axis analytical digital twin (reference)
├── serial_plotter.py # Live serial plotter utility
├── equilibrium.py # Equilibrium gap/current solver
└── requirements.txt # Python dependencies
```
---
## Embedded Stack
### `AltSensorTesting/`
Arduino firmware for reading Baumer inductive analog distance sensors. Uses interrupt-driven ADC sampling at ~77 kHz (16 MHz / prescaler 16) for low-latency gap measurement. Tracks the 10 lowest and 10 highest in-range ADC values over a sampling window to help establish calibration bounds. An out-of-range (OOR) digital pin is monitored in the ISR to discard invalid readings.
Key details:
- ADC ISR at ~77 kHz; readings discarded automatically when OOR pin is HIGH
- Serial commands: `1` to start sampling, `0` to stop and print boundary statistics
- Baud rate: 2,000,000
---
## Sensor Characterization
### `sensor/`
Python pipeline for converting raw ADC readings from the inductive gap sensors into calibrated millimeter distances.
- **`sensorCollector.py`** — Serial interface that reads live ADC values from Arduino and applies the calibration model in real time.
- **`analogFitter-*.py`** — Curve-fitting scripts (polynomial, exponential, 3/4/5-parameter logistic) that fit calibration sweep data (`data*.csv`) to find the best sensor model. The 5-parameter generalized logistic form was found to give the best fit.
- **`Sensor*Averages.csv` / `data*.csv`** — Raw and averaged calibration data for sensors 03. Sensor 3 required a different voltage divider (20 kΩ / 50 kΩ) because the induction sensor output exceeds 6 V.
Calibration constants (A, K, B, C, v) for the generalized logistic model are embedded directly in `sensorCollector.py` and `sensor_simplerNew.py` for deployment.
---
## Magnetic Characterization (`TwoCellMagChar/`)
A minimal bench rig used to validate Ansys Maxwell FEA force predictions experimentally.
- **`TwoCellMagChar.ino`** — Drives two H-bridge coil channels across a sweep of PWM values (250 to +250 in steps of 50) while reading two HX711 load cells simultaneously. Averages 10 measurements per PWM step and reports gram-force readings over serial.
- **`MagCharTrial.xlsx`** — Recorded force-vs-PWM data from physical trials.
- **`CalibConsts.hpp`** — Load-cell offset and scale constants shared with `loadCellCode/`.
The measured force curves confirmed that the Ansys sweep data is in reasonable agreement with physical hardware, providing confidence for using the FEA model inside the simulation.
---
## Levitation Simulation (`lev_sim/`)
A PyBullet-based simulation environment for 4-point active magnetic levitation of the pod. The simulation is driven by an Ansys Maxwell parametric sweep (coil currents × gap height × roll angle → force & torque), fitted to a polynomial regression model for fast inference.
### Data pipeline
1. **Ansys sweep**`Ansys Results 12-9.csv / .xlsx` contains FEA results sweeping left/right coil currents, roll angle, and gap height.
2. **Function Fitting**`Function Fitting.ipynb` fits the Ansys data to a `PolynomialFeatures + LinearRegression` model (inputs: `currL`, `currR`, `roll`, `1/gap`). The trained model is saved to `maglev_model.pkl`.
3. **Fast inference**`maglev_predictor.py` (`MaglevPredictor`) loads the pickle and bypasses sklearn overhead by extracting raw weight matrices, running pure-NumPy polynomial expansion for ~100× faster per-sample prediction.
### Simulation environment
`lev_pod_env.py` implements a [Gymnasium](https://gymnasium.farama.org/) `Env` wrapping PyBullet:
- **State**: 4 gap heights (normalized) + 4 gap-height velocities
- **Action**: 4 PWM duty cycles ∈ [1, 1] (front-left, front-right, back-left, back-right coils)
- **Physics**: first-order RL circuit model per coil (`mag_lev_coil.py`); coil parameters: R = 1.1 Ω, L = 2.5 mH, V_supply = 12 V, I_max = 10.2 A
- **Forces**: `MaglevPredictor.predict()` maps coil currents + gap + roll → force and torque applied to the pod body in PyBullet
- **Noise**: configurable Gaussian sensor noise (default σ = 0.1 mm) and stochastic disturbance forces
- Target equilibrium gap: 11.86 mm (9.4 kg pod)
- Simulation timestep: 1/240 s
The environment is controller-agnostic — any control algorithm can be plugged in:
| File | Controller |
|------|-----------|
| `lev_PID.ipynb` | Interactive PID tuning notebook |
| `lev_PPO.ipynb` | PPO reinforcement learning via Stable-Baselines3 |
### Supplementary Files for PID:
`pid_simulation.py`: Feedforward LUT + PID
`optuna_pid_tune.py`: Optuna-based automated PID hyperparameter search
Pre-tuned PID gain sets are saved in `pid_best_params*.json` (variants for 1500, 3000, and 6000 Optuna trials).
### PWM circuit model
`PWM_Circuit_Model.py` is a standalone electrical model of the H-bridge PWM drive circuit used for offline verification of the coil current dynamics.
---
## Setup
```bash
pip install -r requirements.txt
```
Key dependencies: `pybullet`, `gymnasium`, `stable-baselines3`, `scikit-learn`, `optuna`, `pyserial`, `numpy`, `scipy`, `pandas`, `matplotlib`.

View File

@@ -0,0 +1,139 @@
#include <Arduino.h>
#include "IndSensorMap.hpp"
#include "Controller.hpp"
#include "ADC.hpp"
#include "FastPWM.hpp"
// ── PID Gains (Kp, Ki, Kd) ──────────────────────────────────
// Height loop: controls average gap → additive PWM on all coils
PIDGains heightGains = { 100.0f, 0.0f, 8.0f };
// Roll loop: corrects left/right tilt → differential L/R
PIDGains rollGains = { 0.6f, 0.0f, -0.1f };
// Pitch loop: corrects front/back tilt → differential F/B
PIDGains pitchGains = { 50.0f, 0.0f, 1.9f };
// ── Reference ────────────────────────────────────────────────
float avgRef = 12.36f; // Target gap height (mm) — 9.4 kg equilibrium
// ── Feedforward ──────────────────────────────────────────────
bool useFeedforward = true; // Set false to disable feedforward LUT
// ── Sampling ─────────────────────────────────────────────────
#define SAMPLING_RATE 200 // Hz (controller tick rate)
// ── EMA filter alpha (all sensors) ───────────────────────────
#define ALPHA_VAL 1.0f
// ═══════════════════════════════════════════════════════════════
// ABOVE THIS LINE IS TUNING VALUES ONLY, BELOW IS ACTUAL CODE.
// ═══════════════════════════════════════════════════════════════
unsigned long tprior;
unsigned int tDiffMicros;
FullController controller(indL, indR, indF, indB,
heightGains, rollGains, pitchGains,
avgRef, useFeedforward);
const int dt_micros = 1000000 / SAMPLING_RATE;
int ON = 0;
void setup() {
Serial.begin(2000000);
setupADC();
setupFastPWM();
indL.alpha = ALPHA_VAL;
indR.alpha = ALPHA_VAL;
indF.alpha = ALPHA_VAL;
indB.alpha = ALPHA_VAL;
tprior = micros();
pinMode(dirFL, OUTPUT);
pinMode(pwmFL, OUTPUT);
pinMode(dirBL, OUTPUT);
pinMode(pwmBL, OUTPUT);
pinMode(dirFR, OUTPUT);
pinMode(pwmFR, OUTPUT);
pinMode(dirBR, OUTPUT);
pinMode(pwmBR, OUTPUT);
}
void loop() {
if (Serial.available() > 0) {
String cmd = Serial.readStringUntil('\n');
cmd.trim();
// REF,avgRef — update target gap height
if (cmd.startsWith("REF,")) {
float newRef = cmd.substring(4).toFloat();
avgRef = newRef;
controller.updateReference(avgRef);
Serial.print("Updated Ref: ");
Serial.println(avgRef);
}
// PID,loop,kp,ki,kd — update gains (loop: 0=height, 1=roll, 2=pitch)
else if (cmd.startsWith("PID,")) {
int c1 = cmd.indexOf(',');
int c2 = cmd.indexOf(',', c1 + 1);
int c3 = cmd.indexOf(',', c2 + 1);
int c4 = cmd.indexOf(',', c3 + 1);
if (c1 > 0 && c2 > 0 && c3 > 0 && c4 > 0) {
int loop = cmd.substring(c1 + 1, c2).toInt();
float kp = cmd.substring(c2 + 1, c3).toFloat();
float ki = cmd.substring(c3 + 1, c4).toFloat();
float kd = cmd.substring(c4 + 1).toFloat();
PIDGains g = { kp, ki, kd };
switch (loop) {
case 0:
heightGains = g;
controller.updateHeightPID(g);
Serial.println("Updated Height PID");
break;
case 1:
rollGains = g;
controller.updateRollPID(g);
Serial.println("Updated Roll PID");
break;
case 2:
pitchGains = g;
controller.updatePitchPID(g);
Serial.println("Updated Pitch PID");
break;
default:
Serial.println("Invalid loop (0=height, 1=roll, 2=pitch)");
break;
}
}
}
// FF,0 or FF,1 — toggle feedforward
else if (cmd.startsWith("FF,")) {
bool en = (cmd.charAt(3) != '0');
useFeedforward = en;
controller.setFeedforward(en);
Serial.print("Feedforward: ");
Serial.println(en ? "ON" : "OFF");
}
else {
// Original on/off command (any char except '0' turns on)
controller.outputOn = (cmd.charAt(0) != '0');
}
}
tDiffMicros = micros() - tprior;
if (tDiffMicros >= dt_micros) {
controller.update();
controller.report();
controller.sendOutputs();
tprior = micros();
}
}

181
embedded/lib/Controller.cpp Normal file
View File

@@ -0,0 +1,181 @@
#include "Controller.hpp"
#include <Arduino.h>
#include <math.h>
// ── Integral windup limit ────────────────────────────────────
static const float MAX_INTEGRAL = 1e4f;
// ── Feedforward LUT in PROGMEM ───────────────────────────────
// Generated by gen_ff_lut.py (pod 9.4 kg, R=1.1Ω, V=12V, 320 mm)
// Positive = repelling, Negative = attracting
static const int16_t FF_PWM_LUT[FF_LUT_SIZE] PROGMEM = {
238, 238, 238, 238, 238, 238, 238, 238,
238, 238, 238, 238, 238, 238, 238, 238,
238, 238, 234, 219, 204, 188, 172, 157,
141, 125, 109, 93, 77, 61, 45, 29,
13, -3, -19, -35, -51, -67, -84, -100,
-116, -133, -150, -166, -183, -200, -217, -234,
-250, -250, -250, -250, -250, -250, -250, -250,
-250, -250, -250, -250, -250, -250, -250, -250
};
// ── Constructor ──────────────────────────────────────────────
FullController::FullController(
IndSensor& l, IndSensor& r, IndSensor& f, IndSensor& b,
PIDGains hGains, PIDGains rGains, PIDGains pGains,
float avgRef, bool useFeedforward)
: Left(l), Right(r), Front(f), Back(b),
heightGains(hGains), rollGains(rGains), pitchGains(pGains),
heightErr({0,0,0}), rollErr({0,0,0}), pitchErr({0,0,0}),
AvgRef(avgRef), avg(0), ffEnabled(useFeedforward),
oor(false), outputOn(false),
FLPWM(0), BLPWM(0), FRPWM(0), BRPWM(0)
{}
// ── Main update (called each control tick) ───────────────────
void FullController::update() {
// 1. Read all sensors (updates mmVal, oor)
Left.readMM();
Right.readMM();
Front.readMM();
Back.readMM();
oor = Left.oor || Right.oor || Front.oor || Back.oor;
// 2. Compute average gap (mm)
avg = (Left.mmVal + Right.mmVal + Front.mmVal + Back.mmVal) * 0.25f;
// 3. Feedforward: base PWM from equilibrium LUT
int16_t ffPWM = ffEnabled ? feedforward(avg) : 0;
// 4. Height PID: error = reference - average gap
float heightE = AvgRef - avg;
heightErr.eDiff = heightE - heightErr.e;
if (!oor) {
heightErr.eInt += heightE;
heightErr.eInt = constrain(heightErr.eInt, -MAX_INTEGRAL, MAX_INTEGRAL);
}
heightErr.e = heightE;
int16_t heightPWM = pidCompute(heightGains, heightErr, CAP);
// 5. Roll PID: angle-based error (matches simulation)
// roll_angle = asin((left - right) / y_distance)
// error = -roll_angle (drive roll toward zero)
float rollRatio = (Left.mmVal - Right.mmVal) / Y_DISTANCE_MM;
rollRatio = constrain(rollRatio, -1.0f, 1.0f);
float rollAngle = asinf(rollRatio);
float rollE = -rollAngle;
rollErr.eDiff = rollE - rollErr.e;
if (!oor) {
rollErr.eInt += rollE;
rollErr.eInt = constrain(rollErr.eInt, -MAX_INTEGRAL, MAX_INTEGRAL);
}
rollErr.e = rollE;
int16_t rollPWM = pidCompute(rollGains, rollErr, CAP / 2);
// 6. Pitch PID: angle-based error (matches simulation)
// pitch_angle = asin((back - front) / x_distance)
// error = -pitch_angle (drive pitch toward zero)
float pitchRatio = (Back.mmVal - Front.mmVal) / X_DISTANCE_MM;
pitchRatio = constrain(pitchRatio, -1.0f, 1.0f);
float pitchAngle = asinf(pitchRatio);
float pitchE = -pitchAngle;
pitchErr.eDiff = pitchE - pitchErr.e;
if (!oor) {
pitchErr.eInt += pitchE;
pitchErr.eInt = constrain(pitchErr.eInt, -MAX_INTEGRAL, MAX_INTEGRAL);
}
pitchErr.e = pitchE;
int16_t pitchPWM = pidCompute(pitchGains, pitchErr, CAP / 2);
// 7. Mix outputs (same sign convention as simulation)
// FL: ff + height - roll - pitch
// FR: ff + height + roll - pitch
// BL: ff + height - roll + pitch
// BR: ff + height + roll + pitch
FLPWM = constrain(ffPWM + heightPWM - rollPWM - pitchPWM, -CAP, CAP);
FRPWM = constrain(ffPWM + heightPWM + rollPWM - pitchPWM, -CAP, CAP);
BLPWM = constrain(ffPWM + heightPWM - rollPWM + pitchPWM, -CAP, CAP);
BRPWM = constrain(ffPWM + heightPWM + rollPWM + pitchPWM, -CAP, CAP);
}
// ── PID compute (single symmetric set of gains) ─────────────
int16_t FullController::pidCompute(PIDGains& gains, PIDState& state, float maxOutput) {
if (oor) return 0;
float out = gains.kp * state.e
+ gains.ki * state.eInt
+ gains.kd * state.eDiff;
return (int16_t)constrain(out, -maxOutput, maxOutput);
}
// ── Feedforward: linearly interpolate PROGMEM LUT ────────────
int16_t FullController::feedforward(float gapMM) {
if (gapMM <= FF_GAP_MIN) return (int16_t)pgm_read_word(&FF_PWM_LUT[0]);
if (gapMM >= FF_GAP_MAX) return (int16_t)pgm_read_word(&FF_PWM_LUT[FF_LUT_SIZE - 1]);
float idx_f = (gapMM - 1.0 - FF_GAP_MIN) / FF_GAP_STEP;
uint8_t idx = (uint8_t)idx_f;
if (idx >= FF_LUT_SIZE - 1) idx = FF_LUT_SIZE - 2;
int16_t v0 = (int16_t)pgm_read_word(&FF_PWM_LUT[idx]);
int16_t v1 = (int16_t)pgm_read_word(&FF_PWM_LUT[idx + 1]);
float frac = idx_f - (float)idx;
return (int16_t)(v0 + frac * (v1 - v0));
}
// ── Zero all PWMs ────────────────────────────────────────────
void FullController::zeroPWMs() {
FLPWM = 0;
BLPWM = 0;
FRPWM = 0;
BRPWM = 0;
}
// ── Send PWM values to hardware ──────────────────────────────
void FullController::sendOutputs() {
if (!outputOn) {
zeroPWMs();
}
// Direction: LOW = repelling (positive PWM), HIGH = attracting (negative PWM)
// Using direct register writes for fast PWM mode set by setupFastPWM()
digitalWrite(dirFL, FLPWM < 0);
OCR2A = abs(FLPWM); // Pin 11 → Timer 2A
digitalWrite(dirBL, BLPWM < 0);
OCR1A = abs(BLPWM); // Pin 9 → Timer 1A
digitalWrite(dirFR, FRPWM < 0);
OCR2B = abs(FRPWM); // Pin 3 → Timer 2B
digitalWrite(dirBR, BRPWM < 0);
OCR1B = abs(BRPWM); // Pin 10 → Timer 1B
}
// ── Serial report ────────────────────────────────────────────
void FullController::report() {
// CSV: Left,Right,Front,Back,Avg,FLPWM,BLPWM,FRPWM,BRPWM,ControlOn
Serial.print(Left.mmVal); Serial.print(',');
Serial.print(Right.mmVal); Serial.print(',');
Serial.print(Front.mmVal); Serial.print(',');
Serial.print(Back.mmVal); Serial.print(',');
Serial.print(avg); Serial.print(',');
Serial.print(FLPWM); Serial.print(',');
Serial.print(BLPWM); Serial.print(',');
Serial.print(FRPWM); Serial.print(',');
Serial.print(BRPWM); Serial.print(',');
Serial.println(outputOn);
}
// ── Runtime tuning methods ───────────────────────────────────
void FullController::updateHeightPID(PIDGains gains) { heightGains = gains; }
void FullController::updateRollPID(PIDGains gains) { rollGains = gains; }
void FullController::updatePitchPID(PIDGains gains) { pitchGains = gains; }
void FullController::updateReference(float avgReference) {
AvgRef = avgReference;
}
void FullController::setFeedforward(bool enabled) {
ffEnabled = enabled;
}

View File

@@ -0,0 +1,99 @@
#ifndef CONTROLLER_HPP
#define CONTROLLER_HPP
#include <stdint.h>
#include <avr/pgmspace.h>
#include "IndSensorMap.hpp"
// ── Pin Mapping ──────────────────────────────────────────────
#define dirBL 2
#define pwmBL 3
#define dirBR 4
#define pwmBR 10
#define pwmFL 11
#define dirFL 7
#define dirFR 8
#define pwmFR 9
// ── Output Cap ───────────────────────────────────────────────
#define CAP 250 // Max PWM magnitude (0-255 Arduino range)
// ── PID Gains (single set per loop — matches simulation) ────
typedef struct PIDGains {
float kp;
float ki;
float kd;
} PIDGains;
// ── PID Error State ──────────────────────────────────────────
typedef struct PIDState {
float e; // Current error
float eDiff; // Derivative of error (e[k] - e[k-1])
float eInt; // Integral of error (accumulated)
} PIDState;
// ── Feedforward LUT (PROGMEM) ────────────────────────────────
// Generated by gen_ff_lut.py from MaglevPredictor model
// Pod mass: 9.4 kg, Coil R: 1.1Ω, V_supply: 12V
// Positive = repelling, Negative = attracting
// Beyond ~16mm: clamped to -CAP (no equilibrium exists)
#define FF_LUT_SIZE 64
#define FF_GAP_MIN 3.0f
#define FF_GAP_MAX 20.0f
#define FF_GAP_STEP 0.269841f
// ── Geometry (mm, matching simulation) ───────────────────────
// Sensor-to-sensor distances for angle computation
#define Y_DISTANCE_MM 101.6f // Left↔Right sensor spacing (mm)
#define X_DISTANCE_MM 251.8f // Front↔Back sensor spacing (mm)
// ── Controller Class ─────────────────────────────────────────
class FullController {
public:
bool oor; // Any sensor out-of-range
bool outputOn; // Enable/disable output
FullController(IndSensor& l, IndSensor& r, IndSensor& f, IndSensor& b,
PIDGains heightGains, PIDGains rollGains, PIDGains pitchGains,
float avgRef, bool useFeedforward);
void update();
void zeroPWMs();
void sendOutputs();
void report();
// Runtime tuning
void updateHeightPID(PIDGains gains);
void updateRollPID(PIDGains gains);
void updatePitchPID(PIDGains gains);
void updateReference(float avgReference);
void setFeedforward(bool enabled);
private:
int16_t pidCompute(PIDGains& gains, PIDState& state, float maxOutput);
int16_t feedforward(float gapMM);
IndSensor& Left;
IndSensor& Right;
IndSensor& Front;
IndSensor& Back;
PIDGains heightGains;
PIDGains rollGains;
PIDGains pitchGains;
PIDState heightErr;
PIDState rollErr;
PIDState pitchErr;
float AvgRef; // Target gap height (mm)
float avg; // Current average gap (mm)
bool ffEnabled; // Feedforward on/off
int16_t FLPWM;
int16_t BLPWM;
int16_t FRPWM;
int16_t BRPWM;
};
#endif // CONTROLLER_HPP

View File

@@ -58,7 +58,7 @@ float IndSensor::readMM() {
}
// Predefined sensor instances
IndSensor indL(ind1Map, A0);
IndSensor indR(ind0Map, A1);
IndSensor indF(ind3Map, A5);
IndSensor indB(ind2Map, A4);
IndSensor indF(ind1Map, A0);
IndSensor indB(ind0Map, A1);
IndSensor indR(ind3Map, A5);
IndSensor indL(ind2Map, A4);

File diff suppressed because it is too large Load Diff

File diff suppressed because one or more lines are too long

View File

@@ -0,0 +1,164 @@
import numpy as np
import matplotlib.pyplot as plt
from scipy.signal import TransferFunction, lsim
# ============================================================
# Circuit Parameters
# ============================================================
R = 1.5 # Resistance [Ω]
L = 0.0025 # Inductance [H] (2.5 mH)
V_SUPPLY = 12.0 # Supply rail [V]
tau = L / R # RL time constant ≈ 1.667 ms
# ============================================================
# PWM Parameters
# ============================================================
F_PWM = 16e3 # PWM frequency [Hz]
T_PWM = 1.0 / F_PWM # PWM period [s] (62.5 µs)
# ============================================================
# Simulation Window
# ============================================================
T_END = 1e-3 # 1 ms → 16 full PWM cycles
DT = 1e-7 # 100 ns resolution (625 pts / PWM cycle)
t = np.arange(0, T_END + DT / 2, DT)
# ============================================================
# Duty-Cycle Command D(t)
# ============================================================
# Ramp from 20 % → 80 % over the window so every PWM cycle
# has a visibly different pulse width.
def duty_command(t_val):
"""Continuous duty-cycle setpoint (from a controller)."""
return np.clip(0.2 + 0.6 * (np.asarray(t_val) / T_END), 0.0, 1.0)
D_continuous = duty_command(t)
# ============================================================
# MODEL 1 — Abstracted (Average-Voltage) Approximation
# ============================================================
# Treats the coil voltage as the smooth signal D(t)·V.
# Transfer function: I(s)/D(s) = V / (Ls + R)
G = TransferFunction([V_SUPPLY], [L, R])
_, i_avg, _ = lsim(G, U=D_continuous, T=t)
# ============================================================
# MODEL 2 — True PWM Waveform (exact analytical solution)
# ============================================================
# Between every switching edge the RL circuit obeys:
#
# di/dt = (V_seg R·i) / L (V_seg = V_SUPPLY or 0)
#
# Closed-form from initial condition i₀ at time t₀:
#
# i(t) = V_seg/R + (i₀ V_seg/R) · exp(R·(t t₀) / L)
#
# We propagate i analytically from edge to edge — zero
# numerical-integration error. The only error source is
# IEEE-754 floating-point arithmetic (~1e-15 relative).
# --- Step 1: build segment table and propagate boundary currents ---
seg_t_start = [] # start time of each constant-V segment
seg_V = [] # voltage applied during segment
seg_i0 = [] # current at segment start
i_boundary = 0.0 # coil starts de-energised
cycle = 0
while cycle * T_PWM < T_END:
t_cycle = cycle * T_PWM
D = float(duty_command(t_cycle))
# ---- ON phase (V_SUPPLY applied) ----
t_on_start = t_cycle
t_on_end = min(t_cycle + D * T_PWM, T_END)
if t_on_end > t_on_start:
seg_t_start.append(t_on_start)
seg_V.append(V_SUPPLY)
seg_i0.append(i_boundary)
dt_on = t_on_end - t_on_start
i_boundary = (V_SUPPLY / R) + (i_boundary - V_SUPPLY / R) * np.exp(-R * dt_on / L)
# ---- OFF phase (0 V applied, free-wheeling through diode) ----
t_off_start = t_on_end
t_off_end = min((cycle + 1) * T_PWM, T_END)
if t_off_end > t_off_start:
seg_t_start.append(t_off_start)
seg_V.append(0.0)
seg_i0.append(i_boundary)
dt_off = t_off_end - t_off_start
i_boundary = i_boundary * np.exp(-R * dt_off / L)
cycle += 1
seg_t_start = np.array(seg_t_start)
seg_V = np.array(seg_V)
seg_i0 = np.array(seg_i0)
# --- Step 2: evaluate on the dense time array (vectorised) ---
idx = np.searchsorted(seg_t_start, t, side='right') - 1
idx = np.clip(idx, 0, len(seg_t_start) - 1)
dt_in_seg = t - seg_t_start[idx]
V_at_t = seg_V[idx]
i0_at_t = seg_i0[idx]
i_pwm = (V_at_t / R) + (i0_at_t - V_at_t / R) * np.exp(-R * dt_in_seg / L)
v_pwm = V_at_t # switching waveform for plotting
v_avg = D_continuous * V_SUPPLY # average-model voltage
# ============================================================
# Console Output — sanity-check steady-state values
# ============================================================
print(f"RL time constant τ = L/R = {tau*1e3:.3f} ms")
print(f"PWM period T = 1/f = {T_PWM*1e6:.1f} µs")
print(f"Sim resolution Δt = {DT*1e9:.0f} ns ({int(T_PWM/DT)} pts/cycle)")
print()
print("Expected steady-state currents i_ss = (V/R)·D :")
for d in [0.2, 0.4, 0.6, 0.8]:
print(f" D = {d:.1f} → i_ss = {V_SUPPLY / R * d:.3f} A")
# ============================================================
# Plotting — 4-panel comparison
# ============================================================
t_us = t * 1e6 # time axis in µs
fig, axes = plt.subplots(4, 1, figsize=(14, 10), sharex=True)
fig.suptitle("PWM RL-Circuit Model Comparison (16 kHz, 1 ms window)",
fontsize=13, fontweight='bold')
# --- 1. Duty-cycle command ---
ax = axes[0]
ax.plot(t_us, D_continuous * 100, color='tab:purple', linewidth=1.2)
ax.set_ylabel("Duty Cycle [%]")
ax.set_ylim(0, 100)
ax.grid(True, alpha=0.3)
# --- 2. Voltage waveforms ---
ax = axes[1]
ax.plot(t_us, v_pwm, color='tab:orange', linewidth=0.6, label="True PWM voltage")
ax.plot(t_us, v_avg, color='tab:blue', linewidth=1.4, label="Average voltage D·V",
linestyle='--')
ax.set_ylabel("Voltage [V]")
ax.set_ylim(-0.5, V_SUPPLY + 1)
ax.legend(loc='upper left', fontsize=9)
ax.grid(True, alpha=0.3)
# --- 3. Current comparison ---
ax = axes[2]
ax.plot(t_us, i_pwm, color='tab:red', linewidth=0.7, label="True PWM current (exact)")
ax.plot(t_us, i_avg, color='tab:blue', linewidth=1.4, label="Averaged-model current",
linestyle='--')
ax.set_ylabel("Current [A]")
ax.legend(loc='upper left', fontsize=9)
ax.grid(True, alpha=0.3)
# --- 4. Difference / ripple ---
ax = axes[3]
ax.plot(t_us, (i_pwm - i_avg) * 1e3, color='tab:green', linewidth=0.7)
ax.set_ylabel("Δi (PWM avg) [mA]")
ax.set_xlabel("Time [µs]")
ax.grid(True, alpha=0.3)
plt.tight_layout()
plt.show()

View File

Before

Width:  |  Height:  |  Size: 115 KiB

After

Width:  |  Height:  |  Size: 115 KiB

View File

Before

Width:  |  Height:  |  Size: 221 KiB

After

Width:  |  Height:  |  Size: 221 KiB

View File

Before

Width:  |  Height:  |  Size: 282 KiB

After

Width:  |  Height:  |  Size: 282 KiB

View File

Before

Width:  |  Height:  |  Size: 159 KiB

After

Width:  |  Height:  |  Size: 159 KiB

View File

@@ -0,0 +1,362 @@
"""
Magnetic Levitation Jacobian Linearizer
Computes the local linear (Jacobian) approximation of the degree-6 polynomial
force/torque model at any operating point. The result is an LTI gain matrix
that relates small perturbations in (currL, currR, roll, gap_height) to
perturbations in (Force, Torque):
[ΔF ] [∂F/∂currL ∂F/∂currR ∂F/∂roll ∂F/∂gap] [ΔcurrL ]
[ΔTau] ≈ J [∂T/∂currL ∂T/∂currR ∂T/∂roll ∂T/∂gap] [ΔcurrR ]
[Δroll ]
[Δgap ]
Since the polynomial is analytic, all derivatives are computed exactly
(symbolic differentiation of the power-product terms), NOT by finite
differences.
The chain rule is applied automatically to convert the internal invGap
(= 1/gap_height) variable back to physical gap_height [mm].
Usage:
lin = MaglevLinearizer("maglev_model.pkl")
plant = lin.linearize(currL=-15, currR=-15, roll=0.0, gap_height=10.0)
print(plant)
print(plant.dF_dcurrL) # single gain
print(plant.control_jacobian) # 2×2 matrix mapping ΔcurrL/R → ΔF/ΔT
f, t = plant.predict(delta_currL=0.5) # quick what-if
"""
import numpy as np
import joblib
import os
class LinearizedPlant:
"""
Holds the Jacobian linearization of the force/torque model at one
operating point.
Attributes
----------
operating_point : dict
The (currL, currR, roll, gap_height) where linearization was computed.
f0 : float
Force [N] at the operating point.
tau0 : float
Torque [mN·m] at the operating point.
jacobian : ndarray, shape (2, 4)
Full Jacobian:
Row 0 = Force derivatives, Row 1 = Torque derivatives.
Columns = [currL [A], currR [A], rollDeg [deg], gap_height [mm]]
"""
INPUT_LABELS = ['currL [A]', 'currR [A]', 'rollDeg [deg]', 'gap_height [mm]']
def __init__(self, operating_point, f0, tau0, jacobian):
self.operating_point = operating_point
self.f0 = f0
self.tau0 = tau0
self.jacobian = jacobian
# ---- Individual gain accessors ----
@property
def dF_dcurrL(self):
"""∂Force/∂currL [N/A] at operating point."""
return self.jacobian[0, 0]
@property
def dF_dcurrR(self):
"""∂Force/∂currR [N/A] at operating point."""
return self.jacobian[0, 1]
@property
def dF_droll(self):
"""∂Force/∂roll [N/deg] at operating point."""
return self.jacobian[0, 2]
@property
def dF_dgap(self):
"""∂Force/∂gap_height [N/mm] at operating point.
Typically positive (unstable): force increases as gap shrinks.
"""
return self.jacobian[0, 3]
@property
def dT_dcurrL(self):
"""∂Torque/∂currL [mN·m/A] at operating point."""
return self.jacobian[1, 0]
@property
def dT_dcurrR(self):
"""∂Torque/∂currR [mN·m/A] at operating point."""
return self.jacobian[1, 1]
@property
def dT_droll(self):
"""∂Torque/∂roll [mN·m/deg] at operating point."""
return self.jacobian[1, 2]
@property
def dT_dgap(self):
"""∂Torque/∂gap_height [mN·m/mm] at operating point."""
return self.jacobian[1, 3]
@property
def control_jacobian(self):
"""2×2 sub-matrix mapping control inputs [ΔcurrL, ΔcurrR] → [ΔF, ΔT].
This is the "B" portion of the linearized plant that the PID
controller acts through.
"""
return self.jacobian[:, :2]
@property
def state_jacobian(self):
"""2×2 sub-matrix mapping state perturbations [Δroll, Δgap] → [ΔF, ΔT].
Contains the magnetic stiffness (∂F/∂gap) and roll coupling.
This feeds into the "A" matrix of the full mechanical state-space.
"""
return self.jacobian[:, 2:]
def predict(self, delta_currL=0.0, delta_currR=0.0,
delta_roll=0.0, delta_gap=0.0):
"""
Predict force and torque using the linear approximation.
Returns (force, torque) including the nominal operating-point values.
"""
delta = np.array([delta_currL, delta_currR, delta_roll, delta_gap])
perturbation = self.jacobian @ delta
return self.f0 + perturbation[0], self.tau0 + perturbation[1]
def __repr__(self):
op = self.operating_point
lines = [
f"LinearizedPlant @ currL={op['currL']:.1f}A, "
f"currR={op['currR']:.1f}A, "
f"roll={op['roll']:.2f}°, "
f"gap={op['gap_height']:.2f}mm",
f" F₀ = {self.f0:+.4f} N τ₀ = {self.tau0:+.4f} mN·m",
f" ∂F/∂currL = {self.dF_dcurrL:+.4f} N/A "
f"∂T/∂currL = {self.dT_dcurrL:+.4f} mN·m/A",
f" ∂F/∂currR = {self.dF_dcurrR:+.4f} N/A "
f"∂T/∂currR = {self.dT_dcurrR:+.4f} mN·m/A",
f" ∂F/∂roll = {self.dF_droll:+.4f} N/deg "
f"∂T/∂roll = {self.dT_droll:+.4f} mN·m/deg",
f" ∂F/∂gap = {self.dF_dgap:+.4f} N/mm "
f"∂T/∂gap = {self.dT_dgap:+.4f} mN·m/mm",
]
return '\n'.join(lines)
class MaglevLinearizer:
"""
Jacobian linearizer for the polynomial maglev force/torque model.
Loads the same .pkl model as MaglevPredictor, but instead of just
evaluating the polynomial, computes exact analytical partial derivatives
at any operating point.
"""
def __init__(self, model_path='maglev_model.pkl'):
if not os.path.exists(model_path):
raise FileNotFoundError(
f"Model file '{model_path}' not found. "
"Train and save the model from Function Fitting.ipynb first."
)
data = joblib.load(model_path)
poly_transformer = data['poly_features']
linear_model = data['model']
# powers_: (n_terms, n_inputs) — exponent matrix from sklearn
# Transpose to (n_inputs, n_terms) for broadcasting with x[:, None]
self.powers = poly_transformer.powers_.T.astype(np.float64)
self.force_coef = linear_model.coef_[0] # (n_terms,)
self.torque_coef = linear_model.coef_[1] # (n_terms,)
self.force_intercept = linear_model.intercept_[0]
self.torque_intercept = linear_model.intercept_[1]
self.degree = data['degree']
self.n_terms = self.powers.shape[1]
def _to_internal(self, currL, currR, roll, gap_height):
"""Convert physical inputs to the polynomial's internal variables."""
invGap = 1.0 / max(gap_height, 1e-6)
return np.array([currL, currR, roll, invGap], dtype=np.float64)
def evaluate(self, currL, currR, roll, gap_height):
"""
Evaluate the full (nonlinear) polynomial at a single point.
Returns
-------
force : float [N]
torque : float [mN·m]
"""
x = self._to_internal(currL, currR, roll, gap_height)
poly_features = np.prod(x[:, None] ** self.powers, axis=0)
force = np.dot(self.force_coef, poly_features) + self.force_intercept
torque = np.dot(self.torque_coef, poly_features) + self.torque_intercept
return float(force), float(torque)
def _jacobian_internal(self, x):
"""
Compute the 2×4 Jacobian w.r.t. the internal polynomial variables
(currL, currR, rollDeg, invGap).
For each variable x_k, the partial derivative of a polynomial term
c · x₁^a₁ · x₂^a₂ · x₃^a₃ · x₄^a₄
is:
c · a_k · x_k^(a_k - 1) · ∏_{j≠k} x_j^a_j
This is computed vectorised over all terms simultaneously.
"""
jac = np.zeros((2, 4))
for k in range(4):
# a_k for every term — this becomes the multiplicative scale
scale = self.powers[k, :] # (n_terms,)
# Reduce the k-th exponent by 1 (floored at 0; the scale
# factor of 0 for constant-in-x_k terms zeros those out)
deriv_powers = self.powers.copy()
deriv_powers[k, :] = np.maximum(deriv_powers[k, :] - 1.0, 0.0)
# Evaluate the derivative polynomial
poly_terms = np.prod(x[:, None] ** deriv_powers, axis=0)
deriv_features = scale * poly_terms # (n_terms,)
jac[0, k] = np.dot(self.force_coef, deriv_features)
jac[1, k] = np.dot(self.torque_coef, deriv_features)
return jac
def linearize(self, currL, currR, roll, gap_height):
"""
Compute the Jacobian linearization at the given operating point.
Parameters
----------
currL : float Left coil current [A]
currR : float Right coil current [A]
roll : float Roll angle [deg]
gap_height : float Air gap [mm]
Returns
-------
LinearizedPlant
Contains the operating-point values (F₀, τ₀) and the 2×4
Jacobian with columns [currL, currR, roll, gap_height].
"""
x = self._to_internal(currL, currR, roll, gap_height)
f0, tau0 = self.evaluate(currL, currR, roll, gap_height)
# Jacobian in internal coordinates (w.r.t. invGap in column 3)
jac_internal = self._jacobian_internal(x)
# Chain rule: ∂f/∂gap = ∂f/∂invGap · d(invGap)/d(gap)
# = ∂f/∂invGap · (1 / gap²)
jac = jac_internal.copy()
jac[:, 3] *= -1.0 / (gap_height ** 2)
return LinearizedPlant(
operating_point={
'currL': currL, 'currR': currR,
'roll': roll, 'gap_height': gap_height,
},
f0=f0,
tau0=tau0,
jacobian=jac,
)
def gain_schedule(self, gap_heights, currL, currR, roll=0.0):
"""
Precompute linearizations across a range of gap heights at fixed
current and roll. Useful for visualising how plant gains vary
and for designing a gain-scheduled PID.
Parameters
----------
gap_heights : array-like of float [mm]
currL, currR : float [A]
roll : float [deg], default 0
Returns
-------
list of LinearizedPlant, one per gap height
"""
return [
self.linearize(currL, currR, roll, g)
for g in gap_heights
]
# ==========================================================================
# Demo / quick validation
# ==========================================================================
if __name__ == '__main__':
import sys
model_path = os.path.join(os.path.dirname(__file__), 'maglev_model.pkl')
lin = MaglevLinearizer(model_path)
# --- Single-point linearization ---
print("=" * 70)
print("SINGLE-POINT LINEARIZATION")
print("=" * 70)
plant = lin.linearize(currL=-15, currR=-15, roll=0.0, gap_height=10.0)
print(plant)
print()
# Quick sanity check: compare linear prediction vs full polynomial
dc = 0.5 # small current perturbation
f_lin, t_lin = plant.predict(delta_currL=dc)
f_act, t_act = lin.evaluate(-15 + dc, -15, 0.0, 10.0)
print(f"Linearised vs Actual (ΔcurrL = {dc:+.1f} A):")
print(f" Force: {f_lin:.4f} vs {f_act:.4f} (err {abs(f_lin-f_act):.6f} N)")
print(f" Torque: {t_lin:.4f} vs {t_act:.4f} (err {abs(t_lin-t_act):.6f} mN·m)")
print()
# --- Gain schedule across gap heights ---
print("=" * 70)
print("GAIN SCHEDULE (currL = currR = -15 A, roll = 0°)")
print("=" * 70)
gaps = [6, 8, 10, 12, 15, 20, 25]
plants = lin.gain_schedule(gaps, currL=-15, currR=-15, roll=0.0)
header = f"{'Gap [mm]':>10} {'F₀ [N]':>10} {'∂F/∂iL':>10} {'∂F/∂iR':>10} {'∂F/∂gap':>10} {'∂T/∂iL':>12} {'∂T/∂iR':>12}"
print(header)
print("-" * len(header))
for p in plants:
g = p.operating_point['gap_height']
print(
f"{g:10.1f} {p.f0:10.3f} {p.dF_dcurrL:10.4f} "
f"{p.dF_dcurrR:10.4f} {p.dF_dgap:10.4f} "
f"{p.dT_dcurrL:12.4f} {p.dT_dcurrR:12.4f}"
)
print()
# --- Note on PID usage ---
print("=" * 70)
print("NOTES FOR PID DESIGN")
print("=" * 70)
print("""
At each operating point, the linearized electromagnetic plant is:
[ΔF ] [∂F/∂iL ∂F/∂iR] [ΔiL] [∂F/∂roll ∂F/∂gap] [Δroll]
[ΔTau] = [∂T/∂iL ∂T/∂iR] [ΔiR] + [∂T/∂roll ∂T/∂gap] [Δgap ]
^^^^^^^^^^^^^^^^ ^^^^^^^^^^^^^^^^^^^^
control_jacobian state_jacobian
The full mechanical dynamics (linearized) are:
m · Δg̈ap = ΔF - m·g (vertical — note ∂F/∂gap > 0 means unstable)
Iz · Δroll̈ = ΔTau (roll)
So the PID loop sees:
control_jacobian → the gain from current commands to force/torque
state_jacobian → the coupling from state perturbations (acts like
a destabilising spring for gap, restoring for roll)
""")

View File

@@ -0,0 +1,653 @@
"""
Full Linearized State-Space Model for the Guadaloop Maglev Pod
==============================================================
Combines three dynamic layers into a single LTI system ẋ = Ax + Bu, y = Cx:
Layer 1 — Coil RL dynamics (electrical):
di/dt = (V·pwm R·i) / L
This is already linear. A first-order lag from PWM command to current.
Layer 2 — Electromagnetic force/torque map (from Ansys polynomial):
(F, τ) = f(iL, iR, roll, gap)
Nonlinear, but the MaglevLinearizer gives us the Jacobian at any
operating point, making it locally linear.
Layer 3 — Rigid-body mechanics (Newton/Euler):
m·z̈ = F_front + F_back m·g (heave)
Iy·θ̈ = L_arm·(F_front F_back) (pitch from force differential)
Ix·φ̈ = τ_front + τ_back (roll from magnetic torque)
These are linear once the force/torque are linearized.
The key coupling: the pod is rigid, so front and back yoke gaps are NOT
independent. They are related to the average gap and pitch angle:
gap_front = gap_avg L_arm · pitch
gap_back = gap_avg + L_arm · pitch
This means a pitch perturbation changes both yoke gaps, which changes both
yoke forces, which feeds back into the heave and pitch dynamics. The
electromagnetic Jacobian captures how force/torque respond to these gap
changes, creating the destabilizing "magnetic stiffness" that makes maglev
inherently open-loop unstable.
State vector (10 states):
x = [gap_avg, gap_vel, pitch, pitch_rate, roll, roll_rate,
i_FL, i_FR, i_BL, i_BR]
- gap_avg [m]: average air gap (track-to-yoke distance)
- gap_vel [m/s]: d(gap_avg)/dt
- pitch [rad]: rotation about Y axis (positive = back hangs lower)
- pitch_rate [rad/s]
- roll [rad]: rotation about X axis
- roll_rate [rad/s]
- i_FL..BR [A]: the four coil currents
Input vector (4 inputs):
u = [pwm_FL, pwm_FR, pwm_BL, pwm_BR] (duty cycles, dimensionless)
Output vector (3 outputs):
y = [gap_avg, pitch, roll]
"""
import numpy as np
import os
from maglev_linearizer import MaglevLinearizer
# ---------------------------------------------------------------------------
# Physical constants and unit conversions
# ---------------------------------------------------------------------------
GRAVITY = 9.81 # m/s²
DEG2RAD = np.pi / 180.0
RAD2DEG = 180.0 / np.pi
# State indices (for readability)
GAP, GAPV, PITCH, PITCHV, ROLL, ROLLV, I_FL, I_FR, I_BL, I_BR = range(10)
# ===================================================================
# StateSpaceResult — the output container
# ===================================================================
class StateSpaceResult:
"""
Holds the A, B, C, D matrices of the linearized plant plus
operating-point metadata and stability analysis.
"""
STATE_LABELS = [
'gap_avg [m]', 'gap_vel [m/s]',
'pitch [rad]', 'pitch_rate [rad/s]',
'roll [rad]', 'roll_rate [rad/s]',
'i_FL [A]', 'i_FR [A]', 'i_BL [A]', 'i_BR [A]',
]
INPUT_LABELS = ['pwm_FL', 'pwm_FR', 'pwm_BL', 'pwm_BR']
OUTPUT_LABELS = ['gap_avg [m]', 'pitch [rad]', 'roll [rad]']
def __init__(self, A, B, C, D, operating_point,
equilibrium_force_error, plant_front, plant_back):
self.A = A
self.B = B
self.C = C
self.D = D
self.operating_point = operating_point
self.equilibrium_force_error = equilibrium_force_error
self.plant_front = plant_front # LinearizedPlant for front yoke
self.plant_back = plant_back # LinearizedPlant for back yoke
@property
def eigenvalues(self):
"""Eigenvalues of A, sorted by decreasing real part."""
eigs = np.linalg.eigvals(self.A)
return eigs[np.argsort(-np.real(eigs))]
@property
def is_open_loop_stable(self):
return bool(np.all(np.real(self.eigenvalues) < 0))
@property
def unstable_eigenvalues(self):
eigs = self.eigenvalues
return eigs[np.real(eigs) > 1e-8]
def to_scipy(self):
"""Convert to scipy.signal.StateSpace for frequency-domain analysis."""
from scipy.signal import StateSpace
return StateSpace(self.A, self.B, self.C, self.D)
def print_A_structure(self):
"""Print the A matrix with row/column labels for physical insight."""
labels_short = ['gap', 'ġap', 'θ', 'θ̇', 'φ', 'φ̇',
'iFL', 'iFR', 'iBL', 'iBR']
print("\nA matrix (non-zero entries):")
print("-" * 65)
for i in range(10):
for j in range(10):
if abs(self.A[i, j]) > 1e-10:
print(f" A[{labels_short[i]:>3}, {labels_short[j]:>3}] "
f"= {self.A[i,j]:+12.4f}")
print("-" * 65)
def print_B_structure(self):
"""Print the B matrix with labels."""
labels_short = ['gap', 'ġap', 'θ', 'θ̇', 'φ', 'φ̇',
'iFL', 'iFR', 'iBL', 'iBR']
u_labels = ['uFL', 'uFR', 'uBL', 'uBR']
print("\nB matrix (non-zero entries):")
print("-" * 50)
for i in range(10):
for j in range(4):
if abs(self.B[i, j]) > 1e-10:
print(f" B[{labels_short[i]:>3}, {u_labels[j]:>3}] "
f"= {self.B[i,j]:+12.4f}")
print("-" * 50)
def __repr__(self):
op = self.operating_point
eigs = self.eigenvalues
at_eq = abs(self.equilibrium_force_error) < 0.5
eq_str = ('AT EQUILIBRIUM' if at_eq
else f'NOT AT EQUILIBRIUM — {self.equilibrium_force_error:+.2f} N residual')
lines = [
"=" * 70,
"LINEARIZED MAGLEV STATE-SPACE (ẋ = Ax + Bu, y = Cx)",
"=" * 70,
f"Operating point:",
f" gap = {op['gap_height']:.2f} mm, "
f"currL = {op['currL']:.2f} A, "
f"currR = {op['currR']:.2f} A, "
f"roll = {op['roll']:.1f}°, "
f"pitch = {op['pitch']:.1f}°",
f" F_front = {self.plant_front.f0:.3f} N, "
f"F_back = {self.plant_back.f0:.3f} N, "
f"F_total = {self.plant_front.f0 + self.plant_back.f0:.3f} N, "
f"Weight = {op['mass'] * GRAVITY:.3f} N",
f" >> {eq_str}",
"",
f"System: {self.A.shape[0]} states × "
f"{self.B.shape[1]} inputs × "
f"{self.C.shape[0]} outputs",
f"Open-loop stable: {self.is_open_loop_stable}",
"",
"Eigenvalues of A:",
]
# Group complex conjugate pairs
printed = set()
for i, ev in enumerate(eigs):
if i in printed:
continue
re_part = np.real(ev)
im_part = np.imag(ev)
stability = "UNSTABLE" if re_part > 1e-8 else "stable"
if abs(im_part) < 1e-6:
lines.append(
f" λ = {re_part:+12.4f} "
f" τ = {abs(1/re_part)*1000 if abs(re_part) > 1e-8 else float('inf'):.2f} ms"
f" ({stability})"
)
else:
# Find conjugate pair
for j in range(i + 1, len(eigs)):
if j not in printed and abs(eigs[j] - np.conj(ev)) < 1e-6:
printed.add(j)
break
omega_n = abs(ev)
lines.append(
f" λ = {re_part:+12.4f} ± {abs(im_part):.4f}j"
f" ω_n = {omega_n:.1f} rad/s"
f" ({stability})"
)
lines.extend(["", "=" * 70])
return '\n'.join(lines)
# ===================================================================
# MaglevStateSpace — the builder
# ===================================================================
class MaglevStateSpace:
"""
Assembles the full 10-state linearized state-space from the
electromagnetic Jacobian + rigid body dynamics + coil dynamics.
Physical parameters come from the URDF (pod.xml) and MagLevCoil.
"""
def __init__(self, linearizer,
mass=9.4,
I_roll=0.0192942414, # Ixx from pod.xml [kg·m²]
I_pitch=0.130582305, # Iyy from pod.xml [kg·m²]
coil_R=1.1, # from MagLevCoil in lev_pod_env.py
coil_L=0.0025, # 2.5 mH
V_supply=12.0, # supply voltage [V]
L_arm=0.1259): # front/back yoke X-offset [m]
self.linearizer = linearizer
self.mass = mass
self.I_roll = I_roll
self.I_pitch = I_pitch
self.coil_R = coil_R
self.coil_L = coil_L
self.V_supply = V_supply
self.L_arm = L_arm
@staticmethod
def _convert_jacobian_to_si(jac):
"""
Convert a linearizer Jacobian from mixed units to pure SI.
The linearizer returns:
Row 0: Force [N] per [A, A, deg, mm]
Row 1: Torque [mN·m] per [A, A, deg, mm]
We need:
Row 0: Force [N] per [A, A, rad, m]
Row 1: Torque [N·m] per [A, A, rad, m]
Conversion factors:
col 0,1 (current): ×1 for force, ×(1/1000) for torque
col 2 (roll): ×(180/π) for force, ×(180/π)/1000 for torque
col 3 (gap): ×1000 for force, ×(1000/1000)=×1 for torque
"""
si = np.zeros((2, 4))
# Force row — already in N
si[0, 0] = jac[0, 0] # N/A → N/A
si[0, 1] = jac[0, 1] # N/A → N/A
si[0, 2] = jac[0, 2] * RAD2DEG # N/deg → N/rad
si[0, 3] = jac[0, 3] * 1000.0 # N/mm → N/m
# Torque row — from mN·m to N·m
si[1, 0] = jac[1, 0] / 1000.0 # mN·m/A → N·m/A
si[1, 1] = jac[1, 1] / 1000.0 # mN·m/A → N·m/A
si[1, 2] = jac[1, 2] / 1000.0 * RAD2DEG # mN·m/deg → N·m/rad
si[1, 3] = jac[1, 3] # mN·m/mm → N·m/m (factors cancel)
return si
def build(self, gap_height, currL, currR, roll=0.0, pitch=0.0):
"""
Build the A, B, C, D matrices at a given operating point.
Parameters
----------
gap_height : float Average gap [mm]
currL : float Equilibrium left coil current [A] (same front & back)
currR : float Equilibrium right coil current [A]
roll : float Equilibrium roll angle [deg], default 0
pitch : float Equilibrium pitch angle [deg], default 0
Non-zero pitch means front/back gaps differ.
Returns
-------
StateSpaceResult
"""
m = self.mass
Ix = self.I_roll
Iy = self.I_pitch
R = self.coil_R
Lc = self.coil_L
V = self.V_supply
La = self.L_arm
# ------------------------------------------------------------------
# Step 1: Compute individual yoke gaps from average gap + pitch
#
# The pod is rigid. If it pitches, the front and back yoke ends
# are at different distances from the track:
# gap_front = gap_avg L_arm · sin(pitch) ≈ gap_avg L_arm · pitch
# gap_back = gap_avg + L_arm · sin(pitch) ≈ gap_avg + L_arm · pitch
#
# Sign convention (from lev_pod_env.py lines 230-232):
# positive pitch = back gap > front gap (back hangs lower)
# ------------------------------------------------------------------
pitch_rad = pitch * DEG2RAD
# L_arm [m] * sin(pitch) [rad] → meters; convert to mm for linearizer
gap_front_mm = gap_height - La * np.sin(pitch_rad) * 1000.0
gap_back_mm = gap_height + La * np.sin(pitch_rad) * 1000.0
# ------------------------------------------------------------------
# Step 2: Linearize each yoke independently
#
# Each U-yoke has its own (iL, iR) pair and sees its own gap.
# Both yokes see the same roll angle (the pod is rigid).
# The linearizer returns the Jacobian in mixed units.
# ------------------------------------------------------------------
plant_f = self.linearizer.linearize(currL, currR, roll, gap_front_mm)
plant_b = self.linearizer.linearize(currL, currR, roll, gap_back_mm)
# ------------------------------------------------------------------
# Step 3: Convert Jacobians to SI
#
# After this, all gains are in [N or N·m] per [A, A, rad, m].
# Columns: [currL, currR, roll, gap_height]
# ------------------------------------------------------------------
Jf = self._convert_jacobian_to_si(plant_f.jacobian)
Jb = self._convert_jacobian_to_si(plant_b.jacobian)
# Unpack for clarity — subscript _f = front yoke, _b = back yoke
# Force gains
kFiL_f, kFiR_f, kFr_f, kFg_f = Jf[0]
kFiL_b, kFiR_b, kFr_b, kFg_b = Jb[0]
# Torque gains
kTiL_f, kTiR_f, kTr_f, kTg_f = Jf[1]
kTiL_b, kTiR_b, kTr_b, kTg_b = Jb[1]
# ------------------------------------------------------------------
# Step 4: Assemble the A matrix (10 × 10)
#
# The A matrix encodes three kinds of coupling:
#
# (a) Kinematic identities: gap_vel = d(gap)/dt, etc.
# These are always 1.0 on the super-diagonal of the
# position/velocity pairs.
#
# (b) Electromagnetic coupling through current states:
# Coil currents produce forces/torques. The linearized
# gains (∂F/∂i, ∂T/∂i) appear in the acceleration rows.
# This is the path from current states to mechanical
# acceleration — the "plant gain" that PID acts through.
#
# (c) Electromagnetic coupling through mechanical states:
# Gap and roll perturbations change the force/torque.
# This creates feedback loops:
#
# - ∂F/∂gap < 0 → gap perturbation changes force in a
# direction that AMPLIFIES the gap error → UNSTABLE
# (magnetic stiffness is "negative spring")
#
# - ∂T/∂roll → roll perturbation changes torque;
# sign determines whether roll is self-correcting or not
#
# - Pitch couples through gap_front/gap_back dependence
# on pitch angle, creating pitch instability too
# ------------------------------------------------------------------
A = np.zeros((10, 10))
# (a) Kinematic identities
A[GAP, GAPV] = 1.0
A[PITCH, PITCHV] = 1.0
A[ROLL, ROLLV] = 1.0
# ------------------------------------------------------------------
# HEAVE: m · Δgap̈ = (ΔF_front + ΔF_back)
#
# The negative sign is because force is upward (+Z) but gap
# is measured downward (gap shrinks when pod moves up).
# At equilibrium F₀ = mg; perturbation ΔF pushes pod up → gap shrinks.
#
# Expanding ΔF using the rigid-body gap coupling:
# ΔF_front = kFg_f·(Δgap La·Δpitch) + kFr_f·Δroll + kFiL_f·ΔiFL + kFiR_f·ΔiFR
# ΔF_back = kFg_b·(Δgap + La·Δpitch) + kFr_b·Δroll + kFiL_b·ΔiBL + kFiR_b·ΔiBR
# ------------------------------------------------------------------
# Gap → gap acceleration (magnetic stiffness, UNSTABLE)
A[GAPV, GAP] = -(kFg_f + kFg_b) / m
# Pitch → gap acceleration (cross-coupling through differential gap)
A[GAPV, PITCH] = -(-kFg_f + kFg_b) * La / m
# Roll → gap acceleration
A[GAPV, ROLL] = -(kFr_f + kFr_b) / m
# Current → gap acceleration (the control path!)
A[GAPV, I_FL] = -kFiL_f / m
A[GAPV, I_FR] = -kFiR_f / m
A[GAPV, I_BL] = -kFiL_b / m
A[GAPV, I_BR] = -kFiR_b / m
# ------------------------------------------------------------------
# PITCH: Iy · Δpitcḧ = La · (ΔF_front ΔF_back)
#
# Pitch torque comes from DIFFERENTIAL FORCE, not from the
# electromagnetic torque (which acts on roll). This is because
# the front yoke is at x = +La and the back at x = La:
# τ_pitch = F_front·La F_back·La = La·(F_front F_back)
#
# At symmetric equilibrium, F_front = F_back → zero pitch torque. ✓
# A pitch perturbation breaks this symmetry through the gap coupling.
# ------------------------------------------------------------------
# Gap → pitch acceleration (zero at symmetric equilibrium)
A[PITCHV, GAP] = La * (kFg_f - kFg_b) / Iy
# Pitch → pitch acceleration (pitch instability — UNSTABLE)
# = La²·(kFg_f + kFg_b)/Iy. Since kFg < 0 → positive → unstable.
A[PITCHV, PITCH] = -La**2 * (kFg_f + kFg_b) / Iy
# Roll → pitch acceleration
A[PITCHV, ROLL] = La * (kFr_f - kFr_b) / Iy
# Current → pitch acceleration
A[PITCHV, I_FL] = La * kFiL_f / Iy
A[PITCHV, I_FR] = La * kFiR_f / Iy
A[PITCHV, I_BL] = -La * kFiL_b / Iy
A[PITCHV, I_BR] = -La * kFiR_b / Iy
# ------------------------------------------------------------------
# ROLL: Ix · Δroll̈ = Δτ_front + Δτ_back
#
# Unlike pitch (driven by force differential), roll is driven by
# the electromagnetic TORQUE directly. In the Ansys model, torque
# is the moment about the X axis produced by the asymmetric flux
# in the left vs right legs of each U-yoke.
#
# The torque Jacobian entries determine stability:
# - ∂T/∂roll: if this causes torque that amplifies roll → unstable
# - ∂T/∂iL, ∂T/∂iR: how current asymmetry controls roll
# ------------------------------------------------------------------
# Gap → roll acceleration
A[ROLLV, GAP] = (kTg_f + kTg_b) / Ix
# Pitch → roll acceleration (cross-coupling)
A[ROLLV, PITCH] = (-kTg_f + kTg_b) * La / Ix
# Roll → roll acceleration (roll stiffness)
A[ROLLV, ROLL] = (kTr_f + kTr_b) / Ix
# Current → roll acceleration
A[ROLLV, I_FL] = kTiL_f / Ix
A[ROLLV, I_FR] = kTiR_f / Ix
A[ROLLV, I_BL] = kTiL_b / Ix
A[ROLLV, I_BR] = kTiR_b / Ix
# ------------------------------------------------------------------
# COIL DYNAMICS: L·di/dt = V·pwm R·i
#
# Rearranged: di/dt = (R/L)·i + (V/L)·pwm
#
# This is a simple first-order lag with:
# - Time constant τ_coil = L/R = 2.5ms/1.1 = 2.27 ms
# - Eigenvalue = R/L = 440 (very fast, well-damped)
#
# The coil dynamics act as a low-pass filter between the PWM
# command and the actual current. For PID frequencies below
# ~100 Hz, this lag is small but not negligible.
# ------------------------------------------------------------------
for k in range(I_FL, I_BR + 1):
A[k, k] = -R / Lc
# ------------------------------------------------------------------
# Step 5: B matrix (10 × 4)
#
# Only the coil states respond directly to the PWM inputs.
# The mechanical states are affected INDIRECTLY: pwm → current
# → force/torque → acceleration. This indirect path shows up
# as the product A_mech_curr × B_curr_pwm in the transfer function.
#
# B[coil_k, pwm_k] = V_supply / L_coil
# ------------------------------------------------------------------
B = np.zeros((10, 4))
for k in range(4):
B[I_FL + k, k] = V / Lc
# ------------------------------------------------------------------
# Step 6: C matrix (3 × 10)
#
# Default outputs are the three controlled DOFs:
# gap_avg, pitch, roll
# These are directly the position states.
# ------------------------------------------------------------------
C = np.zeros((3, 10))
C[0, GAP] = 1.0 # gap_avg
C[1, PITCH] = 1.0 # pitch
C[2, ROLL] = 1.0 # roll
# D = 0 (no direct feedthrough from PWM to position)
D = np.zeros((3, 4))
# ------------------------------------------------------------------
# Step 7: Equilibrium check
#
# At a valid operating point, the total magnetic force should
# equal the pod weight. A large residual means the linearization
# is valid mathematically but not physically meaningful (the pod
# wouldn't hover at this point without acceleration).
# ------------------------------------------------------------------
F_total = plant_f.f0 + plant_b.f0
weight = m * GRAVITY
eq_error = F_total - weight
return StateSpaceResult(
A=A, B=B, C=C, D=D,
operating_point={
'gap_height': gap_height,
'currL': currL, 'currR': currR,
'roll': roll, 'pitch': pitch,
'mass': m,
},
equilibrium_force_error=eq_error,
plant_front=plant_f,
plant_back=plant_b,
)
def find_equilibrium_current(self, gap_height, roll=0.0, tol=0.01):
"""
Find the symmetric current (currL = currR = I) that makes
total force = weight at the given gap height.
Uses bisection over the current range. The search assumes
negative currents produce attractive (upward) force, which
matches the Ansys model convention.
Parameters
----------
gap_height : float Target gap [mm]
roll : float Roll angle [deg], default 0
tol : float Force tolerance [N]
Returns
-------
float : equilibrium current [A]
"""
target_per_yoke = self.mass * GRAVITY / 2.0
def force_residual(curr):
f, _ = self.linearizer.evaluate(curr, curr, roll, gap_height)
return f - target_per_yoke
# Bisection search over negative current range
# (More negative = stronger attraction)
a, b = -20.0, 0.0
fa, fb = force_residual(a), force_residual(b)
if fa * fb > 0:
# Try positive range too
a, b = 0.0, 20.0
fa, fb = force_residual(a), force_residual(b)
if fa * fb > 0:
raise ValueError(
f"Cannot find equilibrium current at gap={gap_height}mm. "
f"Force at I=20A: {target_per_yoke + force_residual(-20):.1f}N, "
f"at I=0: {target_per_yoke + force_residual(0):.1f}N, "
f"at I=+20A: {target_per_yoke + force_residual(20):.1f}N, "
f"target per yoke: {target_per_yoke:.1f}N"
)
for _ in range(100):
mid = (a + b) / 2.0
fmid = force_residual(mid)
if abs(fmid) < tol:
return mid
if fa * fmid < 0:
b = mid
else:
a, fa = mid, fmid
return (a + b) / 2.0
# ======================================================================
# Demo
# ======================================================================
if __name__ == '__main__':
model_path = os.path.join(os.path.dirname(__file__), 'maglev_model.pkl')
lin = MaglevLinearizer(model_path)
ss = MaglevStateSpace(lin)
# ------------------------------------------------------------------
# Find the equilibrium current at the target gap
# ------------------------------------------------------------------
TARGET_GAP_MM = 16.491741 # from lev_pod_env.py
print("=" * 70)
print("FINDING EQUILIBRIUM CURRENT")
print("=" * 70)
I_eq = ss.find_equilibrium_current(TARGET_GAP_MM)
F_eq, T_eq = lin.evaluate(I_eq, I_eq, 0.0, TARGET_GAP_MM)
print(f"Target gap: {TARGET_GAP_MM:.3f} mm")
print(f"Pod weight: {ss.mass * GRAVITY:.3f} N ({ss.mass} kg)")
print(f"Required per yoke: {ss.mass * GRAVITY / 2:.3f} N")
print(f"Equilibrium current: {I_eq:.4f} A (symmetric, currL = currR)")
print(f"Force per yoke at equilibrium: {F_eq:.3f} N")
print(f"Equilibrium PWM duty cycle: {I_eq * ss.coil_R / ss.V_supply:.4f}")
print()
# ------------------------------------------------------------------
# Build the state-space at equilibrium
# ------------------------------------------------------------------
result = ss.build(
gap_height=TARGET_GAP_MM,
currL=I_eq,
currR=I_eq,
roll=0.0,
pitch=0.0,
)
print(result)
print()
# ------------------------------------------------------------------
# Show the coupling structure
# ------------------------------------------------------------------
result.print_A_structure()
result.print_B_structure()
# ------------------------------------------------------------------
# Physical interpretation of key eigenvalues
# ------------------------------------------------------------------
eigs = result.eigenvalues
unstable = result.unstable_eigenvalues
print(f"\nUnstable modes: {len(unstable)}")
for ev in unstable:
# Time to double = ln(2) / real_part
t_double = np.log(2) / np.real(ev) * 1000 # ms
print(f" λ = {np.real(ev):+.4f} → amplitude doubles in {t_double:.1f} ms")
print()
print("The PID loop must have bandwidth FASTER than these unstable modes")
print("to stabilize the plant.")
# ------------------------------------------------------------------
# Gain schedule: how eigenvalues change with gap
# ------------------------------------------------------------------
print("\n" + "=" * 70)
print("GAIN SCHEDULE: unstable eigenvalues vs gap height")
print("=" * 70)
gaps = [8, 10, 12, 14, TARGET_GAP_MM, 18, 20, 25]
header = f"{'Gap [mm]':>10} {'I_eq [A]':>10} {'λ_heave':>12} {'t_dbl [ms]':>12} {'λ_pitch':>12} {'t_dbl [ms]':>12}"
print(header)
print("-" * len(header))
for g in gaps:
try:
I = ss.find_equilibrium_current(g)
r = ss.build(g, I, I, 0.0, 0.0)
ue = r.unstable_eigenvalues
real_ue = sorted(np.real(ue), reverse=True)
# Typically: largest = heave, second = pitch
lam_h = real_ue[0] if len(real_ue) > 0 else 0.0
lam_p = real_ue[1] if len(real_ue) > 1 else 0.0
t_h = np.log(2) / lam_h * 1000 if lam_h > 0 else float('inf')
t_p = np.log(2) / lam_p * 1000 if lam_p > 0 else float('inf')
print(f"{g:10.2f} {I:10.4f} {lam_h:+12.4f} {t_h:12.1f} "
f"{lam_p:+12.4f} {t_p:12.1f}")
except ValueError as e:
print(f"{g:10.2f} (no equilibrium found)")

1032
lev_sim/lev_PID.ipynb Normal file

File diff suppressed because one or more lines are too long

View File

@@ -4,13 +4,15 @@ import pybullet as p
import pybullet_data
import numpy as np
import os
from datetime import datetime
from mag_lev_coil import MagLevCoil
from maglev_predictor import MaglevPredictor
TARGET_GAP = 16.491741 / 1000 # target gap height for 5.8 kg pod in meters
TARGET_GAP = 11.86 / 1000 # target gap height for 9.4 kg pod in meters
class LevPodEnv(gym.Env):
def __init__(self, use_gui=False, initial_gap_mm=10.0, max_steps=2000, disturbance_force_std=0.0):
def __init__(self, use_gui=False, initial_gap_mm=10.0, max_steps=2000, disturbance_force_std=0.0,
record_video=False, record_telemetry=False, record_dir="recordings"):
super(LevPodEnv, self).__init__()
# Store initial gap height parameter
@@ -20,6 +22,17 @@ class LevPodEnv(gym.Env):
# Stochastic disturbance parameter (standard deviation of random force in Newtons)
self.disturbance_force_std = disturbance_force_std
# Recording parameters
self.record_video = record_video
self.record_telemetry = record_telemetry
self.record_dir = record_dir
self._frame_skip = 4 # Capture every 4th step → 60fps video from 240Hz sim
self._video_width = 640
self._video_height = 480
self._frames = []
self._telemetry = {}
self._recording_active = False
# The following was coded by AI - see [1]
# --- 1. Define Action & Observation Spaces ---
@@ -143,7 +156,8 @@ class LevPodEnv(gym.Env):
if abs(local_pos[0]) < 0.06 or abs(local_pos[1]) < 0.02:
self.sensor_indices.append(i)
if abs(local_pos[0]) < 0.001: # Center sensors (X ≈ 0)
label = "Center_Right" if local_pos[1] > 0 else "Center_Left"
# +Y = Left, -Y = Right (consistent with yoke labeling)
label = "Center_Left" if local_pos[1] > 0 else "Center_Right"
else: # Front/back sensors (Y ≈ 0)
label = "Front" if local_pos[0] > 0 else "Back"
self.sensor_labels.append(label)
@@ -156,7 +170,49 @@ class LevPodEnv(gym.Env):
self.prev_sensor_gaps = None
obs = self._get_obs(initial_reset=True)
self.current_step = 0
# --- Recording setup ---
# Finalize any previous episode's recording before starting new one
if self._recording_active:
self._finalize_recording()
if self.record_video or self.record_telemetry:
self._recording_active = True
os.makedirs(self.record_dir, exist_ok=True)
if self.record_video:
self._frames = []
# Pod body center ≈ start_z, yoke tops at ≈ start_z + 0.091
# Track bottom at Z=0. Focus camera on the pod body, looking from the side
# so both the pod and the track bottom (with gap between) are visible.
pod_center_z = start_z + 0.045 # Approximate visual center of pod
self._view_matrix = p.computeViewMatrixFromYawPitchRoll(
cameraTargetPosition=[0, 0, pod_center_z],
distance=0.55,
yaw=50, # Front-right angle
pitch=-5, # Nearly horizontal to see gap from the side
roll=0,
upAxisIndex=2,
physicsClientId=self.client
)
self._proj_matrix = p.computeProjectionMatrixFOV(
fov=35, # Narrow FOV for less distortion at close range
aspect=self._video_width / self._video_height,
nearVal=0.01,
farVal=2.0,
physicsClientId=self.client
)
if self.record_telemetry:
self._telemetry = {
'time': [], 'gap_FL': [], 'gap_FR': [], 'gap_BL': [], 'gap_BR': [],
'gap_front_avg': [], 'gap_back_avg': [], 'gap_avg': [],
'roll_deg': [], 'pitch_deg': [],
'curr_FL': [], 'curr_FR': [], 'curr_BL': [], 'curr_BR': [],
'force_front': [], 'force_back': [],
'torque_front': [], 'torque_back': [],
}
return obs, {}
# The following was generated by AI - see [14]
@@ -295,7 +351,7 @@ class LevPodEnv(gym.Env):
physicsClientId=self.client
)
# --- 5b. Apply Stochastic Disturbance Force (if enabled) ---
# --- 5b. Apply Stochastic Disturbance Force and Torques (if enabled) ---
if self.disturbance_force_std > 0:
disturbance_force = np.random.normal(0, self.disturbance_force_std)
p.applyExternalForce(
@@ -305,6 +361,17 @@ class LevPodEnv(gym.Env):
flags=p.LINK_FRAME,
physicsClientId=self.client
)
# Roll and pitch disturbance torques, scaled from heave force (torque ~ force * moment_arm)
# Moment arm ~ 0.15 m so e.g. 1 N force -> 0.15 N·m torque std
disturbance_torque_std = self.disturbance_force_std * 0.15
roll_torque = np.random.normal(0, disturbance_torque_std)
pitch_torque = np.random.normal(0, disturbance_torque_std)
p.applyExternalTorque(
self.podId, -1,
torqueObj=[roll_torque, pitch_torque, 0],
flags=p.LINK_FRAME,
physicsClientId=self.client
)
# --- 6. Step Simulation ---
p.stepSimulation(physicsClientId=self.client)
@@ -318,8 +385,8 @@ class LevPodEnv(gym.Env):
obs = self._get_obs()
# --- 8. Calculate Reward ---
# Goal: Hover at target gap (16.5mm), minimize roll/pitch, minimize power
target_gap = TARGET_GAP # 16.5mm in meters
# Goal: Hover at target gap (11.8mm), minimize roll/pitch, minimize power
target_gap = TARGET_GAP # 11.8mm in meters
avg_gap = (avg_gap_front + avg_gap_back) / 2
gap_error = abs(avg_gap - target_gap)
@@ -390,7 +457,43 @@ class LevPodEnv(gym.Env):
'torque_front': torque_front,
'torque_back': torque_back
}
# --- Recording ---
if self.record_video and self.current_step % self._frame_skip == 0:
_, _, rgb, _, _ = p.getCameraImage(
width=self._video_width,
height=self._video_height,
viewMatrix=self._view_matrix,
projectionMatrix=self._proj_matrix,
physicsClientId=self.client
)
self._frames.append(np.array(rgb, dtype=np.uint8).reshape(
self._video_height, self._video_width, 4)[:, :, :3]) # RGBA → RGB
if self.record_telemetry:
t = self._telemetry
t['time'].append(self.current_step * self.dt)
t['gap_FL'].append(front_left_gap * 1000)
t['gap_FR'].append(front_right_gap * 1000)
t['gap_BL'].append(back_left_gap * 1000)
t['gap_BR'].append(back_right_gap * 1000)
t['gap_front_avg'].append(avg_gap_front * 1000)
t['gap_back_avg'].append(avg_gap_back * 1000)
t['gap_avg'].append(avg_gap * 1000)
t['roll_deg'].append(np.degrees(roll_angle))
t['pitch_deg'].append(np.degrees(pitch_angle))
t['curr_FL'].append(curr_front_L)
t['curr_FR'].append(curr_front_R)
t['curr_BL'].append(curr_back_L)
t['curr_BR'].append(curr_back_R)
t['force_front'].append(force_front)
t['force_back'].append(force_back)
t['torque_front'].append(torque_front)
t['torque_back'].append(torque_back)
if terminated or truncated:
self._finalize_recording()
return obs, reward, terminated, truncated, info
def apply_impulse(self, force_z: float, position: list = None):
@@ -411,6 +514,20 @@ class LevPodEnv(gym.Env):
physicsClientId=self.client
)
def apply_torque_impulse(self, torque_nm: list):
"""
Apply a one-time impulse torque to the pod (body frame).
Args:
torque_nm: [Tx, Ty, Tz] in N·m (LINK_FRAME: X=roll, Y=pitch, Z=yaw)
"""
p.applyExternalTorque(
self.podId, -1,
torqueObj=torque_nm,
flags=p.LINK_FRAME,
physicsClientId=self.client
)
# The following was generated by AI - see [15]
def _get_obs(self, initial_reset=False):
"""
@@ -511,12 +628,103 @@ class LevPodEnv(gym.Env):
return temp_urdf_path
def _finalize_recording(self):
"""Save recorded video and/or telemetry plot to disk."""
if not self._recording_active:
return
self._recording_active = False
timestamp = datetime.now().strftime("%Y%m%d_%H%M%S")
# --- Save video ---
if self.record_video and len(self._frames) > 0:
import imageio.v3 as iio
video_path = os.path.join(self.record_dir, f"sim_{timestamp}.mp4")
fps = int(round(1.0 / (self.dt * self._frame_skip))) # 60fps
iio.imwrite(video_path, self._frames, fps=fps, codec="h264")
print(f"Video saved: {video_path} ({len(self._frames)} frames, {fps}fps)")
self._frames = []
# --- Save telemetry plot ---
if self.record_telemetry and len(self._telemetry.get('time', [])) > 0:
self._save_telemetry_plot(timestamp)
def _save_telemetry_plot(self, timestamp):
"""Generate and save a 4-panel telemetry figure."""
import matplotlib.pyplot as plt
t = {k: np.array(v) for k, v in self._telemetry.items()}
time = t['time']
target_mm = TARGET_GAP * 1000
weight = 9.4 * 9.81 # Pod weight in N
fig, axes = plt.subplots(4, 1, figsize=(12, 14), sharex=True)
fig.suptitle(f'Simulation Telemetry | gap₀={self.initial_gap_mm}mm target={target_mm:.1f}mm',
fontsize=14, fontweight='bold')
# --- Panel 1: Gap heights ---
ax = axes[0]
ax.plot(time, t['gap_FL'], lw=1, alpha=0.6, label='FL')
ax.plot(time, t['gap_FR'], lw=1, alpha=0.6, label='FR')
ax.plot(time, t['gap_BL'], lw=1, alpha=0.6, label='BL')
ax.plot(time, t['gap_BR'], lw=1, alpha=0.6, label='BR')
ax.plot(time, t['gap_avg'], lw=2, color='black', label='Average')
ax.axhline(y=target_mm, color='orange', ls='--', lw=2, label=f'Target ({target_mm:.1f}mm)')
ax.set_ylabel('Gap Height (mm)')
ax.legend(loc='best', ncol=3, fontsize=9)
ax.grid(True, alpha=0.3)
final_err = abs(t['gap_avg'][-1] - target_mm)
ax.text(0.98, 0.02, f'Final error: {final_err:.3f}mm',
transform=ax.transAxes, ha='right', va='bottom', fontsize=10,
bbox=dict(boxstyle='round', facecolor='white', alpha=0.8))
# --- Panel 2: Roll & Pitch ---
ax = axes[1]
ax.plot(time, t['roll_deg'], lw=1.5, label='Roll')
ax.plot(time, t['pitch_deg'], lw=1.5, label='Pitch')
ax.axhline(y=0, color='gray', ls='--', lw=1)
ax.set_ylabel('Angle (degrees)')
ax.legend(loc='best', fontsize=9)
ax.grid(True, alpha=0.3)
# --- Panel 3: Coil currents ---
ax = axes[2]
ax.plot(time, t['curr_FL'], lw=1, alpha=0.8, label='FL')
ax.plot(time, t['curr_FR'], lw=1, alpha=0.8, label='FR')
ax.plot(time, t['curr_BL'], lw=1, alpha=0.8, label='BL')
ax.plot(time, t['curr_BR'], lw=1, alpha=0.8, label='BR')
total = np.abs(t['curr_FL']) + np.abs(t['curr_FR']) + np.abs(t['curr_BL']) + np.abs(t['curr_BR'])
ax.plot(time, total, lw=2, color='black', ls='--', label='Total |I|')
ax.set_ylabel('Current (A)')
ax.legend(loc='best', ncol=3, fontsize=9)
ax.grid(True, alpha=0.3)
# --- Panel 4: Forces ---
ax = axes[3]
ax.plot(time, t['force_front'], lw=1.5, label='Front yoke')
ax.plot(time, t['force_back'], lw=1.5, label='Back yoke')
f_total = t['force_front'] + t['force_back']
ax.plot(time, f_total, lw=2, color='black', label='Total')
ax.axhline(y=weight, color='red', ls='--', lw=1.5, label=f'Weight ({weight:.1f}N)')
ax.set_ylabel('Force (N)')
ax.set_xlabel('Time (s)')
ax.legend(loc='best', ncol=2, fontsize=9)
ax.grid(True, alpha=0.3)
plt.tight_layout()
plot_path = os.path.join(self.record_dir, f"sim_{timestamp}_telemetry.png")
fig.savefig(plot_path, dpi=200, bbox_inches='tight')
plt.close(fig)
print(f"Telemetry plot saved: {plot_path}")
self._telemetry = {}
def close(self):
self._finalize_recording()
try:
p.disconnect(physicsClientId=self.client)
except p.error:
pass # Already disconnected
def render(self):
"""Rendering is handled by PyBullet GUI mode"""
pass

BIN
lev_sim/maglev_model.pkl Normal file

Binary file not shown.

View File

@@ -14,17 +14,22 @@ import numpy as np
import joblib
import os
# Default path: next to this module so it works regardless of cwd
_DEFAULT_MODEL_PATH = os.path.join(os.path.dirname(os.path.abspath(__file__)), "maglev_model.pkl")
class MaglevPredictor:
def __init__(self, model_path='maglev_model.pkl'):
def __init__(self, model_path=None):
"""
Initialize predictor by loading the pickle file and extracting
raw matrices for fast inference.
"""
if not os.path.exists(model_path):
raise FileNotFoundError(f"Model file '{model_path}' not found. Please train and save the model first.")
path = model_path if model_path is not None else _DEFAULT_MODEL_PATH
if not os.path.exists(path):
raise FileNotFoundError(f"Model file '{path}' not found. Please train and save the model first.")
print(f"Loading maglev model from {model_path}...")
data = joblib.load(model_path)
print(f"Loading maglev model from {path}...")
data = joblib.load(path)
# 1. Extract Scikit-Learn Objects
poly_transformer = data['poly_features']

337
lev_sim/optuna_pid_tune.py Normal file
View File

@@ -0,0 +1,337 @@
"""
Optuna (TPE / Bayesian-style) optimization for the three-PID maglev controller.
Tunes all nine gains (height, roll, pitch × Kp, Ki, Kd) jointly so coupling is respected.
Noisy optimization: set disturbance_force_std > 0 so the env applies random force/torque
each step (system changes slightly each run). To keep Bayesian optimization effective,
use n_objective_repeats > 1: each candidate is evaluated multiple times and the mean cost
is returned, reducing variance so TPE can compare trials reliably.
Run from the command line or import and call run_optimization() from a notebook.
"""
import json
import os
import sys
import numpy as np
import optuna
from optuna.samplers import TPESampler
from lev_pod_env import TARGET_GAP
from pid_controller import DEFAULT_GAINS
from pid_simulation import run_pid_simulation, build_feedforward_lut
# Save pid_best_params.json next to this script so notebook and CLI find it regardless of cwd
_SCRIPT_DIR = os.path.dirname(os.path.abspath(__file__))
# Default optimization config: long enough to see late instability (~8s+), not so long that optimizer goes ultra-conservative
DEFAULT_MAX_STEPS = 1500
DEFAULT_INITIAL_GAPS_MM = [8.0, 15.0] # Two conditions for robustness (bracket 11.86mm target)
DEFAULT_N_TRIALS = 200
DEFAULT_TIMEOUT_S = 3600
TARGET_GAP_MM = TARGET_GAP * 1000
def _cost_from_data(
data: dict,
target_gap_mm: float,
penalty_early: float = 500.0,
weight_late_osc: float = 3.0,
weight_steady_state: float = 2.0,
) -> float:
"""
Single scalar cost from one run. Lower is better.
- ITAE for gap error and |roll|/|pitch| (tracking over time).
- Late-oscillation penalty: std(roll) and std(pitch) over the *last 50%* of the run,
plus max |roll|/|pitch| in that window, so gains that go unstable after ~half the run are penalized.
- Steady-state term: mean absolute gap error and mean |roll|/|pitch| over the *last 20%*,
so we reward settling at target with small angles.
- Penalty if episode ended early (crash/instability), regardless of run length.
- Small penalty on mean total current (efficiency).
"""
t = np.asarray(data["time"])
dt = np.diff(t, prepend=0.0)
gap_err_mm = np.abs(np.asarray(data["gap_avg"]) - target_gap_mm)
itae_gap = np.sum(t * gap_err_mm * dt)
roll_deg = np.asarray(data["roll_deg"])
pitch_deg = np.asarray(data["pitch_deg"])
roll_abs = np.abs(roll_deg)
pitch_abs = np.abs(pitch_deg)
itae_roll = np.sum(t * roll_abs * dt)
itae_pitch = np.sum(t * pitch_abs * dt)
n = len(t)
early_penalty = penalty_early if data.get("terminated_early", False) else 0.0
# Late half: penalize oscillation (std) and large angles (max) so "good for 6s then violent roll" is expensive
half = max(1, n // 2)
roll_last = roll_deg[-half:]
pitch_last = pitch_deg[-half:]
late_osc_roll = np.std(roll_last) + np.max(np.abs(roll_last))
late_osc_pitch = np.std(pitch_last) + np.max(np.abs(pitch_last))
late_osc_penalty = weight_late_osc * (late_osc_roll + late_osc_pitch)
# Last 20%: steady-state error — want small gap error and small roll/pitch at end
tail = max(1, n // 5)
ss_gap = np.mean(np.abs(np.asarray(data["gap_avg"])[-tail:] - target_gap_mm))
ss_roll = np.mean(roll_abs[-tail:])
ss_pitch = np.mean(pitch_abs[-tail:])
steady_state_penalty = weight_steady_state * (ss_gap + ss_roll + ss_pitch)
mean_current = np.mean(data["current_total"])
current_penalty = 0.01 * mean_current
return (
itae_gap
+ 2.0 * (itae_roll + itae_pitch)
+ early_penalty
+ late_osc_penalty
+ steady_state_penalty
+ current_penalty
)
def objective(
trial: optuna.Trial,
initial_gaps_mm: list,
max_steps: int,
use_feedforward: bool,
penalty_early: float,
disturbance_force_std: float = 0.0,
n_objective_repeats: int = 1,
) -> float:
"""
Optuna objective: suggest 9 gains, run simulation(s), return cost.
With disturbance_force_std > 0, the env applies random force/torque disturbances each step,
so the same gains yield different costs across runs. For Bayesian optimization under noise,
set n_objective_repeats > 1 to evaluate each candidate multiple times and return the mean cost,
reducing variance so TPE can compare trials reliably.
"""
# All three loops tuned together (recommended: they interact)
height_kp = trial.suggest_float("height_kp", 5.0, 200.0, log=True)
height_ki = trial.suggest_float("height_ki", 0.5, 50.0, log=True)
height_kd = trial.suggest_float("height_kd", 1.0, 50.0, log=True)
roll_kp = trial.suggest_float("roll_kp", 0.1, 20.0, log=True)
roll_ki = trial.suggest_float("roll_ki", 0.01, 5.0, log=True)
roll_kd = trial.suggest_float("roll_kd", 0.01, 5.0, log=True)
pitch_kp = trial.suggest_float("pitch_kp", 0.1, 20.0, log=True)
pitch_ki = trial.suggest_float("pitch_ki", 0.01, 5.0, log=True)
pitch_kd = trial.suggest_float("pitch_kd", 0.01, 5.0, log=True)
gains = {
"height_kp": height_kp, "height_ki": height_ki, "height_kd": height_kd,
"roll_kp": roll_kp, "roll_ki": roll_ki, "roll_kd": roll_kd,
"pitch_kp": pitch_kp, "pitch_ki": pitch_ki, "pitch_kd": pitch_kd,
}
cost_sum = 0.0
n_evals = 0
for _ in range(n_objective_repeats):
for initial_gap in initial_gaps_mm:
data = run_pid_simulation(
initial_gap_mm=initial_gap,
max_steps=max_steps,
use_gui=False,
disturbance_force_std=disturbance_force_std,
use_feedforward=use_feedforward,
record_video=False,
record_telemetry=False,
gains=gains,
verbose=False,
)
n = len(data["time"])
data["terminated_early"] = n < max_steps - 10
cost_sum += _cost_from_data(data, TARGET_GAP_MM, penalty_early=penalty_early)
n_evals += 1
return cost_sum / n_evals
def run_optimization(
n_trials: int = DEFAULT_N_TRIALS,
timeout: int = DEFAULT_TIMEOUT_S,
initial_gaps_mm: list = None,
max_steps: int = DEFAULT_MAX_STEPS,
use_feedforward: bool = True,
penalty_early: float = 500.0,
disturbance_force_std: float = 0.0,
n_objective_repeats: int = 1,
out_dir: str = None,
study_name: str = "pid_maglev",
) -> optuna.Study:
"""
Run Optuna study (TPE sampler) and save best params to JSON.
disturbance_force_std: passed to env so each step gets random force/torque noise (N).
n_objective_repeats: when > 1, each trial is evaluated this many times (different noise)
and the mean cost is returned, so Bayesian optimization sees a less noisy objective.
Returns:
study: Optuna Study (study.best_params, study.best_value).
"""
if initial_gaps_mm is None:
initial_gaps_mm = DEFAULT_INITIAL_GAPS_MM
if out_dir is None:
out_dir = _SCRIPT_DIR
# Build feedforward LUT once so first trial doesn't do it inside run
build_feedforward_lut()
sampler = TPESampler(
n_startup_trials=min(20, n_trials // 4),
n_ei_candidates=24,
seed=42,
)
study = optuna.create_study(
direction="minimize",
study_name=study_name,
sampler=sampler,
)
study.optimize(
lambda t: objective(
t,
initial_gaps_mm=initial_gaps_mm,
max_steps=max_steps,
use_feedforward=use_feedforward,
penalty_early=penalty_early,
disturbance_force_std=disturbance_force_std,
n_objective_repeats=n_objective_repeats,
),
n_trials=n_trials,
timeout=timeout,
show_progress_bar=True,
)
out_path = os.path.join(out_dir, "pid_best_params.json")
with open(out_path, "w") as f:
json.dump(study.best_params, f, indent=2)
print(f"Best cost: {study.best_value:.4f}")
print(f"Best params saved to {out_path}")
return study
def run_staged_optimization(
stage_steps: list = None,
n_trials_per_stage: int = 50,
timeout_per_stage: int = None,
initial_gaps_mm: list = None,
use_feedforward: bool = True,
penalty_early: float = 500.0,
disturbance_force_std: float = 0.0,
n_objective_repeats: int = 1,
out_dir: str = None,
) -> list:
"""
Run optimization in stages with increasing max_steps, warm-starting each stage from the previous best.
disturbance_force_std: passed to env for stochastic force/torque noise (N).
n_objective_repeats: mean over this many evaluations per trial for a less noisy objective.
Example: stage_steps=[1500, 3000, 6000]
- Stage 1: optimize with 1500 steps (finds good gap/initial roll), save best.
- Stage 2: optimize with 3000 steps; first trial is the 1500-step best (evaluated at 3000 steps), then TPE suggests improvements.
- Stage 3: same with 6000 steps starting from stage 2's best.
This keeps good lift-off and gap control from the short-horizon run while refining for late-horizon roll stability.
"""
if stage_steps is None:
stage_steps = [1500, 3000, 6000]
if initial_gaps_mm is None:
initial_gaps_mm = DEFAULT_INITIAL_GAPS_MM
if out_dir is None:
out_dir = _SCRIPT_DIR
if timeout_per_stage is None:
timeout_per_stage = DEFAULT_TIMEOUT_S
build_feedforward_lut()
best_params_path = os.path.join(out_dir, "pid_best_params.json")
studies = []
for stage_idx, max_steps in enumerate(stage_steps):
print(f"\n--- Stage {stage_idx + 1}/{len(stage_steps)}: max_steps={max_steps} ---")
study = optuna.create_study(
direction="minimize",
study_name=f"pid_maglev_stage_{max_steps}",
sampler=TPESampler(
n_startup_trials=min(20, n_trials_per_stage // 4),
n_ei_candidates=24,
seed=42 + stage_idx,
),
)
# Warm start: enqueue previous stage's best so we refine from it (stage 0 has no previous)
if stage_idx > 0 and os.path.isfile(best_params_path):
with open(best_params_path) as f:
prev_best = json.load(f)
study.enqueue_trial(prev_best)
print(f"Enqueued previous best params (from stage {stage_steps[stage_idx - 1]} steps) as first trial.")
study.optimize(
lambda t: objective(
t,
initial_gaps_mm=initial_gaps_mm,
max_steps=max_steps,
use_feedforward=use_feedforward,
penalty_early=penalty_early,
disturbance_force_std=disturbance_force_std,
n_objective_repeats=n_objective_repeats,
),
n_trials=n_trials_per_stage,
timeout=timeout_per_stage,
show_progress_bar=True,
)
with open(best_params_path, "w") as f:
json.dump(study.best_params, f, indent=2)
stage_path = os.path.join(out_dir, f"pid_best_params_{max_steps}.json")
with open(stage_path, "w") as f:
json.dump(study.best_params, f, indent=2)
print(f"Stage best cost: {study.best_value:.4f} -> saved to {best_params_path} and {stage_path}")
studies.append(study)
print(f"\nStaged optimization done. Final best params in {best_params_path}")
return studies
if __name__ == "__main__":
import argparse
parser = argparse.ArgumentParser(description="Optuna PID tuning for maglev three-loop controller")
parser.add_argument("--n_trials", type=int, default=DEFAULT_N_TRIALS)
parser.add_argument("--timeout", type=int, default=DEFAULT_TIMEOUT_S)
parser.add_argument("--max_steps", type=int, default=DEFAULT_MAX_STEPS)
parser.add_argument("--gaps", type=float, nargs="+", default=DEFAULT_INITIAL_GAPS_MM)
parser.add_argument("--out_dir", type=str, default=_SCRIPT_DIR, help="Directory for pid_best_params.json (default: same as script)")
parser.add_argument("--no_feedforward", action="store_true")
parser.add_argument("--staged", action="store_true", help="Staged optimization: 1500 -> 3000 -> 6000 steps, each stage warm-starts from previous best")
parser.add_argument("--stage_steps", type=int, nargs="+", default=[1500, 3000, 6000], help="Steps per stage when using --staged (default: 1500 3000 6000)")
parser.add_argument("--n_trials_per_stage", type=int, default=DEFAULT_N_TRIALS, help="Trials per stage when using --staged")
parser.add_argument("--disturbance_force_std", type=float, default=0.0, help="Env disturbance force std (N); roll/pitch torque scale with this. Use >0 for noisy optimization.")
parser.add_argument("--n_objective_repeats", type=int, default=1, help="Evaluate each trial this many times and report mean cost (reduces noise for Bayesian optimization)")
args = parser.parse_args()
if args.staged:
run_staged_optimization(
stage_steps=args.stage_steps,
n_trials_per_stage=args.n_trials_per_stage,
timeout_per_stage=args.timeout,
initial_gaps_mm=args.gaps,
use_feedforward=not args.no_feedforward,
disturbance_force_std=args.disturbance_force_std,
n_objective_repeats=args.n_objective_repeats,
out_dir=args.out_dir,
)
else:
run_optimization(
n_trials=args.n_trials,
timeout=args.timeout,
initial_gaps_mm=args.gaps,
max_steps=args.max_steps,
use_feedforward=not args.no_feedforward,
disturbance_force_std=args.disturbance_force_std,
n_objective_repeats=args.n_objective_repeats,
out_dir=args.out_dir,
)

View File

@@ -0,0 +1,11 @@
{
"height_kp": 100.962395560374814,
"height_ki": 0.0,
"height_kd": 8.1738092637166575,
"roll_kp": 0.600856607986966,
"roll_ki": 0.0,
"roll_kd": -0.1,
"pitch_kp": 50.0114708799258271,
"pitch_ki": 0,
"pitch_kd": 1.8990306608320433
}

View File

@@ -0,0 +1,11 @@
{
"height_kp": 61.34660453658844,
"height_ki": 5.337339965349835,
"height_kd": 12.13071554123404,
"roll_kp": 5.838881924776812,
"roll_ki": 0.11040111644948386,
"roll_kd": 0.0401383180893775,
"pitch_kp": 0.10114651080341679,
"pitch_ki": 0.06948994902747452,
"pitch_kd": 0.16948986671689478
}

View File

@@ -0,0 +1,11 @@
{
"height_kp": 6.79952358593656,
"height_ki": 2.7199339229214856,
"height_kd": 12.166576111298163,
"roll_kp": 1.7073146141313746,
"roll_ki": 0.026221209129363342,
"roll_kd": 0.018353603438859525,
"pitch_kp": 1.2333241666054757,
"pitch_ki": 0.03544610305322942,
"pitch_kd": 0.3711162924888727
}

View File

@@ -0,0 +1,11 @@
{
"height_kp": 5.962395560374814,
"height_ki": 0.5381137743695537,
"height_kd": 1.1738092637166575,
"roll_kp": 0.48249575996443006,
"roll_ki": 0.016923890033141546,
"roll_kd": 0.013609429509460135,
"pitch_kp": 0.10114708799258271,
"pitch_ki": 1.906050976563914,
"pitch_kd": 1.8990306608320433
}

92
lev_sim/pid_controller.py Normal file
View File

@@ -0,0 +1,92 @@
"""
PID controller and default gains for the maglev three-loop (height, roll, pitch) control.
Used by lev_PID.ipynb and optuna_pid_tune.py.
"""
import numpy as np
class PIDController:
"""Simple PID controller with anti-windup."""
def __init__(
self,
kp: float,
ki: float,
kd: float,
output_min: float = -1.0,
output_max: float = 1.0,
integral_limit: float = None,
):
self.kp = kp
self.ki = ki
self.kd = kd
self.output_min = output_min
self.output_max = output_max
self.integral_limit = (
integral_limit if integral_limit is not None else abs(output_max) * 2
)
self.integral = 0.0
self.prev_error = 0.0
self.first_update = True
def reset(self):
"""Reset controller state."""
self.integral = 0.0
self.prev_error = 0.0
self.first_update = True
def update(self, error: float, dt: float) -> float:
"""Compute PID output.
Args:
error: Current error (setpoint - measurement)
dt: Time step in seconds
Returns:
Control output (clamped to output limits)
"""
p_term = self.kp * error
self.integral += error * dt
self.integral = np.clip(
self.integral, -self.integral_limit, self.integral_limit
)
i_term = self.ki * self.integral
if self.first_update:
d_term = 0.0
self.first_update = False
else:
d_term = self.kd * (error - self.prev_error) / dt
self.prev_error = error
output = p_term + i_term + d_term
return np.clip(output, self.output_min, self.output_max)
# Default gains: height (main), roll, pitch.
# Optimizer and notebook can override via gains dict passed to run_pid_simulation.
DEFAULT_GAINS = {
"height_kp": 50.0,
"height_ki": 5.0,
"height_kd": 10.0,
"roll_kp": 2.0,
"roll_ki": 0.5,
"roll_kd": 0.5,
"pitch_kp": 2.0,
"pitch_ki": 0.5,
"pitch_kd": 0.5,
}
# Backward-compat names for notebook (optional)
HEIGHT_KP = DEFAULT_GAINS["height_kp"]
HEIGHT_KI = DEFAULT_GAINS["height_ki"]
HEIGHT_KD = DEFAULT_GAINS["height_kd"]
ROLL_KP = DEFAULT_GAINS["roll_kp"]
ROLL_KI = DEFAULT_GAINS["roll_ki"]
ROLL_KD = DEFAULT_GAINS["roll_kd"]
PITCH_KP = DEFAULT_GAINS["pitch_kp"]
PITCH_KI = DEFAULT_GAINS["pitch_ki"]
PITCH_KD = DEFAULT_GAINS["pitch_kd"]

216
lev_sim/pid_simulation.py Normal file
View File

@@ -0,0 +1,216 @@
"""
Feedforward + PID simulation runner for the maglev pod.
Uses LevPodEnv, MaglevPredictor (feedforward), and PIDController with configurable gains.
"""
import numpy as np
from lev_pod_env import LevPodEnv, TARGET_GAP
from maglev_predictor import MaglevPredictor
from pid_controller import PIDController, DEFAULT_GAINS
# Feedforward LUT (built on first use)
_FF_GAP_LUT = None
_FF_PWM_LUT = None
def build_feedforward_lut(
pod_mass: float = 9.4,
coil_r: float = 1.1,
v_supply: float = 12.0,
gap_min: float = 3.0,
gap_max: float = 35.0,
n_points: int = 500,
):
"""Build gap [mm] -> equilibrium PWM lookup table. Returns (gap_lut, pwm_lut) for np.interp."""
global _FF_GAP_LUT, _FF_PWM_LUT
target_per_yoke = pod_mass * 9.81 / 2.0
predictor = MaglevPredictor()
def _find_eq_current(gap_mm):
a, b = -10.2, 10.2
fa, _ = predictor.predict(a, a, 0.0, gap_mm)
for _ in range(80):
mid = (a + b) / 2.0
fm, _ = predictor.predict(mid, mid, 0.0, gap_mm)
if (fa > target_per_yoke) == (fm > target_per_yoke):
a, fa = mid, fm
else:
b = mid
return (a + b) / 2.0
_FF_GAP_LUT = np.linspace(gap_min, gap_max, n_points)
curr_lut = np.array([_find_eq_current(g) for g in _FF_GAP_LUT])
_FF_PWM_LUT = np.clip(curr_lut * coil_r / v_supply, -1.0, 1.0)
return _FF_GAP_LUT, _FF_PWM_LUT
def feedforward_pwm(gap_mm: float) -> float:
"""Interpolate equilibrium PWM for gap height [mm]. Builds LUT on first call."""
global _FF_GAP_LUT, _FF_PWM_LUT
if _FF_GAP_LUT is None:
build_feedforward_lut()
return float(np.interp(gap_mm, _FF_GAP_LUT, _FF_PWM_LUT))
def run_pid_simulation(
initial_gap_mm: float = 14.0,
max_steps: int = 2000,
use_gui: bool = False,
disturbance_step: int = None,
disturbance_force: float = 0.0,
disturbance_force_std: float = 0.0,
use_feedforward: bool = True,
record_video: bool = False,
record_telemetry: bool = False,
record_dir: str = "recordings",
gains: dict = None,
verbose: bool = True,
) -> dict:
"""
Run one feedforward + PID simulation. Gains can be passed for tuning (e.g. Optuna).
Args:
initial_gap_mm: Starting gap height (mm).
max_steps: Max simulation steps.
use_gui: PyBullet GUI (avoid in notebooks).
disturbance_step: Step for impulse (None = none).
disturbance_force: Impulse force (N).
disturbance_force_std: Noise std (N).
use_feedforward: Use MaglevPredictor feedforward.
record_video: Save MP4.
record_telemetry: Save telemetry PNG.
record_dir: Output directory.
gains: Dict with keys height_kp, height_ki, height_kd, roll_kp, roll_ki, roll_kd,
pitch_kp, pitch_ki, pitch_kd. If None, uses DEFAULT_GAINS.
verbose: Print progress.
Returns:
data: dict of arrays (time, gap_avg, roll_deg, pitch_deg, currents, pwms, ...).
"""
g = gains if gains is not None else DEFAULT_GAINS
env = LevPodEnv(
use_gui=use_gui,
initial_gap_mm=initial_gap_mm,
max_steps=max_steps,
disturbance_force_std=disturbance_force_std,
record_video=record_video,
record_telemetry=record_telemetry,
record_dir=record_dir,
)
dt = env.dt
height_pid = PIDController(
g["height_kp"], g["height_ki"], g["height_kd"],
output_min=-1.0, output_max=1.0,
)
roll_pid = PIDController(
g["roll_kp"], g["roll_ki"], g["roll_kd"],
output_min=-0.5, output_max=0.5,
)
pitch_pid = PIDController(
g["pitch_kp"], g["pitch_ki"], g["pitch_kd"],
output_min=-0.5, output_max=0.5,
)
data = {
"time": [], "gap_front": [], "gap_back": [], "gap_avg": [],
"roll_deg": [], "pitch_deg": [],
"current_FL": [], "current_FR": [], "current_BL": [], "current_BR": [],
"current_total": [], "pwm_FL": [], "pwm_FR": [], "pwm_BL": [], "pwm_BR": [],
"ff_pwm": [],
}
obs, _ = env.reset()
target_gap = TARGET_GAP
y_distance = 0.1016
x_distance = 0.2518
if verbose:
print(f"Starting simulation: initial_gap={initial_gap_mm}mm, target={target_gap*1000:.2f}mm")
if disturbance_step is not None:
print(f" Impulse disturbance: {disturbance_force}N at step {disturbance_step}")
if disturbance_force_std > 0:
print(f" Stochastic noise: std={disturbance_force_std}N")
print(f" Feedforward: {'enabled' if use_feedforward else 'disabled'}")
if record_video or record_telemetry:
print(f" Recording: video={record_video}, telemetry={record_telemetry}{record_dir}/")
for step in range(max_steps):
t = step * dt
gaps_normalized = obs[:4]
gaps = gaps_normalized * env.gap_scale + TARGET_GAP
gap_front = gaps[2]
gap_back = gaps[3]
gap_left = gaps[1]
gap_right = gaps[0]
gap_avg = (gap_front + gap_back + gap_left + gap_right) / 4
roll_angle = np.arcsin(np.clip((gap_left - gap_right) / y_distance, -1, 1))
pitch_angle = np.arcsin(np.clip((gap_back - gap_front) / x_distance, -1, 1))
ff_base = feedforward_pwm(gap_avg * 1000) if use_feedforward else 0.0
height_error = target_gap - gap_avg
roll_error = -roll_angle
pitch_error = -pitch_angle
height_correction = height_pid.update(height_error, dt)
roll_correction = roll_pid.update(roll_error, dt)
pitch_correction = pitch_pid.update(pitch_error, dt)
pwm_FL = np.clip(ff_base + height_correction - roll_correction - pitch_correction, -1, 1)
pwm_FR = np.clip(ff_base + height_correction + roll_correction - pitch_correction, -1, 1)
pwm_BL = np.clip(ff_base + height_correction - roll_correction + pitch_correction, -1, 1)
pwm_BR = np.clip(ff_base + height_correction + roll_correction + pitch_correction, -1, 1)
action = np.array([pwm_FL, pwm_FR, pwm_BL, pwm_BR], dtype=np.float32)
if disturbance_step is not None and step == disturbance_step:
env.apply_impulse(disturbance_force)
# Coupled torque: random direction, magnitude = 0.5 * |impulse force| (N·m)
torque_mag = 0.5 * abs(disturbance_force)
direction = np.random.randn(3)
direction = direction / (np.linalg.norm(direction) + 1e-12)
torque_nm = (torque_mag * direction).tolist()
env.apply_torque_impulse(torque_nm)
if verbose:
print(f" Applied {disturbance_force}N impulse and {torque_mag:.2f} N·m torque at step {step}")
obs, _, terminated, truncated, info = env.step(action)
data["time"].append(t)
data["gap_front"].append(info["gap_front_yoke"] * 1000)
data["gap_back"].append(info["gap_back_yoke"] * 1000)
data["gap_avg"].append(info["gap_avg"] * 1000)
data["roll_deg"].append(np.degrees(info["roll"]))
data["pitch_deg"].append(np.degrees(info["pitch"]))
data["current_FL"].append(info["curr_front_L"])
data["current_FR"].append(info["curr_front_R"])
data["current_BL"].append(info["curr_back_L"])
data["current_BR"].append(info["curr_back_R"])
data["current_total"].append(
abs(info["curr_front_L"]) + abs(info["curr_front_R"])
+ abs(info["curr_back_L"]) + abs(info["curr_back_R"])
)
data["ff_pwm"].append(ff_base)
data["pwm_FL"].append(pwm_FL)
data["pwm_FR"].append(pwm_FR)
data["pwm_BL"].append(pwm_BL)
data["pwm_BR"].append(pwm_BR)
if terminated or truncated:
if verbose:
print(f" Simulation ended at step {step} (terminated={terminated})")
break
env.close()
for key in data:
data[key] = np.array(data[key])
if verbose:
print(f"Simulation complete: {len(data['time'])} steps, {data['time'][-1]:.2f}s")
print(f" Final gap: {data['gap_avg'][-1]:.2f}mm (target: {target_gap*1000:.2f}mm)")
print(f" Final roll: {data['roll_deg'][-1]:.3f}°, pitch: {data['pitch_deg'][-1]:.3f}°")
return data

View File

@@ -2,8 +2,8 @@
<robot name="lev_pod">
<link name="base_link">
<inertial>
<mass value="5.8"/>
<inertia ixx="0.0192942414" ixy="0.0" ixz="0.0" iyy="0.130582305" iyz="0.0" izz="0.13760599326"/>
<mass value="9.4"/>
<inertia ixx="0.03162537654" ixy="0.0" ixz="0.0" iyy="0.21929017831" iyz="0.0" izz="0.21430205089"/>
</inertial>
<collision>
@@ -13,19 +13,19 @@
Bolts
<collision>
<origin rpy="0 0 0" xyz="0.285 0.03 0.09585"/>
<origin rpy="0 0 0" xyz="0.285 0.03 0.09085"/>
<geometry><box size="0.01 0.01 0.01"/></geometry>
</collision>
<collision>
<origin rpy="0 0 0" xyz="0.285 -0.03 0.09585"/>
<origin rpy="0 0 0" xyz="0.285 -0.03 0.09085"/>
<geometry><box size="0.01 0.01 0.01"/></geometry>
</collision>
<collision>
<origin rpy="0 0 0" xyz="-0.285 0.03 0.09585"/>
<origin rpy="0 0 0" xyz="-0.285 0.03 0.09085"/>
<geometry><box size="0.01 0.01 0.01"/></geometry>
</collision>
<collision>
<origin rpy="0 0 0" xyz="-0.285 -0.03 0.09585"/>
<origin rpy="0 0 0" xyz="-0.285 -0.03 0.09085"/>
<geometry><box size="0.01 0.01 0.01"/></geometry>
</collision>

View File

@@ -0,0 +1,430 @@
Magnetic Levitation Force & Torque — Explicit Polynomial Equations
Polynomial Degree: 6
Variables:
currL [A] = Left coil current
currR [A] = Right coil current
rollDeg [deg] = Roll angle
invGap = 1 / GapHeight [1/mm]
================================================================================
FORCE [N] =
-1.3837763236e+01
+ (+3.4900958018e-01) * currL [A]
+ (+3.4444782070e-01) * currR [A]
+ (+1.3948921341e-07) * rollDeg [deg]
+ (+6.3404397040e+02) * invGap
+ (+2.0808153074e-02) * currL [A]^2
+ (-8.2940557511e-04) * currL [A] * currR [A]
+ (+2.2629904125e-02) * currL [A] * rollDeg [deg]
+ (-1.4941727622e+01) * currL [A] * invGap
+ (+2.1137560003e-02) * currR [A]^2
+ (-2.2629886279e-02) * currR [A] * rollDeg [deg]
+ (-1.4834895226e+01) * currR [A] * invGap
+ (-7.3648244412e-01) * rollDeg [deg]^2
+ (-7.6740357314e-06) * rollDeg [deg] * invGap
+ (+1.3767217831e+03) * invGap^2
+ (-1.1531758728e-04) * currL [A]^3
+ (+7.2971576377e-05) * currL [A]^2 * currR [A]
+ (+5.4868393021e-06) * currL [A]^2 * rollDeg [deg]
+ (-1.0521912466e+00) * currL [A]^2 * invGap
+ (+5.2348894922e-05) * currL [A] * currR [A]^2
+ (+2.1794350221e-09) * currL [A] * currR [A] * rollDeg [deg]
+ (+3.2678067078e-02) * currL [A] * currR [A] * invGap
+ (-6.3017520966e-03) * currL [A] * rollDeg [deg]^2
+ (-2.6462505434e-01) * currL [A] * rollDeg [deg] * invGap
+ (-2.9510804409e+01) * currL [A] * invGap^2
+ (-7.2152022082e-05) * currR [A]^3
+ (-5.4823932308e-06) * currR [A]^2 * rollDeg [deg]
+ (-1.0708822638e+00) * currR [A]^2 * invGap
+ (-6.3914882711e-03) * currR [A] * rollDeg [deg]^2
+ (+2.6462554272e-01) * currR [A] * rollDeg [deg] * invGap
+ (-3.0234998506e+01) * currR [A] * invGap^2
+ (+4.5881294085e-09) * rollDeg [deg]^3
+ (+2.5797308313e+01) * rollDeg [deg]^2 * invGap
+ (+4.6682794236e-05) * rollDeg [deg] * invGap^2
+ (-5.3401486713e+03) * invGap^3
+ (+1.3320765542e-06) * currL [A]^4
+ (+3.2152411427e-06) * currL [A]^3 * currR [A]
+ (+1.2629467079e-05) * currL [A]^3 * rollDeg [deg]
+ (+1.7892402808e-03) * currL [A]^3 * invGap
+ (+3.0619624267e-06) * currL [A]^2 * currR [A]^2
+ (-1.5568499556e-07) * currL [A]^2 * currR [A] * rollDeg [deg]
+ (-1.0714912904e-03) * currL [A]^2 * currR [A] * invGap
+ (+8.7713928261e-05) * currL [A]^2 * rollDeg [deg]^2
+ (+4.5854056157e-03) * currL [A]^2 * rollDeg [deg] * invGap
+ (+2.0746027602e+01) * currL [A]^2 * invGap^2
+ (+3.8655549044e-06) * currL [A] * currR [A]^3
+ (+1.5545726439e-07) * currL [A] * currR [A]^2 * rollDeg [deg]
+ (-7.0411774478e-04) * currL [A] * currR [A]^2 * invGap
+ (-3.8261231547e-05) * currL [A] * currR [A] * rollDeg [deg]^2
+ (-9.5017239129e-09) * currL [A] * currR [A] * rollDeg [deg] * invGap
+ (+7.0646804762e-01) * currL [A] * currR [A] * invGap^2
+ (-2.5574383917e-03) * currL [A] * rollDeg [deg]^3
+ (-3.3355499360e-02) * currL [A] * rollDeg [deg]^2 * invGap
+ (-2.1337761184e+01) * currL [A] * rollDeg [deg] * invGap^2
+ (+1.2343471808e+02) * currL [A] * invGap^3
+ (+7.7592074199e-07) * currR [A]^4
+ (-1.2629426979e-05) * currR [A]^3 * rollDeg [deg]
+ (+8.6147973530e-04) * currR [A]^3 * invGap
+ (+8.0130692138e-05) * currR [A]^2 * rollDeg [deg]^2
+ (-4.5854241649e-03) * currR [A]^2 * rollDeg [deg] * invGap
+ (+2.1139446060e+01) * currR [A]^2 * invGap^2
+ (+2.5574380197e-03) * currR [A] * rollDeg [deg]^3
+ (-2.9857453053e-02) * currR [A] * rollDeg [deg]^2 * invGap
+ (+2.1337762097e+01) * currR [A] * rollDeg [deg] * invGap^2
+ (+1.2514911864e+02) * currR [A] * invGap^3
+ (+2.9443521553e-02) * rollDeg [deg]^4
+ (-7.9265644452e-09) * rollDeg [deg]^3 * invGap
+ (-2.3563990269e+02) * rollDeg [deg]^2 * invGap^2
+ (+1.6353835994e-04) * rollDeg [deg] * invGap^3
+ (-2.2354105572e+03) * invGap^4
+ (+3.1117360777e-07) * currL [A]^5
+ (-1.8750259301e-07) * currL [A]^4 * currR [A]
+ (-8.5198564648e-08) * currL [A]^4 * rollDeg [deg]
+ (-6.3869937977e-05) * currL [A]^4 * invGap
+ (-1.4911217505e-07) * currL [A]^3 * currR [A]^2
+ (+1.7061909929e-07) * currL [A]^3 * currR [A] * rollDeg [deg]
+ (-7.4262537249e-06) * currL [A]^3 * currR [A] * invGap
+ (+7.2402232831e-07) * currL [A]^3 * rollDeg [deg]^2
+ (+2.1841125430e-05) * currL [A]^3 * rollDeg [deg] * invGap
+ (-3.4357925518e-03) * currL [A]^3 * invGap^2
+ (-1.6416880300e-07) * currL [A]^2 * currR [A]^3
+ (+3.6385798723e-05) * currL [A]^2 * currR [A]^2 * invGap
+ (+5.2924336558e-07) * currL [A]^2 * currR [A] * rollDeg [deg]^2
+ (+8.5467922645e-05) * currL [A]^2 * currR [A] * rollDeg [deg] * invGap
+ (+4.5573594510e-03) * currL [A]^2 * currR [A] * invGap^2
+ (-2.9680843072e-05) * currL [A]^2 * rollDeg [deg]^3
+ (-3.7951808035e-03) * currL [A]^2 * rollDeg [deg]^2 * invGap
+ (+4.7717250306e-02) * currL [A]^2 * rollDeg [deg] * invGap^2
+ (-1.4608679078e+02) * currL [A]^2 * invGap^3
+ (-1.2370955460e-07) * currL [A] * currR [A]^4
+ (-1.7060417434e-07) * currL [A] * currR [A]^3 * rollDeg [deg]
+ (-1.3936700967e-05) * currL [A] * currR [A]^3 * invGap
+ (+4.5908154078e-07) * currL [A] * currR [A]^2 * rollDeg [deg]^2
+ (-8.5469212391e-05) * currL [A] * currR [A]^2 * rollDeg [deg] * invGap
+ (+1.6991917750e-03) * currL [A] * currR [A]^2 * invGap^2
+ (-3.7373312737e-04) * currL [A] * currR [A] * rollDeg [deg]^2 * invGap
+ (+1.5086926031e-07) * currL [A] * currR [A] * rollDeg [deg] * invGap^2
+ (-7.5987537316e+00) * currL [A] * currR [A] * invGap^3
+ (+6.6508849418e-04) * currL [A] * rollDeg [deg]^4
+ (+9.6378055653e-02) * currL [A] * rollDeg [deg]^3 * invGap
+ (+2.4435308561e+00) * currL [A] * rollDeg [deg]^2 * invGap^2
+ (+1.2664933542e+02) * currL [A] * rollDeg [deg] * invGap^3
+ (+5.1887450366e+01) * currL [A] * invGap^4
+ (+2.3180087538e-07) * currR [A]^5
+ (+8.5217195078e-08) * currR [A]^4 * rollDeg [deg]
+ (-6.9233585420e-05) * currR [A]^4 * invGap
+ (+7.5608402383e-07) * currR [A]^3 * rollDeg [deg]^2
+ (-2.1841873013e-05) * currR [A]^3 * rollDeg [deg] * invGap
+ (+3.1131797033e-03) * currR [A]^3 * invGap^2
+ (+2.9680840171e-05) * currR [A]^2 * rollDeg [deg]^3
+ (-3.7292231655e-03) * currR [A]^2 * rollDeg [deg]^2 * invGap
+ (-4.7717023731e-02) * currR [A]^2 * rollDeg [deg] * invGap^2
+ (-1.4923564858e+02) * currR [A]^2 * invGap^3
+ (+6.6540367362e-04) * currR [A] * rollDeg [deg]^4
+ (-9.6378069105e-02) * currR [A] * rollDeg [deg]^3 * invGap
+ (+2.3836959223e+00) * currR [A] * rollDeg [deg]^2 * invGap^2
+ (-1.2664937015e+02) * currR [A] * rollDeg [deg] * invGap^3
+ (+5.2627468646e+01) * currR [A] * invGap^4
+ (+1.4646059365e-10) * rollDeg [deg]^5
+ (-1.0417153181e+00) * rollDeg [deg]^4 * invGap
+ (+1.1431957446e-06) * rollDeg [deg]^3 * invGap^2
+ (+9.2056028147e+02) * rollDeg [deg]^2 * invGap^3
+ (-3.1228040188e-04) * rollDeg [deg] * invGap^4
+ (-5.9623186232e+02) * invGap^5
+ (+2.9763214116e-09) * currL [A]^6
+ (-6.2261733547e-09) * currL [A]^5 * currR [A]
+ (-3.7175269085e-08) * currL [A]^5 * rollDeg [deg]
+ (-3.1125615720e-06) * currL [A]^5 * invGap
+ (-9.9876729109e-09) * currL [A]^4 * currR [A]^2
+ (-1.3294041423e-08) * currL [A]^4 * currR [A] * rollDeg [deg]
+ (+2.2610334440e-06) * currL [A]^4 * currR [A] * invGap
+ (+2.4101829865e-08) * currL [A]^4 * rollDeg [deg]^2
+ (+2.5320289563e-06) * currL [A]^4 * rollDeg [deg] * invGap
+ (+2.0532678993e-04) * currL [A]^4 * invGap^2
+ (-7.0411871889e-09) * currL [A]^3 * currR [A]^3
+ (+1.1956544199e-08) * currL [A]^3 * currR [A]^2 * rollDeg [deg]
+ (+1.9188820701e-06) * currL [A]^3 * currR [A]^2 * invGap
+ (+6.3643952330e-08) * currL [A]^3 * currR [A] * rollDeg [deg]^2
+ (-3.3660324359e-06) * currL [A]^3 * currR [A] * rollDeg [deg] * invGap
+ (+1.0594658745e-05) * currL [A]^3 * currR [A] * invGap^2
+ (-2.5937761805e-07) * currL [A]^3 * rollDeg [deg]^3
+ (-7.2227672945e-06) * currL [A]^3 * rollDeg [deg]^2 * invGap
+ (+9.6876113423e-05) * currL [A]^3 * rollDeg [deg] * invGap^2
+ (+8.5422144858e-03) * currL [A]^3 * invGap^3
+ (-1.0519386251e-08) * currL [A]^2 * currR [A]^4
+ (-1.1957411061e-08) * currL [A]^2 * currR [A]^3 * rollDeg [deg]
+ (+2.1222821118e-06) * currL [A]^2 * currR [A]^3 * invGap
+ (+4.4935102750e-08) * currL [A]^2 * currR [A]^2 * rollDeg [deg]^2
+ (-1.2807847845e-04) * currL [A]^2 * currR [A]^2 * invGap^2
+ (+5.7679319987e-08) * currL [A]^2 * currR [A] * rollDeg [deg]^3
+ (-1.4777475671e-05) * currL [A]^2 * currR [A] * rollDeg [deg]^2 * invGap
+ (-2.5449360510e-04) * currL [A]^2 * currR [A] * rollDeg [deg] * invGap^2
+ (-1.2272562713e-02) * currL [A]^2 * currR [A] * invGap^3
+ (+8.8287809685e-07) * currL [A]^2 * rollDeg [deg]^4
+ (+4.4586018461e-04) * currL [A]^2 * rollDeg [deg]^3 * invGap
+ (+3.8576999819e-02) * currL [A]^2 * rollDeg [deg]^2 * invGap^2
+ (+3.4044411238e-01) * currL [A]^2 * rollDeg [deg] * invGap^3
+ (+3.5950095140e+02) * currL [A]^2 * invGap^4
+ (-8.4967268776e-09) * currL [A] * currR [A]^5
+ (+1.3295050394e-08) * currL [A] * currR [A]^4 * rollDeg [deg]
+ (+1.7032328259e-06) * currL [A] * currR [A]^4 * invGap
+ (+7.0043846279e-08) * currL [A] * currR [A]^3 * rollDeg [deg]^2
+ (+3.3657944138e-06) * currL [A] * currR [A]^3 * rollDeg [deg] * invGap
+ (+6.8900834879e-05) * currL [A] * currR [A]^3 * invGap^2
+ (-5.7674824028e-08) * currL [A] * currR [A]^2 * rollDeg [deg]^3
+ (-1.4623729019e-05) * currL [A] * currR [A]^2 * rollDeg [deg]^2 * invGap
+ (+2.5450219980e-04) * currL [A] * currR [A]^2 * rollDeg [deg] * invGap^2
+ (-1.0593500843e-03) * currL [A] * currR [A]^2 * invGap^3
+ (+1.0484950490e-06) * currL [A] * currR [A] * rollDeg [deg]^4
+ (-3.0932389983e-10) * currL [A] * currR [A] * rollDeg [deg]^3 * invGap
+ (+5.6370243409e-03) * currL [A] * currR [A] * rollDeg [deg]^2 * invGap^2
+ (-6.1682354633e-07) * currL [A] * currR [A] * rollDeg [deg] * invGap^3
+ (+2.2923219836e+01) * currL [A] * currR [A] * invGap^4
+ (-2.3420164800e-05) * currL [A] * rollDeg [deg]^5
+ (-9.2739975478e-03) * currL [A] * rollDeg [deg]^4 * invGap
+ (-7.4080422659e-01) * currL [A] * rollDeg [deg]^3 * invGap^2
+ (-2.1756879968e+01) * currL [A] * rollDeg [deg]^2 * invGap^3
+ (-3.5929041347e+02) * currL [A] * rollDeg [deg] * invGap^4
+ (+1.3909390562e+01) * currL [A] * invGap^5
+ (+6.1617129177e-09) * currR [A]^6
+ (+3.7175730938e-08) * currR [A]^5 * rollDeg [deg]
+ (-2.1826492898e-06) * currR [A]^5 * invGap
+ (+3.0887363778e-08) * currR [A]^4 * rollDeg [deg]^2
+ (-2.5321109476e-06) * currR [A]^4 * rollDeg [deg] * invGap
+ (+2.0057675659e-04) * currR [A]^4 * invGap^2
+ (+2.5936417813e-07) * currR [A]^3 * rollDeg [deg]^3
+ (-7.9156716870e-06) * currR [A]^3 * rollDeg [deg]^2 * invGap
+ (-9.6870862064e-05) * currR [A]^3 * rollDeg [deg] * invGap^2
+ (-1.1576514633e-02) * currR [A]^3 * invGap^3
+ (+1.0210733379e-06) * currR [A]^2 * rollDeg [deg]^4
+ (-4.4586066717e-04) * currR [A]^2 * rollDeg [deg]^3 * invGap
+ (+3.8287512141e-02) * currR [A]^2 * rollDeg [deg]^2 * invGap^2
+ (-3.4044501906e-01) * currR [A]^2 * rollDeg [deg] * invGap^3
+ (+3.6814992351e+02) * currR [A]^2 * invGap^4
+ (+2.3420159192e-05) * currR [A] * rollDeg [deg]^5
+ (-9.2337309491e-03) * currR [A] * rollDeg [deg]^4 * invGap
+ (+7.4080431520e-01) * currR [A] * rollDeg [deg]^3 * invGap^2
+ (-2.1520950367e+01) * currR [A] * rollDeg [deg]^2 * invGap^3
+ (+3.5929051935e+02) * currR [A] * rollDeg [deg] * invGap^4
+ (+1.4109361400e+01) * currR [A] * invGap^5
+ (+1.7232857807e-04) * rollDeg [deg]^6
+ (-1.5228368774e-09) * rollDeg [deg]^5 * invGap
+ (+7.4229949571e+00) * rollDeg [deg]^4 * invGap^2
+ (-4.7116044996e-06) * rollDeg [deg]^3 * invGap^3
+ (+4.0058823232e+02) * rollDeg [deg]^2 * invGap^4
+ (+7.4032294285e-04) * rollDeg [deg] * invGap^5
+ (-1.3151563792e+02) * invGap^6
================================================================================
TORQUE [mN*m] =
-2.5609643910e+00
+ (+1.2736755974e+01) * currL [A]
+ (-1.3082527996e+01) * currR [A]
+ (-1.3305641735e+01) * rollDeg [deg]
+ (+4.4151637366e+01) * invGap
+ (-6.3923649292e-02) * currL [A]^2
+ (-1.1560951475e-02) * currL [A] * currR [A]
+ (+1.8386370689e+00) * currL [A] * rollDeg [deg]
+ (-4.5922645259e+02) * currL [A] * invGap
+ (+9.8233200925e-02) * currR [A]^2
+ (+1.8386371393e+00) * currR [A] * rollDeg [deg]
+ (+4.7236896866e+02) * currR [A] * invGap
+ (+9.1214755261e-01) * rollDeg [deg]^2
+ (-1.0749540976e+03) * rollDeg [deg] * invGap
+ (-1.7435331556e+02) * invGap^2
+ (+1.3682740756e-03) * currL [A]^3
+ (+1.9533070101e-03) * currL [A]^2 * currR [A]
+ (+1.9657240805e-02) * currL [A]^2 * rollDeg [deg]
+ (+2.0525258396e+00) * currL [A]^2 * invGap
+ (-2.0087168696e-03) * currL [A] * currR [A]^2
+ (-7.7704180912e-03) * currL [A] * currR [A] * rollDeg [deg]
+ (+4.6783332660e-01) * currL [A] * currR [A] * invGap
+ (-1.5697787523e-01) * currL [A] * rollDeg [deg]^2
+ (-2.5279026405e+01) * currL [A] * rollDeg [deg] * invGap
+ (-2.6796288784e+03) * currL [A] * invGap^2
+ (-6.9397567186e-04) * currR [A]^3
+ (+1.9657238531e-02) * currR [A]^2 * rollDeg [deg]
+ (-3.1136966908e+00) * currR [A]^2 * invGap
+ (+1.8298169417e-01) * currR [A] * rollDeg [deg]^2
+ (-2.5279027176e+01) * currR [A] * rollDeg [deg] * invGap
+ (+2.5386184669e+03) * currR [A] * invGap^2
+ (+6.2974733858e-01) * rollDeg [deg]^3
+ (-1.3210284466e+01) * rollDeg [deg]^2 * invGap
+ (+4.7007171607e+04) * rollDeg [deg] * invGap^2
+ (-3.3555302551e+02) * invGap^3
+ (-1.4305035722e-04) * currL [A]^4
+ (-1.6602474226e-05) * currL [A]^3 * currR [A]
+ (-1.2886823540e-04) * currL [A]^3 * rollDeg [deg]
+ (+6.0143039665e-03) * currL [A]^3 * invGap
+ (+1.2951511025e-05) * currL [A]^2 * currR [A]^2
+ (-5.1776437670e-04) * currL [A]^2 * currR [A] * rollDeg [deg]
+ (-3.8569371878e-02) * currL [A]^2 * currR [A] * invGap
+ (+5.2166822420e-03) * currL [A]^2 * rollDeg [deg]^2
+ (-6.2117182881e-01) * currL [A]^2 * rollDeg [deg] * invGap
+ (+9.0620919904e+01) * currL [A]^2 * invGap^2
+ (+1.3270592660e-06) * currL [A] * currR [A]^3
+ (-5.1776417343e-04) * currL [A] * currR [A]^2 * rollDeg [deg]
+ (+4.2265553856e-02) * currL [A] * currR [A]^2 * invGap
+ (-2.2041148798e-04) * currL [A] * currR [A] * rollDeg [deg]^2
+ (+2.4509139646e-01) * currL [A] * currR [A] * rollDeg [deg] * invGap
+ (-4.9160159525e+00) * currL [A] * currR [A] * invGap^2
+ (-1.7295894521e-01) * currL [A] * rollDeg [deg]^3
+ (-6.7494817486e+00) * currL [A] * rollDeg [deg]^2 * invGap
+ (-8.6427297569e+02) * currL [A] * rollDeg [deg] * invGap^2
+ (+8.5965909925e+03) * currL [A] * invGap^3
+ (-1.6550913550e-05) * currR [A]^4
+ (-1.2886821877e-04) * currR [A]^3 * rollDeg [deg]
+ (-3.0326211668e-02) * currR [A]^3 * invGap
+ (-5.1175783571e-03) * currR [A]^2 * rollDeg [deg]^2
+ (-6.2117181767e-01) * currR [A]^2 * rollDeg [deg] * invGap
+ (-7.5004948389e+01) * currR [A]^2 * invGap^2
+ (-1.7295894543e-01) * currR [A] * rollDeg [deg]^3
+ (+5.7289182157e+00) * currR [A] * rollDeg [deg]^2 * invGap
+ (-8.6427297453e+02) * currR [A] * rollDeg [deg] * invGap^2
+ (-8.1554262787e+03) * currR [A] * invGap^3
+ (-8.0890042154e-02) * rollDeg [deg]^4
+ (+1.7462417614e+02) * rollDeg [deg]^3 * invGap
+ (+5.9548102453e+01) * rollDeg [deg]^2 * invGap^2
+ (-9.1016550502e+04) * rollDeg [deg] * invGap^3
+ (-1.2462037728e+02) * invGap^4
+ (-1.2219304153e-05) * currL [A]^5
+ (-6.3133366268e-06) * currL [A]^4 * currR [A]
+ (+5.1514166444e-07) * currL [A]^4 * rollDeg [deg]
+ (+1.1879557083e-03) * currL [A]^4 * invGap
+ (-1.0954778098e-06) * currL [A]^3 * currR [A]^2
+ (-5.8420851161e-06) * currL [A]^3 * currR [A] * rollDeg [deg]
+ (+2.5831185234e-03) * currL [A]^3 * currR [A] * invGap
+ (+7.9254089698e-05) * currL [A]^3 * rollDeg [deg]^2
+ (-1.7220995748e-03) * currL [A]^3 * rollDeg [deg] * invGap
+ (-4.0028155701e-01) * currL [A]^3 * invGap^2
+ (+1.7079834365e-06) * currL [A]^2 * currR [A]^3
+ (-7.8935650691e-06) * currL [A]^2 * currR [A]^2 * rollDeg [deg]
+ (-3.2330488590e-04) * currL [A]^2 * currR [A]^2 * invGap
+ (+9.9753661971e-05) * currL [A]^2 * currR [A] * rollDeg [deg]^2
+ (+7.2169993632e-03) * currL [A]^2 * currR [A] * rollDeg [deg] * invGap
+ (+5.4494940800e-01) * currL [A]^2 * currR [A] * invGap^2
+ (-1.5381149512e-03) * currL [A]^2 * rollDeg [deg]^3
+ (-1.9907607357e-01) * currL [A]^2 * rollDeg [deg]^2 * invGap
+ (+1.0517964842e+01) * currL [A]^2 * rollDeg [deg] * invGap^2
+ (-5.9716223372e+02) * currL [A]^2 * invGap^3
+ (+5.7682329953e-06) * currL [A] * currR [A]^4
+ (-5.8420830129e-06) * currL [A] * currR [A]^3 * rollDeg [deg]
+ (-3.1387669824e-03) * currL [A] * currR [A]^3 * invGap
+ (-9.2627696858e-05) * currL [A] * currR [A]^2 * rollDeg [deg]^2
+ (+7.2169983158e-03) * currL [A] * currR [A]^2 * rollDeg [deg] * invGap
+ (-5.4112374537e-01) * currL [A] * currR [A]^2 * invGap^2
+ (-3.1504005406e-05) * currL [A] * currR [A] * rollDeg [deg]^3
+ (-1.7005015703e-04) * currL [A] * currR [A] * rollDeg [deg]^2 * invGap
+ (-2.3976914010e+00) * currL [A] * currR [A] * rollDeg [deg] * invGap^2
+ (+2.0162876449e+01) * currL [A] * currR [A] * invGap^3
+ (+3.0541236561e-02) * currL [A] * rollDeg [deg]^4
+ (+6.0909890705e+00) * currL [A] * rollDeg [deg]^3 * invGap
+ (+1.8686476537e+02) * currL [A] * rollDeg [deg]^2 * invGap^2
+ (+5.4569961037e+03) * currL [A] * rollDeg [deg] * invGap^3
+ (+3.6521334233e+03) * currL [A] * invGap^4
+ (+1.2356741024e-05) * currR [A]^5
+ (+5.1514541610e-07) * currR [A]^4 * rollDeg [deg]
+ (-3.2093123475e-04) * currR [A]^4 * invGap
+ (-9.5040930219e-05) * currR [A]^3 * rollDeg [deg]^2
+ (-1.7221002130e-03) * currR [A]^3 * rollDeg [deg] * invGap
+ (+6.5615872016e-01) * currR [A]^3 * invGap^2
+ (-1.5381149487e-03) * currR [A]^2 * rollDeg [deg]^3
+ (+2.0395948760e-01) * currR [A]^2 * rollDeg [deg]^2 * invGap
+ (+1.0517964822e+01) * currR [A]^2 * rollDeg [deg] * invGap^2
+ (+4.9837046412e+02) * currR [A]^2 * invGap^3
+ (-3.0694304201e-02) * currR [A] * rollDeg [deg]^4
+ (+6.0909890702e+00) * currR [A] * rollDeg [deg]^3 * invGap
+ (-1.7712281328e+02) * currR [A] * rollDeg [deg]^2 * invGap^2
+ (+5.4569961045e+03) * currR [A] * rollDeg [deg] * invGap^3
+ (-3.4643372364e+03) * currR [A] * invGap^4
+ (-3.1967283950e-01) * rollDeg [deg]^5
+ (+7.2465373581e-01) * rollDeg [deg]^4 * invGap
+ (-3.7694440105e+03) * rollDeg [deg]^3 * invGap^2
+ (+4.4429019352e+01) * rollDeg [deg]^2 * invGap^3
+ (-3.9730669147e+04) * rollDeg [deg] * invGap^4
+ (-3.1813627757e+01) * invGap^5
+ (+2.0551811986e-07) * currL [A]^6
+ (-2.2810121436e-07) * currL [A]^5 * currR [A]
+ (-1.3383146324e-07) * currL [A]^5 * rollDeg [deg]
+ (+1.6049756900e-04) * currL [A]^5 * invGap
+ (-5.6453359321e-07) * currL [A]^4 * currR [A]^2
+ (+2.6031671041e-07) * currL [A]^4 * currR [A] * rollDeg [deg]
+ (+1.2744387021e-05) * currL [A]^4 * currR [A] * invGap
+ (+2.8978174669e-06) * currL [A]^4 * rollDeg [deg]^2
+ (-9.3438872511e-05) * currL [A]^4 * rollDeg [deg] * invGap
+ (-3.2491823205e-03) * currL [A]^4 * invGap^2
+ (+3.7946676912e-09) * currL [A]^3 * currR [A]^3
+ (+1.7599444391e-07) * currL [A]^3 * currR [A]^2 * rollDeg [deg]
+ (+2.4965108992e-05) * currL [A]^3 * currR [A]^2 * invGap
+ (+1.1286476678e-06) * currL [A]^3 * currR [A] * rollDeg [deg]^2
+ (+4.5300600434e-05) * currL [A]^3 * currR [A] * rollDeg [deg] * invGap
+ (-1.5200582693e-02) * currL [A]^3 * currR [A] * invGap^2
+ (+2.7490628440e-06) * currL [A]^3 * rollDeg [deg]^3
+ (-8.2493098857e-04) * currL [A]^3 * rollDeg [deg]^2 * invGap
+ (+2.3944496913e-02) * currL [A]^3 * rollDeg [deg] * invGap^2
+ (+1.2946953968e+00) * currL [A]^3 * invGap^3
+ (+5.9211265580e-07) * currL [A]^2 * currR [A]^4
+ (+1.7599464286e-07) * currL [A]^2 * currR [A]^3 * rollDeg [deg]
+ (-3.7773169680e-05) * currL [A]^2 * currR [A]^3 * invGap
+ (-7.7324017411e-08) * currL [A]^2 * currR [A]^2 * rollDeg [deg]^2
+ (+1.6224376321e-04) * currL [A]^2 * currR [A]^2 * rollDeg [deg] * invGap
+ (+1.1125393841e-03) * currL [A]^2 * currR [A]^2 * invGap^2
+ (-1.8213825115e-08) * currL [A]^2 * currR [A] * rollDeg [deg]^3
+ (-1.1582951117e-03) * currL [A]^2 * currR [A] * rollDeg [deg]^2 * invGap
+ (-2.7423615740e-02) * currL [A]^2 * currR [A] * rollDeg [deg] * invGap^2
+ (-1.8375761343e+00) * currL [A]^2 * currR [A] * invGap^3
+ (+1.8148082155e-05) * currL [A]^2 * rollDeg [deg]^4
+ (+2.5582361106e-02) * currL [A]^2 * rollDeg [deg]^3 * invGap
+ (+1.8719567169e+00) * currL [A]^2 * rollDeg [deg]^2 * invGap^2
+ (-7.9375540256e+00) * currL [A]^2 * rollDeg [deg] * invGap^3
+ (+1.3851610060e+03) * currL [A]^2 * invGap^4
+ (+3.6572413364e-07) * currL [A] * currR [A]^5
+ (+2.6031864309e-07) * currL [A] * currR [A]^4 * rollDeg [deg]
+ (-1.3740560576e-05) * currL [A] * currR [A]^4 * invGap
+ (-1.1634704791e-06) * currL [A] * currR [A]^3 * rollDeg [deg]^2
+ (+4.5300591111e-05) * currL [A] * currR [A]^3 * rollDeg [deg] * invGap
+ (+1.7827349035e-02) * currL [A] * currR [A]^3 * invGap^2
+ (-1.8220930542e-08) * currL [A] * currR [A]^2 * rollDeg [deg]^3
+ (+1.0311063391e-03) * currL [A] * currR [A]^2 * rollDeg [deg]^2 * invGap
+ (-2.7423615867e-02) * currL [A] * currR [A]^2 * rollDeg [deg] * invGap^2
+ (+1.8202040056e+00) * currL [A] * currR [A]^2 * invGap^3
+ (+1.4693588980e-05) * currL [A] * currR [A] * rollDeg [deg]^4
+ (+2.0391970869e-03) * currL [A] * currR [A] * rollDeg [deg]^3 * invGap
+ (-5.1289752136e-03) * currL [A] * currR [A] * rollDeg [deg]^2 * invGap^2
+ (+1.3585046026e+01) * currL [A] * currR [A] * rollDeg [deg] * invGap^3
+ (-2.5312909994e+01) * currL [A] * currR [A] * invGap^4
+ (-1.2892918352e-03) * currL [A] * rollDeg [deg]^5
+ (-4.2744856185e-01) * currL [A] * rollDeg [deg]^4 * invGap
+ (-4.5230140146e+01) * currL [A] * rollDeg [deg]^3 * invGap^2
+ (-1.2691925261e+03) * currL [A] * rollDeg [deg]^2 * invGap^3
+ (-1.7946912044e+04) * currL [A] * rollDeg [deg] * invGap^4
+ (+9.8200368161e+02) * currL [A] * invGap^5
+ (+1.4402604620e-07) * currR [A]^6
+ (-1.3383078112e-07) * currR [A]^5 * rollDeg [deg]
+ (-1.5877721700e-04) * currR [A]^5 * invGap
+ (-1.8463799734e-06) * currR [A]^4 * rollDeg [deg]^2
+ (-9.3438911534e-05) * currR [A]^4 * rollDeg [deg] * invGap
+ (-2.0062450751e-03) * currR [A]^4 * invGap^2
+ (+2.7490636967e-06) * currR [A]^3 * rollDeg [deg]^3
+ (+1.0293575893e-03) * currR [A]^3 * rollDeg [deg]^2 * invGap
+ (+2.3944496992e-02) * currR [A]^3 * rollDeg [deg] * invGap^2
+ (-2.1505766179e+00) * currR [A]^3 * invGap^3
+ (-4.8050087258e-05) * currR [A]^2 * rollDeg [deg]^4
+ (+2.5582361094e-02) * currR [A]^2 * rollDeg [deg]^3 * invGap
+ (-1.8925775930e+00) * currR [A]^2 * rollDeg [deg]^2 * invGap^2
+ (-7.9375540232e+00) * currR [A]^2 * rollDeg [deg] * invGap^3
+ (-1.1457282555e+03) * currR [A]^2 * invGap^4
+ (-1.2892918417e-03) * currR [A] * rollDeg [deg]^5
+ (+4.3570132351e-01) * currR [A] * rollDeg [deg]^4 * invGap
+ (-4.5230140146e+01) * currR [A] * rollDeg [deg]^3 * invGap^2
+ (+1.2356182202e+03) * currR [A] * rollDeg [deg]^2 * invGap^3
+ (-1.7946912045e+04) * currR [A] * rollDeg [deg] * invGap^4
+ (-9.3157391357e+02) * currR [A] * invGap^5
+ (+1.9887971069e-03) * rollDeg [deg]^6
+ (+4.1532416818e+00) * rollDeg [deg]^5 * invGap
+ (-3.7128109697e+00) * rollDeg [deg]^4 * invGap^2
+ (+1.9150570779e+04) * rollDeg [deg]^3 * invGap^3
+ (+1.9562107621e+01) * rollDeg [deg]^2 * invGap^4
+ (-1.0765823661e+04) * rollDeg [deg] * invGap^5
+ (-6.8540115783e+00) * invGap^6

Binary file not shown.

Binary file not shown.

Binary file not shown.

Binary file not shown.

Binary file not shown.

11
lev_sim/temp.json Normal file
View File

@@ -0,0 +1,11 @@
{
"height_kp": 80.05607483893696,
"height_ki": 0,
"height_kd": 7.09266287860531,
"roll_kp": -0.600856607986966,
"roll_ki": 0,
"roll_kd": -0.1,
"pitch_kp": 50.3415835489009009,
"pitch_ki": 0.02319184022898008,
"pitch_kd": 0.017632648760979346
}

View File

@@ -1,164 +0,0 @@
#include "Controller.hpp"
#include <Arduino.h>
// CONTROLLER CONSTANTS
float MAX_INTEGRAL_TERM = 1e4;
void FullController::update() {
Left.readMM();
Right.readMM();
Front.readMM();
Back.readMM(); // read and update dists/oor for all sensors.
oor = Left.oor || Right.oor || Front.oor || Back.oor;
avgControl();
LRControl(); // run pwm functions.
FBControl();
FLPWM = constrain(avgPWM + LDiffPWM + FDiffPWM, -CAP, CAP);
BLPWM = constrain(avgPWM + LDiffPWM + BDiffPWM, -CAP, CAP);
FRPWM = constrain(avgPWM + RDiffPWM + FDiffPWM, -CAP, CAP);
BRPWM = constrain(avgPWM + RDiffPWM + BDiffPWM, -CAP, CAP);
// FLPWM = avgPWM;
// BLPWM = avgPWM;
// FRPWM = avgPWM;
// BRPWM = avgPWM;
}
void FullController::zeroPWMs() {
FLPWM = 0;
BLPWM = 0;
FRPWM = 0;
BRPWM = 0;
}
void FullController::sendOutputs() {
if (!outputOn) {
zeroPWMs();
}
// The following assumes 0 direction drives repulsion and 1 direction drives
// attraction. Using direct register writes to maintain fast PWM mode set by
// setupFastPWM()
digitalWrite(dirFL, FLPWM < 0);
OCR2A = abs(FLPWM); // Pin 11 -> Timer 2A
digitalWrite(dirBL, BLPWM < 0);
OCR1A = abs(BLPWM); // Pin 9 -> Timer 1A
digitalWrite(dirFR, FRPWM < 0);
OCR2B = abs(FRPWM); // Pin 3 -> Timer 2B
digitalWrite(dirBR, BRPWM < 0);
OCR1B = abs(BRPWM); // Pin 10 -> Timer 1B
}
void FullController::avgControl() {
avg = (Left.mmVal + Right.mmVal + Front.mmVal + Back.mmVal) * 0.25f;
float eCurr = AvgRef - avg;
avgError.eDiff = eCurr - avgError.e;
if (!oor) {
avgError.eInt += eCurr;
avgError.eInt =
constrain(avgError.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM);
}
avgError.e = eCurr;
avgPWM = pwmFunc(avgConsts, avgError);
}
void FullController::LRControl() {
float diff = Right.mmVal - Left.mmVal; // how far above the right is the left?
float eCurr = diff - LRDiffRef; // how different is that from the reference?
// positive -> Left repels, Right attracts.
K_MAP rConsts = {
LConsts.attracting,
LConsts.repelling}; // apply attracting to repelling and vice versa.
LRDiffErr.eDiff = eCurr - LRDiffErr.e;
if (!oor) {
LRDiffErr.eInt += eCurr;
LRDiffErr.eInt =
constrain(LRDiffErr.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM);
}
LRDiffErr.e = eCurr;
LDiffPWM = pwmFunc(LConsts, LRDiffErr);
RDiffPWM = -pwmFunc(rConsts, LRDiffErr);
}
void FullController::FBControl() {
float diff = Back.mmVal - Front.mmVal; // how far above the back is the front?
float eCurr = diff - FBDiffRef; // how different is that from ref? pos.->Front
// must repel, Back must attract
K_MAP bConsts = {FConsts.attracting, FConsts.repelling};
FBDiffErr.eDiff = eCurr - FBDiffErr.e;
if (!oor) {
FBDiffErr.eInt += eCurr;
FBDiffErr.eInt =
constrain(FBDiffErr.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM);
}
FBDiffErr.e = eCurr;
FDiffPWM = pwmFunc(FConsts, FBDiffErr);
BDiffPWM = -pwmFunc(bConsts, FBDiffErr);
}
int16_t FullController::pwmFunc(K_MAP consts, Errors errs) {
if (oor)
return 0;
Constants constants = (errs.e < 0) ? consts.attracting : consts.repelling;
return (int)(constants.kp * errs.e + constants.ki * errs.eInt +
constants.kd * errs.eDiff);
}
void FullController::report() {
// CSV Format: Left,Right,Front,Back,Avg,FLPWM,BLPWM,FRPWM,BRPWM,ControlOn
Serial.print(Left.mmVal);
Serial.print(",");
Serial.print(Right.mmVal);
Serial.print(",");
Serial.print(Front.mmVal);
Serial.print(",");
Serial.print(Back.mmVal);
Serial.print(",");
Serial.print(avg);
Serial.print(",");
Serial.print(FLPWM);
Serial.print(",");
Serial.print(BLPWM);
Serial.print(",");
Serial.print(FRPWM);
Serial.print(",");
Serial.print(BRPWM);
Serial.print(",");
Serial.println(outputOn);
}
void FullController::updateAvgPID(Constants repel, Constants attract) {
avgConsts.repelling = repel;
avgConsts.attracting = attract;
}
void FullController::updateLRPID(Constants down, Constants up) {
LConsts.repelling = down;
LConsts.attracting = up;
}
void FullController::updateFBPID(Constants down, Constants up) {
FConsts.repelling = down;
FConsts.attracting = up;
}
void FullController::updateReferences(float avgReference, float lrDiffReference, float fbDiffReference) {
AvgRef = avgReference;
LRDiffRef = lrDiffReference;
FBDiffRef = fbDiffReference;
}

View File

@@ -1,104 +0,0 @@
#ifndef CONTROLLER_HPP
#define CONTROLLER_HPP
#include <stdint.h>
#include "IndSensorMap.hpp"
// PIN MAPPING
#define dirFR 2
#define pwmFR 3
#define dirBR 4
#define pwmBR 10
#define pwmFL 11
#define dirFL 7
#define dirBL 8
#define pwmBL 9
#define CAP 250
typedef struct Constants {
float kp;
float ki;
float kd;
} Constants;
typedef struct K_MAP {
Constants repelling;
Constants attracting;
} K_MAP;
typedef struct FullConsts {
K_MAP avg;
K_MAP lColl; // repelling is applied to attracting and vice versa for the Right and Back collectives.
K_MAP fColl;
} FullConsts;
typedef struct Errors {
float e;
float eDiff;
float eInt;
} Errors;
class FullController {
public:
bool oor;
bool outputOn;
FullController(IndSensor& l, IndSensor& r, IndSensor& f, IndSensor& b,
FullConsts fullConsts, float avgRef, float lrDiffRef, float fbDiffRef)
: Left(l), Right(r), Front(f), Back(b), AvgRef(avgRef), LRDiffRef(lrDiffRef),
FBDiffRef(fbDiffRef), avgConsts(fullConsts.avg), LConsts(fullConsts.lColl),
FConsts(fullConsts.fColl), avgError({0,0,0}), LRDiffErr({0,0,0}),
FBDiffErr({0,0,0}), oor(false), outputOn(false) {}
void update();
void zeroPWMs();
void sendOutputs();
void report();
// PID tuning methods
void updateAvgPID(Constants repel, Constants attract);
void updateLRPID(Constants down, Constants up);
void updateFBPID(Constants down, Constants up);
// Reference update methods
void updateReferences(float avgReference, float lrDiffReference, float fbDiffReference);
private:
void avgControl();
void LRControl();
void FBControl();
int16_t pwmFunc(K_MAP consts, Errors errs);
IndSensor& Front;
IndSensor& Back;
IndSensor& Right;
IndSensor& Left;
K_MAP avgConsts;
K_MAP LConsts;
K_MAP FConsts;
Errors avgError;
Errors LRDiffErr;
Errors FBDiffErr;
float AvgRef;
float LRDiffRef;
float FBDiffRef;
float avg;
int16_t avgPWM;
int16_t LDiffPWM;
int16_t RDiffPWM;
int16_t FDiffPWM;
int16_t BDiffPWM;
// Initially, I was going to make the Right and Back just the negatives,
// but having separate control functions running for each of these outputs might prove useful.
int16_t FLPWM;
int16_t BLPWM;
int16_t FRPWM;
int16_t BRPWM;
};
#endif // CONTROLLER_HPP