ts changes
This commit is contained in:
@@ -3,21 +3,21 @@
|
||||
#include "Controller.hpp"
|
||||
|
||||
// K, Ki, Kd Constants
|
||||
Constants repelling = {40, 0.01, 7};
|
||||
Constants attracting = {20, 0.01, 20};
|
||||
Constants repelling = {1000, 0, 10000};
|
||||
Constants attracting = {1000, 0, 10000};
|
||||
|
||||
Constants RollLeftUp = {30, 0.01, 15};
|
||||
Constants RollLeftDown = {30, 0.01, 15};
|
||||
Constants RollLeftUp = {500, 0, 10000};
|
||||
Constants RollLeftDown = {500, 0, 10000};
|
||||
|
||||
Constants RollFrontUp = {30, 0.01, 15};
|
||||
Constants RollFrontDown = {30, 0.01, 15};
|
||||
Constants RollFrontUp = {500, 0, 10000};
|
||||
Constants RollFrontDown = {500, 0, 10000};
|
||||
|
||||
// Reference values for average dist,
|
||||
float avgRef = 21.0; // TBD: what is our equilibrium height with this testrig?
|
||||
float avgRef = 12.0; // TBD: what is our equilibrium height with this testrig?
|
||||
float LRDiffRef = 0.0; // TBD: what is our left-right balance equilibrium? Positive -> left is above right
|
||||
float FBDiffRef = 0.0; // TBD: what is front-back balance equilibrium? Positive -> front above back.
|
||||
float FBDiffRef = 2; // TBD: what is front-back balance equilibrium? Positive -> front above back.
|
||||
|
||||
float slewRateLimit = 100.0; // max PWM change per control cycle (determined by 1 second / sampling rate)
|
||||
float slewRateLimit = 10000.0; // max PWM change per control cycle (determined by 1 second / sampling rate)
|
||||
// this was implemented by Claude and we can see if it helps.
|
||||
// Set it at or above 255 to make it have no effect.
|
||||
|
||||
@@ -44,7 +44,7 @@ const int dt_micros = 1e6/sampling_rate;
|
||||
int ON = 0;
|
||||
|
||||
void setup() {
|
||||
Serial.begin(57600);
|
||||
Serial.begin(115200);
|
||||
|
||||
tprior = micros();
|
||||
|
||||
@@ -70,7 +70,7 @@ void loop() {
|
||||
tDiffMicros = micros() - tprior;
|
||||
|
||||
if (tDiffMicros >= dt_micros){
|
||||
controller.update((float)tDiffMicros / (float)1e6);
|
||||
controller.update();
|
||||
controller.report();
|
||||
controller.sendOutputs();
|
||||
// this and the previous line can be switched if you want the PWMs to display 0 when controller off.
|
||||
|
||||
@@ -1 +0,0 @@
|
||||
../lib/PseudoSensorControl.cpp
|
||||
@@ -1 +0,0 @@
|
||||
../lib/PseudoSensorControl.hpp
|
||||
@@ -2,10 +2,10 @@
|
||||
#include "IndSensorMap.hpp"
|
||||
#include "PseudoSensorControl.hpp"
|
||||
|
||||
float refs[4] = {14,14,14,14};
|
||||
float refs[4] = {12.9,12.3,12.6,12};
|
||||
|
||||
Constants repelling = {10000, 0, 50000};
|
||||
Constants attracting = {10000, 0, 50000};
|
||||
Constants repelling = {250, 0, 20000};
|
||||
Constants attracting = {250, 0, 20000};
|
||||
|
||||
K_MAP consts = {repelling, attracting};
|
||||
|
||||
@@ -34,7 +34,7 @@ const int dt_micros = 1e6/sampling_rate;
|
||||
int ON = 0;
|
||||
|
||||
void setup() {
|
||||
Serial.begin(57600);
|
||||
Serial.begin(115200);
|
||||
|
||||
indL.alpha = alphaVal;
|
||||
indR.alpha = alphaVal;
|
||||
@@ -54,7 +54,7 @@ void loop() {
|
||||
char c = Serial.read();
|
||||
while(Serial.available()) Serial.read(); // flush remaining
|
||||
|
||||
controller.outputOn = (c != '0');
|
||||
controller.outputOn = (c != '0' && c != 'r'); // planning to add r command to set refernce or smth
|
||||
}
|
||||
|
||||
tDiffMicros = micros() - tprior;
|
||||
|
||||
@@ -4,9 +4,7 @@
|
||||
// CONTROLLER CONSTANTS
|
||||
float MAX_INTEGRAL_TERM = 1e4;
|
||||
|
||||
void FullController::update(float tDiff) {
|
||||
this->tDiff = tDiff; // store time step for use in differential and integral portions
|
||||
|
||||
void FullController::update() {
|
||||
Left.readMM();
|
||||
Right.readMM();
|
||||
Front.readMM();
|
||||
@@ -18,20 +16,15 @@ void FullController::update(float tDiff) {
|
||||
LRControl(); // run pwm functions.
|
||||
FBControl();
|
||||
|
||||
int16_t flTarget = avgPWM + LDiffPWM + FDiffPWM;
|
||||
int16_t blTarget = avgPWM + LDiffPWM + BDiffPWM;
|
||||
int16_t frTarget = avgPWM + RDiffPWM + FDiffPWM;
|
||||
int16_t brTarget = avgPWM + RDiffPWM + BDiffPWM;
|
||||
FLPWM = constrain(avgPWM + LDiffPWM + FDiffPWM, -CAP, CAP);
|
||||
BLPWM = constrain(avgPWM + LDiffPWM + BDiffPWM, -CAP, CAP);
|
||||
FRPWM = constrain(avgPWM + RDiffPWM + FDiffPWM, -CAP, CAP);
|
||||
BRPWM = constrain(avgPWM + RDiffPWM + BDiffPWM, -CAP, CAP);
|
||||
|
||||
FLPWM = slewLimit(flTarget, FLPrev);
|
||||
BLPWM = slewLimit(blTarget, BLPrev);
|
||||
FRPWM = slewLimit(frTarget, FRPrev);
|
||||
BRPWM = slewLimit(brTarget, BRPrev);
|
||||
|
||||
FLPrev = FLPWM;
|
||||
BLPrev = BLPWM;
|
||||
FRPrev = FRPWM;
|
||||
BRPrev = BRPWM;
|
||||
// FLPWM = avgPWM;
|
||||
// BLPWM = avgPWM;
|
||||
// FRPWM = avgPWM;
|
||||
// BRPWM = avgPWM;
|
||||
}
|
||||
|
||||
void FullController::zeroPWMs() {
|
||||
@@ -58,12 +51,14 @@ void FullController::sendOutputs() {
|
||||
}
|
||||
|
||||
void FullController::avgControl() {
|
||||
float avg = (Left.mmVal + Right.mmVal + Front.mmVal + Back.mmVal) * 0.25f;
|
||||
avg = (Left.mmVal + Right.mmVal + Front.mmVal + Back.mmVal) * 0.25f;
|
||||
float eCurr = AvgRef - avg;
|
||||
|
||||
avgError.eDiff = (tDiff == 0.0) ? 0:(eCurr - avgError.e) / tDiff; // rise over run
|
||||
avgError.eInt += eCurr * tDiff;
|
||||
avgError.eInt = constrain(avgError.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM);
|
||||
avgError.eDiff = eCurr - avgError.e;
|
||||
if (!oor) {
|
||||
avgError.eInt += eCurr;
|
||||
avgError.eInt = constrain(avgError.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM);
|
||||
}
|
||||
avgError.e = eCurr;
|
||||
|
||||
avgPWM = pwmFunc(avgConsts, avgError);
|
||||
@@ -74,9 +69,13 @@ void FullController::LRControl() {
|
||||
float eCurr = diff - LRDiffRef; // how different is that from the reference? positive -> Left repels, Right attracts.
|
||||
K_MAP rConsts = {LConsts.attracting, LConsts.repelling}; // apply attracting to repelling and vice versa.
|
||||
|
||||
LRDiffErr.eDiff = (tDiff == 0.0) ? 0:(eCurr - LRDiffErr.e) / tDiff;
|
||||
LRDiffErr.eInt += eCurr * tDiff;
|
||||
LRDiffErr.eInt = constrain(LRDiffErr.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM);
|
||||
LRDiffErr.eDiff = eCurr - LRDiffErr.e;
|
||||
|
||||
if (!oor) {
|
||||
LRDiffErr.eInt += eCurr;
|
||||
LRDiffErr.eInt = constrain(LRDiffErr.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM);
|
||||
}
|
||||
|
||||
LRDiffErr.e = eCurr;
|
||||
|
||||
LDiffPWM = pwmFunc(LConsts, LRDiffErr);
|
||||
@@ -88,9 +87,13 @@ void FullController::FBControl() {
|
||||
float eCurr = diff - FBDiffRef; // how different is that from ref? pos.->Front must repel, Back must attract
|
||||
K_MAP bConsts = {FConsts.attracting, FConsts.repelling};
|
||||
|
||||
FBDiffErr.eDiff = (tDiff == 0.0) ? 0:(eCurr - FBDiffErr.e) / tDiff;
|
||||
FBDiffErr.eInt += eCurr * tDiff;
|
||||
FBDiffErr.eInt = constrain(FBDiffErr.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM);
|
||||
FBDiffErr.eDiff = eCurr - FBDiffErr.e;
|
||||
|
||||
if (!oor) {
|
||||
FBDiffErr.eInt += eCurr;
|
||||
FBDiffErr.eInt = constrain(FBDiffErr.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM);
|
||||
}
|
||||
|
||||
FBDiffErr.e = eCurr;
|
||||
|
||||
FDiffPWM = pwmFunc(FConsts, FBDiffErr);
|
||||
@@ -103,13 +106,6 @@ int16_t FullController::pwmFunc(K_MAP consts, Errors errs) {
|
||||
return (int)constrain(constants.kp*errs.e + constants.ki*errs.eInt + constants.kd*errs.eDiff, -(float)CAP,(float)CAP);
|
||||
}
|
||||
|
||||
int16_t FullController::slewLimit(int16_t target, int16_t prev) {
|
||||
int16_t maxChange = (int16_t)(slewRateLimit * tDiff);
|
||||
int16_t delta = target - prev;
|
||||
if (abs(delta) <= maxChange) return target;
|
||||
return prev + (delta > 0 ? maxChange : -maxChange);
|
||||
}
|
||||
|
||||
void FullController::report() {
|
||||
Serial.print("SENSORS - Left: ");
|
||||
Serial.print(Left.mmVal);
|
||||
@@ -120,6 +116,8 @@ void FullController::report() {
|
||||
Serial.print("mm, Back: ");
|
||||
Serial.print(Back.mmVal);
|
||||
Serial.print("mm,\n");
|
||||
Serial.print("AVG - ");
|
||||
Serial.println(avg);
|
||||
|
||||
Serial.print("PWMS - FL_PWM: ");
|
||||
Serial.print(FLPWM);
|
||||
|
||||
@@ -14,7 +14,7 @@
|
||||
#define dirBL 8
|
||||
#define pwmBL 9
|
||||
|
||||
#define CAP 200
|
||||
#define CAP 250
|
||||
|
||||
typedef struct Constants {
|
||||
float kp;
|
||||
@@ -49,10 +49,9 @@ class FullController {
|
||||
: Left(l), Right(r), Front(f), Back(b), AvgRef(avgRef), LRDiffRef(lrDiffRef),
|
||||
FBDiffRef(fbDiffRef), avgConsts(fullConsts.avg), LConsts(fullConsts.lColl),
|
||||
FConsts(fullConsts.fColl), avgError({0,0,0}), LRDiffErr({0,0,0}),
|
||||
FBDiffErr({0,0,0}), oor(false), outputOn(false),
|
||||
FLPrev(0), BLPrev(0), FRPrev(0), BRPrev(0), slewRateLimit(slewRate) {}
|
||||
FBDiffErr({0,0,0}), oor(false), outputOn(false) {}
|
||||
|
||||
void update(float tDiff);
|
||||
void update();
|
||||
void zeroPWMs();
|
||||
void sendOutputs();
|
||||
void report();
|
||||
@@ -80,7 +79,7 @@ class FullController {
|
||||
float AvgRef;
|
||||
float LRDiffRef;
|
||||
float FBDiffRef;
|
||||
float slewRateLimit;
|
||||
float avg;
|
||||
|
||||
int16_t avgPWM;
|
||||
int16_t LDiffPWM;
|
||||
@@ -94,12 +93,5 @@ class FullController {
|
||||
int16_t BLPWM;
|
||||
int16_t FRPWM;
|
||||
int16_t BRPWM;
|
||||
|
||||
int16_t FLPrev;
|
||||
int16_t BLPrev;
|
||||
int16_t FRPrev;
|
||||
int16_t BRPrev;
|
||||
|
||||
float tDiff;
|
||||
};
|
||||
#endif // CONTROLLER_HPP
|
||||
@@ -23,7 +23,6 @@ float IndSensor::toMM(uint16_t raw) {
|
||||
// Read sensor directly from pin and convert to millimeters
|
||||
float IndSensor::readMM() {
|
||||
uint16_t raw = constrain(analogRead(pin), 0, 900);
|
||||
Serial.println(raw);
|
||||
|
||||
// Exponential moving average filter
|
||||
filteredRaw = alpha * raw + (1.0f - alpha) * filteredRaw;
|
||||
|
||||
@@ -45,11 +45,16 @@ void PseudoSensorController::control() {
|
||||
Back.mmVal + Right.mmVal - avg}; // BR
|
||||
|
||||
for (uint8_t i = 0; i < 4; i++) {
|
||||
float eCurr = Refs[i] - pseudos[i]; // Above reference is positive error.
|
||||
float eCurr = Refs[i] - pseudos[i];
|
||||
|
||||
errors[i].eDiff = (eCurr - errors[i].e);
|
||||
|
||||
// Only integrate when not out of range
|
||||
if (!oor) {
|
||||
errors[i].eInt += eCurr;
|
||||
errors[i].eInt = constrain(errors[i].eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM);
|
||||
}
|
||||
|
||||
errors[i].eDiff = (eCurr - errors[i].e); // rise over run
|
||||
errors[i].eInt += eCurr;
|
||||
errors[i].eInt = constrain(errors[i].eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM);
|
||||
errors[i].e = eCurr;
|
||||
|
||||
PWMs[i] = pwmFunc(Consts, errors[i]);
|
||||
|
||||
@@ -23,7 +23,7 @@ typedef struct PinPair {
|
||||
extern PinPair pinMap[4];
|
||||
// FL, FR, BL, BR
|
||||
|
||||
#define CAP 200
|
||||
#define CAP 255
|
||||
|
||||
typedef struct Constants {
|
||||
float kp;
|
||||
|
||||
Reference in New Issue
Block a user