we might be cooked man

This commit is contained in:
2025-11-30 19:05:57 -06:00
parent 138c04f7a1
commit 0580c44aa3
10 changed files with 1130 additions and 57 deletions

1
.gitignore vendored
View File

@@ -3,3 +3,4 @@
__pycache__/ __pycache__/
sim_results/ sim_results/
sim_results_multi/ sim_results_multi/
tuningTrials/

View File

@@ -5,23 +5,19 @@
#include "FastPWM.hpp" #include "FastPWM.hpp"
// K, Ki, Kd Constants // K, Ki, Kd Constants
Constants repelling = {1000, 0, 10000}; Constants repelling = {250, 0, 1000};
Constants attracting = {1000, 0, 10000}; Constants attracting = {250, 0, 1000};
Constants RollLeftUp = {500, 0, 10000}; Constants RollLeftUp = {0, 0, 100};
Constants RollLeftDown = {500, 0, 10000}; Constants RollLeftDown = {0, 0, 100};
Constants RollFrontUp = {500, 0, 10000}; Constants RollFrontUp = {0, 0, 500};
Constants RollFrontDown = {500, 0, 10000}; Constants RollFrontDown = {0, 0, 500};
// Reference values for average dist, // Reference values for average dist,
float avgRef = 12.0; // TBD: what is our equilibrium height with this testrig? float avgRef = 11.0; // TBD: what is our equilibrium height with this testrig?
float LRDiffRef = 0.0; // TBD: what is our left-right balance equilibrium? Positive -> left is above right float LRDiffRef = -2.0; // TBD: what is our left-right balance equilibrium? Positive -> left is above right
float FBDiffRef = 2; // TBD: what is front-back balance equilibrium? Positive -> front above back. float FBDiffRef = 0.0; // TBD: what is front-back balance equilibrium? Positive -> front above back.
float slewRateLimit = 10000.0; // max PWM change per control cycle (determined by 1 second / sampling rate)
// this was implemented by Claude and we can see if it helps.
// Set it at or above 255 to make it have no effect.
// Might be useful for things like jitter or lag. // Might be useful for things like jitter or lag.
#define sampling_rate 1000 // Hz #define sampling_rate 1000 // Hz
@@ -40,7 +36,7 @@ FullConsts fullConsts = {
{RollFrontDown, RollFrontUp} {RollFrontDown, RollFrontUp}
}; };
FullController controller(indL, indR, indF, indB, fullConsts, avgRef, LRDiffRef, FBDiffRef, slewRateLimit); FullController controller(indL, indR, indF, indB, fullConsts, avgRef, LRDiffRef, FBDiffRef);
const int dt_micros = 1e6/sampling_rate; const int dt_micros = 1e6/sampling_rate;
@@ -49,7 +45,7 @@ const int dt_micros = 1e6/sampling_rate;
int ON = 0; int ON = 0;
void setup() { void setup() {
Serial.begin(115200); Serial.begin(2000000);
setupADC(); setupADC();
setupFastPWM(); setupFastPWM();
@@ -72,11 +68,96 @@ void setup() {
void loop() { void loop() {
if (Serial.available() > 0) { if (Serial.available() > 0) {
// this might need to be changed if we have trouble getting serial to read. String cmd = Serial.readStringUntil('\n');
char c = Serial.read(); cmd.trim();
while(Serial.available()) Serial.read(); // flush remaining
controller.outputOn = (c != '0'); // Check if it's a reference update command (format: REF,avgRef,lrDiffRef,fbDiffRef)
if (cmd.startsWith("REF,")) {
int firstComma = cmd.indexOf(',');
int secondComma = cmd.indexOf(',', firstComma + 1);
int thirdComma = cmd.indexOf(',', secondComma + 1);
if (firstComma > 0 && secondComma > 0 && thirdComma > 0) {
float newAvgRef = cmd.substring(firstComma + 1, secondComma).toFloat();
float newLRDiffRef = cmd.substring(secondComma + 1, thirdComma).toFloat();
float newFBDiffRef = cmd.substring(thirdComma + 1).toFloat();
avgRef = newAvgRef;
LRDiffRef = newLRDiffRef;
FBDiffRef = newFBDiffRef;
controller.updateReferences(avgRef, LRDiffRef, FBDiffRef);
Serial.print("Updated References: Avg=");
Serial.print(avgRef);
Serial.print(", LR=");
Serial.print(LRDiffRef);
Serial.print(", FB=");
Serial.println(FBDiffRef);
}
}
// Check if it's a PID tuning command (format: PID,mode,kp,ki,kd)
else if (cmd.startsWith("PID,")) {
int firstComma = cmd.indexOf(',');
int secondComma = cmd.indexOf(',', firstComma + 1);
int thirdComma = cmd.indexOf(',', secondComma + 1);
int fourthComma = cmd.indexOf(',', thirdComma + 1);
if (firstComma > 0 && secondComma > 0 && thirdComma > 0 && fourthComma > 0) {
int mode = cmd.substring(firstComma + 1, secondComma).toInt();
float kp = cmd.substring(secondComma + 1, thirdComma).toFloat();
float ki = cmd.substring(thirdComma + 1, fourthComma).toFloat();
float kd = cmd.substring(fourthComma + 1).toFloat();
Constants newConst = {kp, ki, kd};
// Mode mapping:
// 0: Repelling
// 1: Attracting
// 2: RollLeftDown
// 3: RollLeftUp
// 4: RollFrontDown
// 5: RollFrontUp
switch(mode) {
case 0: // Repelling
repelling = newConst;
controller.updateAvgPID(repelling, attracting);
Serial.println("Updated Repelling PID");
break;
case 1: // Attracting
attracting = newConst;
controller.updateAvgPID(repelling, attracting);
Serial.println("Updated Attracting PID");
break;
case 2: // RollLeftDown
RollLeftDown = newConst;
controller.updateLRPID(RollLeftDown, RollLeftUp);
Serial.println("Updated RollLeftDown PID");
break;
case 3: // RollLeftUp
RollLeftUp = newConst;
controller.updateLRPID(RollLeftDown, RollLeftUp);
Serial.println("Updated RollLeftUp PID");
break;
case 4: // RollFrontDown
RollFrontDown = newConst;
controller.updateFBPID(RollFrontDown, RollFrontUp);
Serial.println("Updated RollFrontDown PID");
break;
case 5: // RollFrontUp
RollFrontUp = newConst;
controller.updateFBPID(RollFrontDown, RollFrontUp);
Serial.println("Updated RollFrontUp PID");
break;
default:
Serial.println("Invalid mode");
break;
}
}
} else {
// Original control on/off command
controller.outputOn = (cmd.charAt(0) != '0');
}
} }
tDiffMicros = micros() - tprior; tDiffMicros = micros() - tprior;

View File

@@ -6,7 +6,7 @@ Ported from decentralizedPIDcontroller.m
import numpy as np import numpy as np
class DecentralizedPIDController: class AdditivePIDController:
""" """
Decentralized PID controller for quadrotor/maglev control. Decentralized PID controller for quadrotor/maglev control.
Controls altitude, roll, and pitch using gap sensor feedback. Controls altitude, roll, and pitch using gap sensor feedback.
@@ -151,6 +151,6 @@ def decentralized_pid_controller(R, S, P, controller=None):
4-element vector with voltages applied to each yoke 4-element vector with voltages applied to each yoke
""" """
if controller is None: if controller is None:
controller = DecentralizedPIDController() controller = AdditivePIDController()
return controller.control(R, S, P) return controller.control(R, S, P)

View File

@@ -7,7 +7,7 @@ import numpy as np
from scipy.integrate import solve_ivp from scipy.integrate import solve_ivp
from utils import euler2dcm, dcm2euler from utils import euler2dcm, dcm2euler
from dynamics import quad_ode_function_hf from dynamics import quad_ode_function_hf
from controller import DecentralizedPIDController from MAGLEV_DIGITALTWIN_PYTHON.additiveController import AdditivePIDController
def simulate_maglev_control(R, S, P): def simulate_maglev_control(R, S, P):
@@ -84,7 +84,7 @@ def simulate_maglev_control(R, S, P):
xk = x0 xk = x0
# Create controller instance to maintain state # Create controller instance to maintain state
controller = DecentralizedPIDController() controller = AdditivePIDController()
for k in range(N - 1): # loop through each time step for k in range(N - 1): # loop through each time step
tspan = np.arange(S['tVec'][k], S['tVec'][k+1] + dt/2, dt) tspan = np.arange(S['tVec'][k], S['tVec'][k+1] + dt/2, dt)

203
PID_TUNING_GUIDE.md Normal file
View File

@@ -0,0 +1,203 @@
# PID Tuning & Reference Control System - Implementation Guide
## Overview
This system allows real-time tuning of all 6 PID control modes and reference setpoints through a GUI interface. Changes are transmitted via serial communication and applied immediately to the controller.
## Control Modes
The system supports 6 distinct PID control modes:
1. **Repelling** (Mode 0) - Average height control when pushing away
2. **Attracting** (Mode 1) - Average height control when pulling in
3. **RollLeftDown** (Mode 2) - Left-right balance when left side needs to go down
4. **RollLeftUp** (Mode 3) - Left-right balance when left side needs to go up
5. **RollFrontDown** (Mode 4) - Front-back balance when front needs to go down
6. **RollFrontUp** (Mode 5) - Front-back balance when front needs to go up
## Reference Values
The system also supports updating three reference setpoints:
1. **Average Height Reference (avgRef)** - Target height for levitation (mm)
2. **Left-Right Difference Reference (LRDiffRef)** - Target balance between left and right sensors (mm)
- Positive value: left side should be higher than right
- Negative value: right side should be higher than left
3. **Front-Back Difference Reference (FBDiffRef)** - Target balance between front and back sensors (mm)
- Positive value: front should be higher than back
- Negative value: back should be higher than front
## Serial Protocol
### PID Command Format
```
PID,<mode>,<kp>,<ki>,<kd>\n
```
### Reference Command Format
```
REF,<avgRef>,<lrDiffRef>,<fbDiffRef>\n
```
### Parameters
**PID Command:**
- **mode**: Integer 0-5 (see control modes above)
- **kp**: Float - Proportional gain
- **ki**: Float - Integral gain
- **kd**: Float - Derivative gain
**Reference Command:**
- **avgRef**: Float - Average height target in mm
- **lrDiffRef**: Float - Left-right balance difference in mm
- **fbDiffRef**: Float - Front-back balance difference in mm
### Examples
```
PID,0,250,0,1000\n # Set Repelling: Kp=250, Ki=0, Kd=1000
REF,11.0,-2.0,0.0\n # Set avgRef=11mm, LRDiff=-2mm, FBDiff=0mm
PID,3,0,0,100\n # Set RollLeftUp: Kp=0, Ki=0, Kd=100
REF,12.5,0.0,0.5\n # Set avgRef=12.5mm, LRDiff=0mm, FBDiff=0.5mm
```
## Implementation Details
### Arduino Side (AdditiveControlCode.ino)
#### Default Values
```cpp
Constants repelling = {250, 0, 1000};
Constants attracting = {250, 0, 1000};
Constants RollLeftUp = {0, 0, 100};
Constants RollLeftDown = {0, 0, 100};
Constants RollFrontUp = {0, 0, 500};
Constants RollFrontDown = {0, 0, 500};
```
#### Serial Command Processing
The main loop now parses incoming serial commands:
- Commands starting with "PID," are parsed for PID tuning
- Single character commands ('0' or '1') control the system on/off state
- Upon receiving a PID command, the corresponding Constants struct is updated
- The controller's internal PID values are updated via setter methods
### Controller (Controller.hpp/cpp)
#### New Methods
```cpp
// PID update methods
void updateAvgPID(Constants repel, Constants attract);
void updateLRPID(Constants down, Constants up);
void updateFBPID(Constants down, Constants up);
// Reference update method
void updateReferences(float avgReference, float lrDiffReference, float fbDiffReference);
```
These methods update the controller's internal values:
- **PID Constants:**
- `avgConsts` - Controls average height (repelling/attracting)
- `LConsts` - Controls left-right balance (RollLeftDown/RollLeftUp)
- `FConsts` - Controls front-back balance (RollFrontDown/RollFrontUp)
- **Reference Values:**
- `AvgRef` - Target average height
- `LRDiffRef` - Target left-right balance difference
- `FBDiffRef` - Target front-back balance difference
### Python GUI (serial_plotter.py)
#### Features
- **Individual PID Entry**: Each control mode has dedicated Kp, Ki, Kd input fields
- **Reference Value Controls**: Set avgRef, LRDiffRef, FBDiffRef targets
- **Send Button**: Each mode has its own "Send" button for individual updates
- **Send All**: A "Send All PID Values" button transmits all 6 modes at once
- **Send References**: Update all reference values with one click
- **Default Values**: GUI is pre-populated with the default values from the Arduino code
- **Scrollable Interface**: All PID controls are in a scrollable panel for easy access
#### Control Flow - PID Updates
1. User enters PID values in the GUI
2. Clicks "Send" for individual mode or "Send All" for batch update
3. Python formats the command: `PID,<mode>,<kp>,<ki>,<kd>\n`
4. Command is sent via serial to Arduino
5. Arduino parses the command and updates the controller
6. Changes take effect immediately in the control loop
#### Control Flow - Reference Updates
1. User enters reference values in the GUI (Avg Height, LR Diff, FB Diff)
2. Clicks "Send References"
3. Python formats the command: `REF,<avgRef>,<lrDiffRef>,<fbDiffRef>\n`
4. Command is sent via serial to Arduino
5. Arduino updates the reference variables and controller
6. New setpoints take effect immediately
## Usage Instructions
### Starting the GUI
```bash
python serial_plotter.py --port /dev/cu.usbmodemXXXX
```
Or for testing without hardware:
```bash
python serial_plotter.py --mock
```
### Tuning Workflow
1. **Start the application** - GUI launches with current PID values
2. **Connect to Arduino** - Serial connection established automatically
3. **Adjust values** - Modify Kp, Ki, Kd for desired control mode
4. **Send to Arduino** - Click "Send" for that mode or "Send All"
5. **Observe behavior** - Watch real-time plots to see the effect
6. **Iterate** - Adjust and resend as needed
### Tips for Tuning
- Start with one mode at a time
- Use "Send All" to load a complete tuning set
- Watch the real-time plots to observe the effect of changes
- The system updates immediately - no restart required
## Data Flow Summary
**PID Updates:**
```
GUI Input → Serial Command → Arduino Parse → Constants Update →
Controller Setter → Internal PID Update → Control Loop → PWM Output
```
**Reference Updates:**
```
GUI Input → Serial Command → Arduino Parse → Reference Variables Update →
Controller Setter → Internal Reference Update → Control Loop → PWM Output
```
## Compatibility Notes
- The GUI requires `tkinter` (included with most Python installations)
- Serial communication uses standard pyserial library
- Arduino code uses String parsing (ensure sufficient memory)
- Commands are processed in the main loop between control cycles
## Troubleshooting
### GUI doesn't send commands
- Check serial connection
- Verify port selection
- Look for error messages in console
### Arduino doesn't respond
- Ensure Arduino code is uploaded
- Check Serial Monitor for confirmation messages
- Verify baud rate (115200)
### Values don't take effect
- Confirm command format is correct
- Check that mode number (0-5) is valid
- Ensure values are within reasonable ranges
## Future Enhancements
Possible additions:
- Save/load PID profiles to/from file
- Preset tuning configurations
- Auto-tuning algorithms
- Real-time response visualization
- Logging of PID changes with timestamps

View File

@@ -39,8 +39,9 @@ void FullController::sendOutputs() {
zeroPWMs(); zeroPWMs();
} }
// The following assumes 0 direction drives repulsion and 1 direction drives attraction. // The following assumes 0 direction drives repulsion and 1 direction drives
// Using direct register writes to maintain fast PWM mode set by setupFastPWM() // attraction. Using direct register writes to maintain fast PWM mode set by
// setupFastPWM()
digitalWrite(dirFL, FLPWM < 0); digitalWrite(dirFL, FLPWM < 0);
OCR2A = abs(FLPWM); // Pin 11 -> Timer 2A OCR2A = abs(FLPWM); // Pin 11 -> Timer 2A
digitalWrite(dirBL, BLPWM < 0); digitalWrite(dirBL, BLPWM < 0);
@@ -58,7 +59,8 @@ void FullController::avgControl() {
avgError.eDiff = eCurr - avgError.e; avgError.eDiff = eCurr - avgError.e;
if (!oor) { if (!oor) {
avgError.eInt += eCurr; avgError.eInt += eCurr;
avgError.eInt = constrain(avgError.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM); avgError.eInt =
constrain(avgError.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM);
} }
avgError.e = eCurr; avgError.e = eCurr;
@@ -67,14 +69,18 @@ void FullController::avgControl() {
void FullController::LRControl() { void FullController::LRControl() {
float diff = Right.mmVal - Left.mmVal; // how far above the right is the left? float diff = Right.mmVal - Left.mmVal; // how far above the right is the left?
float eCurr = diff - LRDiffRef; // how different is that from the reference? positive -> Left repels, Right attracts. float eCurr = diff - LRDiffRef; // how different is that from the reference?
K_MAP rConsts = {LConsts.attracting, LConsts.repelling}; // apply attracting to repelling and vice versa. // positive -> Left repels, Right attracts.
K_MAP rConsts = {
LConsts.attracting,
LConsts.repelling}; // apply attracting to repelling and vice versa.
LRDiffErr.eDiff = eCurr - LRDiffErr.e; LRDiffErr.eDiff = eCurr - LRDiffErr.e;
if (!oor) { if (!oor) {
LRDiffErr.eInt += eCurr; LRDiffErr.eInt += eCurr;
LRDiffErr.eInt = constrain(LRDiffErr.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM); LRDiffErr.eInt =
constrain(LRDiffErr.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM);
} }
LRDiffErr.e = eCurr; LRDiffErr.e = eCurr;
@@ -85,14 +91,16 @@ void FullController::LRControl() {
void FullController::FBControl() { void FullController::FBControl() {
float diff = Back.mmVal - Front.mmVal; // how far above the back is the front? float diff = Back.mmVal - Front.mmVal; // how far above the back is the front?
float eCurr = diff - FBDiffRef; // how different is that from ref? pos.->Front must repel, Back must attract float eCurr = diff - FBDiffRef; // how different is that from ref? pos.->Front
// must repel, Back must attract
K_MAP bConsts = {FConsts.attracting, FConsts.repelling}; K_MAP bConsts = {FConsts.attracting, FConsts.repelling};
FBDiffErr.eDiff = eCurr - FBDiffErr.e; FBDiffErr.eDiff = eCurr - FBDiffErr.e;
if (!oor) { if (!oor) {
FBDiffErr.eInt += eCurr; FBDiffErr.eInt += eCurr;
FBDiffErr.eInt = constrain(FBDiffErr.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM); FBDiffErr.eInt =
constrain(FBDiffErr.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM);
} }
FBDiffErr.e = eCurr; FBDiffErr.e = eCurr;
@@ -102,35 +110,55 @@ void FullController::FBControl() {
} }
int16_t FullController::pwmFunc(K_MAP consts, Errors errs) { int16_t FullController::pwmFunc(K_MAP consts, Errors errs) {
if (oor) return 0; if (oor)
return 0;
Constants constants = (errs.e < 0) ? consts.attracting : consts.repelling; Constants constants = (errs.e < 0) ? consts.attracting : consts.repelling;
return (int)constrain(constants.kp*errs.e + constants.ki*errs.eInt + constants.kd*errs.eDiff, -(float)CAP,(float)CAP); return (int)(constants.kp * errs.e + constants.ki * errs.eInt +
constants.kd * errs.eDiff);
} }
void FullController::report() { void FullController::report() {
Serial.print("SENSORS - Left: "); // CSV Format: Left,Right,Front,Back,Avg,FLPWM,BLPWM,FRPWM,BRPWM,ControlOn
Serial.print(Left.mmVal); Serial.print(Left.mmVal);
Serial.print("mm, Right: "); Serial.print(",");
Serial.print(Right.mmVal); Serial.print(Right.mmVal);
Serial.print("mm, Front: "); Serial.print(",");
Serial.print(Front.mmVal); Serial.print(Front.mmVal);
Serial.print("mm, Back: "); Serial.print(",");
Serial.print(Back.mmVal); Serial.print(Back.mmVal);
Serial.print("mm,\n"); Serial.print(",");
Serial.print("AVG - "); Serial.print(avg);
Serial.println(avg); Serial.print(",");
Serial.print("PWMS - FL_PWM: ");
Serial.print(FLPWM); Serial.print(FLPWM);
Serial.print(", BL_PWM: "); Serial.print(",");
Serial.print(BLPWM); Serial.print(BLPWM);
Serial.print("FR_PWM: "); Serial.print(",");
Serial.print(FRPWM); Serial.print(FRPWM);
Serial.print("BR_PWM: "); Serial.print(",");
Serial.print(BRPWM); Serial.print(BRPWM);
Serial.print("\n"); Serial.print(",");
Serial.print("CONTROL ON - "); Serial.println(outputOn);
Serial.print(outputOn); }
Serial.print("\n");
void FullController::updateAvgPID(Constants repel, Constants attract) {
avgConsts.repelling = repel;
avgConsts.attracting = attract;
}
void FullController::updateLRPID(Constants down, Constants up) {
LConsts.repelling = down;
LConsts.attracting = up;
}
void FullController::updateFBPID(Constants down, Constants up) {
FConsts.repelling = down;
FConsts.attracting = up;
}
void FullController::updateReferences(float avgReference, float lrDiffReference, float fbDiffReference) {
AvgRef = avgReference;
LRDiffRef = lrDiffReference;
FBDiffRef = fbDiffReference;
} }

View File

@@ -45,7 +45,7 @@ class FullController {
bool outputOn; bool outputOn;
FullController(IndSensor& l, IndSensor& r, IndSensor& f, IndSensor& b, FullController(IndSensor& l, IndSensor& r, IndSensor& f, IndSensor& b,
FullConsts fullConsts, float avgRef, float lrDiffRef, float fbDiffRef, float slewRate) FullConsts fullConsts, float avgRef, float lrDiffRef, float fbDiffRef)
: Left(l), Right(r), Front(f), Back(b), AvgRef(avgRef), LRDiffRef(lrDiffRef), : Left(l), Right(r), Front(f), Back(b), AvgRef(avgRef), LRDiffRef(lrDiffRef),
FBDiffRef(fbDiffRef), avgConsts(fullConsts.avg), LConsts(fullConsts.lColl), FBDiffRef(fbDiffRef), avgConsts(fullConsts.avg), LConsts(fullConsts.lColl),
FConsts(fullConsts.fColl), avgError({0,0,0}), LRDiffErr({0,0,0}), FConsts(fullConsts.fColl), avgError({0,0,0}), LRDiffErr({0,0,0}),
@@ -56,12 +56,19 @@ class FullController {
void sendOutputs(); void sendOutputs();
void report(); void report();
// PID tuning methods
void updateAvgPID(Constants repel, Constants attract);
void updateLRPID(Constants down, Constants up);
void updateFBPID(Constants down, Constants up);
// Reference update methods
void updateReferences(float avgReference, float lrDiffReference, float fbDiffReference);
private: private:
void avgControl(); void avgControl();
void LRControl(); void LRControl();
void FBControl(); void FBControl();
int16_t pwmFunc(K_MAP consts, Errors errs); int16_t pwmFunc(K_MAP consts, Errors errs);
int16_t slewLimit(int16_t target, int16_t prev);
IndSensor& Front; IndSensor& Front;
IndSensor& Back; IndSensor& Back;

View File

@@ -0,0 +1,99 @@
//
// FILE: HX_calibration.ino
// AUTHOR: Rob Tillaart
// PURPOSE: HX711 calibration finder for offset and scale
// URL: https://github.com/RobTillaart/HX711
#include "HX711.h"
HX711 myScale;
// adjust pins if needed.
uint8_t dataPin = 2;
uint8_t clockPin = 3;
void setup()
{
Serial.begin(115200);
Serial.println();
Serial.println(__FILE__);
Serial.print("HX711_LIB_VERSION: ");
Serial.println(HX711_LIB_VERSION);
Serial.println();
myScale.begin(dataPin, clockPin);
myScale.set_offset(26784);
myScale.set_scale(106.557518);
}
void loop()
{
// Serial.println(myScale.get_units());
calibrate();
}
void calibrate()
{
Serial.println("\n\nCALIBRATION\n===========");
Serial.println("remove all weight from the loadcell");
// flush Serial input
while (Serial.available()) Serial.read();
Serial.println("and enter any message into serial.\n");
while (Serial.available() == 0);
Serial.println("Determine zero weight offset");
// average 20 measurements.
myScale.tare(20);
int32_t offset = myScale.get_offset();
Serial.print("OFFSET: ");
Serial.println(offset);
Serial.println();
Serial.println("place a weight on the loadcell");
// flush Serial input
while (Serial.available()) Serial.read();
Serial.println("enter the weight in (whole) grams and enter 'e'");
int16_t weight = 0;
bool neg = false;
while (Serial.peek() != 'e')
{
if (Serial.available())
{
char ch = Serial.read();
if (isdigit(ch))
{
weight *= 10;
weight = weight + (ch - '0');
}
else if (ch == '-') neg = true;
}
}
if (neg) weight *= -1;
Serial.print("WEIGHT: ");
Serial.println(weight);
myScale.calibrate_scale(weight, 20);
float scale = myScale.get_scale();
Serial.print("SCALE: ");
Serial.println(scale, 6);
Serial.print("\nuse scale.set_offset(");
Serial.print(offset);
Serial.print("); and scale.set_scale(");
Serial.print(scale, 6);
Serial.print(");\n");
Serial.println("in the setup of your project");
Serial.println("\n\n");
}
// -- END OF FILE --

View File

@@ -12,3 +12,4 @@ python-dateutil==2.9.0.post0
scipy==1.16.3 scipy==1.16.3
six==1.17.0 six==1.17.0
sympy==1.14.0 sympy==1.14.0
pyserial==3.5

653
serial_plotter.py Normal file
View File

@@ -0,0 +1,653 @@
import serial
import serial.tools.list_ports
import matplotlib
matplotlib.use('TkAgg') # Use TkAgg backend explicitly
import matplotlib.pyplot as plt
import matplotlib.animation as animation
from matplotlib.backends.backend_tkagg import FigureCanvasTkAgg
from collections import deque
import argparse
import time
import random
import threading
import sys
from datetime import datetime
import queue
import tkinter as tk
from tkinter import ttk
# Constants
BAUD_RATE = 2000000
MAX_POINTS = 100 # Number of points to display on the plot
# Save queue for handling saves in main thread
save_queue = queue.Queue()
# Data storage
data = {
"Left": deque(maxlen=MAX_POINTS),
"Right": deque(maxlen=MAX_POINTS),
"Front": deque(maxlen=MAX_POINTS),
"Back": deque(maxlen=MAX_POINTS),
"Avg": deque(maxlen=MAX_POINTS),
"FLPWM": deque(maxlen=MAX_POINTS),
"BLPWM": deque(maxlen=MAX_POINTS),
"FRPWM": deque(maxlen=MAX_POINTS),
"BRPWM": deque(maxlen=MAX_POINTS),
"ControlOn": deque(maxlen=MAX_POINTS),
"Time": deque(maxlen=MAX_POINTS)
}
# Recording data storage (no max length limit)
recording_data = {
"Left": [],
"Right": [],
"Front": [],
"Back": [],
"Avg": [],
"FLPWM": [],
"BLPWM": [],
"FRPWM": [],
"BRPWM": [],
"ControlOn": [],
"Time": []
}
start_time = time.time()
recording = False
recording_start_time = None
def get_serial_port():
ports = list(serial.tools.list_ports.comports())
if not ports:
return None
print("Available ports:")
for i, p in enumerate(ports):
print(f"{i}: {p.device} - {p.description}")
if len(ports) == 1:
return ports[0].device
try:
selection = int(input("Select port index: "))
return ports[selection].device
except (ValueError, IndexError):
print("Invalid selection.")
return None
def mock_data_generator():
"""Generates mock data in the expected CSV format."""
while True:
# Simulate sensor readings (around 12.0mm with noise)
left = 12.0 + random.uniform(-0.5, 0.5)
right = 12.0 + random.uniform(-0.5, 0.5)
front = 12.0 + random.uniform(-0.5, 0.5)
back = 12.0 + random.uniform(-0.5, 0.5)
avg = (left + right + front + back) / 4.0
# Simulate PWM values (around 0 with noise)
fl_pwm = random.randint(-50, 50)
bl_pwm = random.randint(-50, 50)
fr_pwm = random.randint(-50, 50)
br_pwm = random.randint(-50, 50)
control_on = 1
# CSV Format: Left,Right,Front,Back,Avg,FLPWM,BLPWM,FRPWM,BRPWM,ControlOn
line = f"{left:.2f},{right:.2f},{front:.2f},{back:.2f},{avg:.2f},{fl_pwm},{bl_pwm},{fr_pwm},{br_pwm},{control_on}"
yield line
time.sleep(0.01) # 100Hz
def read_serial(ser, mock=False):
"""Reads data from serial port or mock generator."""
global recording, recording_start_time
generator = mock_data_generator() if mock else None
while True:
try:
if mock:
line = next(generator)
else:
if ser.in_waiting:
line = ser.readline().decode('utf-8').strip()
else:
continue
parts = line.split(',')
if len(parts) == 10:
current_time = time.time() - start_time
left = float(parts[0])
right = float(parts[1])
front = float(parts[2])
back = float(parts[3])
avg = float(parts[4])
flpwm = float(parts[5])
blpwm = float(parts[6])
frpwm = float(parts[7])
brpwm = float(parts[8])
control_on = int(parts[9])
# Update live display data
data["Left"].append(left)
data["Right"].append(right)
data["Front"].append(front)
data["Back"].append(back)
data["Avg"].append(avg)
data["FLPWM"].append(flpwm)
data["BLPWM"].append(blpwm)
data["FRPWM"].append(frpwm)
data["BRPWM"].append(brpwm)
data["ControlOn"].append(control_on)
data["Time"].append(current_time)
# If recording, store in unlimited buffer
if recording:
recording_time = current_time - recording_start_time
recording_data["Left"].append(left)
recording_data["Right"].append(right)
recording_data["Front"].append(front)
recording_data["Back"].append(back)
recording_data["Avg"].append(avg)
recording_data["FLPWM"].append(flpwm)
recording_data["BLPWM"].append(blpwm)
recording_data["FRPWM"].append(frpwm)
recording_data["BRPWM"].append(brpwm)
recording_data["ControlOn"].append(control_on)
recording_data["Time"].append(recording_time)
except ValueError:
pass # Ignore parse errors
except Exception as e:
print(f"Error reading data: {e}")
if not mock:
break
def save_recording(metadata=None):
"""Save the recorded data to a high-quality PNG file."""
global recording_data
if not recording_data["Time"]:
print("No data recorded to save.")
return
# Generate filename with timestamp
timestamp = datetime.now().strftime("%Y%m%d_%H%M%S")
# Create directory if it doesn't exist
import os
save_dir = "tuningTrials"
os.makedirs(save_dir, exist_ok=True)
filename = f"{save_dir}/trial_{timestamp}.png"
# Create a completely independent figure with Agg backend
import matplotlib
from matplotlib.figure import Figure
from matplotlib.backends.backend_agg import FigureCanvasAgg
save_fig = Figure(figsize=(14, 10))
canvas = FigureCanvasAgg(save_fig)
save_fig.suptitle(f'Levitation Control Trial - {timestamp}', fontsize=16, fontweight='bold')
# Plot Sensors
ax1 = save_fig.add_subplot(2, 1, 1)
ax1.plot(recording_data["Time"], recording_data["Left"], label="Left", linewidth=2)
ax1.plot(recording_data["Time"], recording_data["Right"], label="Right", linewidth=2)
ax1.plot(recording_data["Time"], recording_data["Front"], label="Front", linewidth=2)
ax1.plot(recording_data["Time"], recording_data["Back"], label="Back", linewidth=2)
ax1.plot(recording_data["Time"], recording_data["Avg"], label="Avg", linestyle='--', color='black', linewidth=2.5)
ax1.set_ylabel("Distance (mm)", fontsize=12, fontweight='bold')
ax1.legend(loc='upper right', fontsize=10)
ax1.set_title("Sensor Readings", fontsize=14, fontweight='bold')
ax1.grid(True, alpha=0.3)
ax1.set_xlim([0, recording_data["Time"][-1]])
# Plot PWMs
ax2 = save_fig.add_subplot(2, 1, 2)
ax2.plot(recording_data["Time"], recording_data["FLPWM"], label="FL", linewidth=2)
ax2.plot(recording_data["Time"], recording_data["BLPWM"], label="BL", linewidth=2)
ax2.plot(recording_data["Time"], recording_data["FRPWM"], label="FR", linewidth=2)
ax2.plot(recording_data["Time"], recording_data["BRPWM"], label="BR", linewidth=2)
ax2.set_ylabel("PWM Value", fontsize=12, fontweight='bold')
ax2.set_xlabel("Time (s)", fontsize=12, fontweight='bold')
ax2.legend(loc='upper right', fontsize=10)
ax2.set_title("PWM Outputs", fontsize=14, fontweight='bold')
ax2.grid(True, alpha=0.3)
ax2.set_xlim([0, recording_data["Time"][-1]])
save_fig.tight_layout()
# Save with high DPI using the canvas
canvas.print_figure(filename, dpi=300, bbox_inches='tight')
print(f"\n{'='*60}")
print(f"Trial data saved to: {filename}")
print(f"Duration: {recording_data['Time'][-1]:.2f} seconds")
print(f"Data points: {len(recording_data['Time'])}")
# Save metadata if provided
if metadata:
txt_filename = f"{save_dir}/trial_{timestamp}.txt"
try:
with open(txt_filename, 'w') as f:
f.write(f"Trial Timestamp: {timestamp}\n")
f.write(f"Duration: {recording_data['Time'][-1]:.2f} seconds\n")
f.write(f"Data Points: {len(recording_data['Time'])}\n\n")
f.write("=== Reference Values ===\n")
if "references" in metadata:
for key, value in metadata["references"].items():
f.write(f"{key}: {value}\n")
f.write("\n")
f.write("=== PID Parameters ===\n")
if "pid" in metadata:
for mode, values in metadata["pid"].items():
f.write(f"[{mode}]\n")
f.write(f" Kp: {values['Kp']}\n")
f.write(f" Ki: {values['Ki']}\n")
f.write(f" Kd: {values['Kd']}\n")
f.write("\n")
print(f"Metadata saved to: {txt_filename}")
except Exception as e:
print(f"Failed to save metadata: {e}")
print(f"{'='*60}\n")
def update_plot(frame):
global recording
# Check if there's a save request
try:
while not save_queue.empty():
item = save_queue.get_nowait()
if isinstance(item, dict):
save_recording(metadata=item)
else:
save_recording()
except:
pass
plt.clf()
# Add recording indicator
fig = plt.gcf()
if recording:
fig.patch.set_facecolor('#ffe6e6') # Light red background when recording
else:
fig.patch.set_facecolor('white')
# Plot Sensors
plt.subplot(2, 1, 1)
plt.plot(data["Time"], data["Left"], label="Left")
plt.plot(data["Time"], data["Right"], label="Right")
plt.plot(data["Time"], data["Front"], label="Front")
plt.plot(data["Time"], data["Back"], label="Back")
plt.plot(data["Time"], data["Avg"], label="Avg", linestyle='--', color='black')
plt.ylabel("Distance (mm)")
plt.legend(loc='upper right')
title = "Sensor Readings"
if recording:
title += " [RECORDING]"
plt.title(title)
plt.grid(True)
# Plot PWMs
plt.subplot(2, 1, 2)
plt.plot(data["Time"], data["FLPWM"], label="FL")
plt.plot(data["Time"], data["BLPWM"], label="BL")
plt.plot(data["Time"], data["FRPWM"], label="FR")
plt.plot(data["Time"], data["BRPWM"], label="BR")
plt.ylabel("PWM Value")
plt.xlabel("Time (s)")
plt.legend(loc='upper right')
title = "PWM Outputs"
if recording:
title += " [RECORDING]"
plt.title(title)
plt.grid(True)
plt.tight_layout()
def main():
parser = argparse.ArgumentParser(description='Serial Plotter for Levitation Control')
parser.add_argument('--port', type=str, help='Serial port to connect to')
parser.add_argument('--mock', action='store_true', help='Use mock data instead of serial')
args = parser.parse_args()
ser = None
if not args.mock:
port = args.port or get_serial_port()
if not port:
print("No serial port found or selected. Use --mock to test without hardware.")
return
try:
ser = serial.Serial(port, BAUD_RATE, timeout=1)
print(f"Connected to {port} at {BAUD_RATE} baud.")
except serial.SerialException as e:
print(f"Error connecting to serial port: {e}")
return
# Start data reading thread
thread = threading.Thread(target=read_serial, args=(ser, args.mock), daemon=True)
thread.start()
# Send initial start command
if ser:
try:
print("Sending start command...")
ser.write(b'1')
except Exception as e:
print(f"Failed to send start command: {e}")
# Create Tkinter window
root = tk.Tk()
root.title("Levitation Control - Serial Plotter")
# Create main container
main_container = ttk.Frame(root)
main_container.pack(fill=tk.BOTH, expand=True)
# Left panel for controls
control_panel = ttk.Frame(main_container, width=400)
control_panel.pack(side=tk.LEFT, fill=tk.BOTH, padx=5, pady=5)
# Right panel for plot
plot_panel = ttk.Frame(main_container)
plot_panel.pack(side=tk.RIGHT, fill=tk.BOTH, expand=True, padx=5, pady=5)
# === CONTROL BUTTONS ===
btn_frame = ttk.LabelFrame(control_panel, text="Control", padding=10)
btn_frame.pack(fill=tk.X, pady=5)
def start_control():
if ser:
ser.write(b'1')
print("Control started")
global recording, recording_start_time, recording_data
recording = True
recording_start_time = time.time() - start_time
for key in recording_data:
recording_data[key] = []
def stop_control():
if ser:
ser.write(b'0')
print("Control stopped")
global recording
if recording:
recording = False
# Collect metadata
metadata = {
"references": {
"Avg Height": avg_ref_entry.get(),
"LR Diff": lr_diff_entry.get(),
"FB Diff": fb_diff_entry.get()
},
"pid": {}
}
# Collect PID values
for name, _, _, _, _ in pid_modes:
kp_e, ki_e, kd_e = pid_entries[name]
metadata["pid"][name] = {
"Kp": kp_e.get(),
"Ki": ki_e.get(),
"Kd": kd_e.get()
}
save_queue.put(metadata)
ttk.Button(btn_frame, text="Start Control & Record", command=start_control, width=25).pack(pady=2)
ttk.Button(btn_frame, text="Stop Control & Save", command=stop_control, width=25).pack(pady=2)
# === REFERENCE VALUES ===
ref_frame = ttk.LabelFrame(control_panel, text="Reference Values", padding=10)
ref_frame.pack(fill=tk.X, pady=5)
# Average Reference
ttk.Label(ref_frame, text="Avg Height (mm):", width=15).grid(row=0, column=0, sticky=tk.W, pady=2)
avg_ref_entry = ttk.Entry(ref_frame, width=12)
avg_ref_entry.insert(0, "11.0")
avg_ref_entry.grid(row=0, column=1, padx=5, pady=2)
# Left-Right Diff Reference
ttk.Label(ref_frame, text="LR Diff (mm):", width=15).grid(row=1, column=0, sticky=tk.W, pady=2)
lr_diff_entry = ttk.Entry(ref_frame, width=12)
lr_diff_entry.insert(0, "-2.0")
lr_diff_entry.grid(row=1, column=1, padx=5, pady=2)
# Front-Back Diff Reference
ttk.Label(ref_frame, text="FB Diff (mm):", width=15).grid(row=2, column=0, sticky=tk.W, pady=2)
fb_diff_entry = ttk.Entry(ref_frame, width=12)
fb_diff_entry.insert(0, "0.0")
fb_diff_entry.grid(row=2, column=1, padx=5, pady=2)
def send_references():
try:
avg_ref = float(avg_ref_entry.get())
lr_diff = float(lr_diff_entry.get())
fb_diff = float(fb_diff_entry.get())
cmd = f"REF,{avg_ref},{lr_diff},{fb_diff}\n"
if ser:
ser.write(cmd.encode('utf-8'))
print(f"Sent References: Avg={avg_ref}, LR={lr_diff}, FB={fb_diff}")
else:
print(f"Mock mode - would send: {cmd.strip()}")
except ValueError as e:
print(f"Error: Invalid reference values - {e}")
ttk.Button(ref_frame, text="Send References", command=send_references, width=25).grid(row=3, column=0, columnspan=2, pady=10)
# === PID TUNING ===
pid_frame = ttk.LabelFrame(control_panel, text="PID Tuning", padding=10)
pid_frame.pack(fill=tk.BOTH, expand=True, pady=5)
# Create scrollable frame
canvas = tk.Canvas(pid_frame, height=500)
scrollbar = ttk.Scrollbar(pid_frame, orient="vertical", command=canvas.yview)
scrollable_frame = ttk.Frame(canvas)
scrollable_frame.bind(
"<Configure>",
lambda e: canvas.configure(scrollregion=canvas.bbox("all"))
)
canvas.create_window((0, 0), window=scrollable_frame, anchor="nw")
canvas.configure(yscrollcommand=scrollbar.set)
# PID modes with default values from the .ino file
pid_modes = [
("Repelling", 0, 250, 0, 1000),
("Attracting", 1, 250, 0, 1000),
("RollLeftDown", 2, 0, 0, 100),
("RollLeftUp", 3, 0, 0, 100),
("RollFrontDown", 4, 0, 0, 500),
("RollFrontUp", 5, 0, 0, 500),
]
pid_entries = {}
for name, mode, default_kp, default_ki, default_kd in pid_modes:
mode_frame = ttk.LabelFrame(scrollable_frame, text=name, padding=5)
mode_frame.pack(fill=tk.X, pady=5, padx=5)
# Kp
ttk.Label(mode_frame, text="Kp:", width=5).grid(row=0, column=0, sticky=tk.W)
kp_entry = ttk.Entry(mode_frame, width=12)
kp_entry.insert(0, str(default_kp))
kp_entry.grid(row=0, column=1, padx=5)
# Ki
ttk.Label(mode_frame, text="Ki:", width=5).grid(row=1, column=0, sticky=tk.W)
ki_entry = ttk.Entry(mode_frame, width=12)
ki_entry.insert(0, str(default_ki))
ki_entry.grid(row=1, column=1, padx=5)
# Kd
ttk.Label(mode_frame, text="Kd:", width=5).grid(row=2, column=0, sticky=tk.W)
kd_entry = ttk.Entry(mode_frame, width=12)
kd_entry.insert(0, str(default_kd))
kd_entry.grid(row=2, column=1, padx=5)
# Send button
def make_send_func(mode_num, kp_e, ki_e, kd_e, mode_name):
def send_pid():
try:
kp = float(kp_e.get())
ki = float(ki_e.get())
kd = float(kd_e.get())
cmd = f"PID,{mode_num},{kp},{ki},{kd}\n"
if ser:
ser.write(cmd.encode('utf-8'))
print(f"Sent {mode_name}: Kp={kp}, Ki={ki}, Kd={kd}")
else:
print(f"Mock mode - would send: {cmd.strip()}")
except ValueError as e:
print(f"Error: Invalid PID values - {e}")
return send_pid
send_btn = ttk.Button(mode_frame, text="Send",
command=make_send_func(mode, kp_entry, ki_entry, kd_entry, name),
width=10)
send_btn.grid(row=3, column=0, columnspan=2, pady=5)
pid_entries[name] = (kp_entry, ki_entry, kd_entry)
# Send All button
def send_all_pid():
for name, mode, _, _, _ in pid_modes:
kp_e, ki_e, kd_e = pid_entries[name]
try:
kp = float(kp_e.get())
ki = float(ki_e.get())
kd = float(kd_e.get())
cmd = f"PID,{mode},{kp},{ki},{kd}\n"
if ser:
ser.write(cmd.encode('utf-8'))
time.sleep(0.05) # Small delay between commands
print(f"Sent {name}: Kp={kp}, Ki={ki}, Kd={kd}")
except ValueError as e:
print(f"Error in {name}: {e}")
send_all_frame = ttk.Frame(scrollable_frame)
send_all_frame.pack(fill=tk.X, pady=10, padx=5)
ttk.Button(send_all_frame, text="Send All PID Values", command=send_all_pid, width=25).pack()
canvas.pack(side=tk.LEFT, fill=tk.BOTH, expand=True)
scrollbar.pack(side=tk.RIGHT, fill=tk.Y)
# === PLOT SETUP ===
fig, (ax1, ax2) = plt.subplots(2, 1, figsize=(10, 8))
fig.tight_layout(pad=3.0)
canvas_plot = FigureCanvasTkAgg(fig, master=plot_panel)
canvas_plot.get_tk_widget().pack(fill=tk.BOTH, expand=True)
# Setup axes once
ax1.set_ylabel("Distance (mm)")
ax1.grid(True)
ax1.set_title("Sensor Readings")
ax2.set_ylabel("PWM Value")
ax2.set_xlabel("Time (s)")
ax2.grid(True)
ax2.set_title("PWM Outputs")
# Initialize line objects for efficient updating
line_left, = ax1.plot([], [], label="Left")
line_right, = ax1.plot([], [], label="Right")
line_front, = ax1.plot([], [], label="Front")
line_back, = ax1.plot([], [], label="Back")
line_avg, = ax1.plot([], [], label="Avg", linestyle='--', color='black', linewidth=1.5)
line_fl, = ax2.plot([], [], label="FL")
line_bl, = ax2.plot([], [], label="BL")
line_fr, = ax2.plot([], [], label="FR")
line_br, = ax2.plot([], [], label="BR")
# Create legends after line objects
ax1.legend(loc='upper right')
ax2.legend(loc='upper right')
# Track recording state to minimize updates
_was_recording = False
def update_plot(frame):
global recording
nonlocal _was_recording
# Check if there's a save request
try:
while not save_queue.empty():
item = save_queue.get_nowait()
if isinstance(item, dict):
save_recording(metadata=item)
else:
save_recording()
except:
pass
# Only update background color when recording state changes
if recording != _was_recording:
if recording:
fig.patch.set_facecolor('#ffe6e6')
ax1.set_title("Sensor Readings [RECORDING]")
ax2.set_title("PWM Outputs [RECORDING]")
else:
fig.patch.set_facecolor('white')
ax1.set_title("Sensor Readings")
ax2.set_title("PWM Outputs")
_was_recording = recording
# Update line data efficiently (no clear/replot)
if len(data["Time"]) > 0:
time_data = list(data["Time"])
line_left.set_data(time_data, list(data["Left"]))
line_right.set_data(time_data, list(data["Right"]))
line_front.set_data(time_data, list(data["Front"]))
line_back.set_data(time_data, list(data["Back"]))
line_avg.set_data(time_data, list(data["Avg"]))
line_fl.set_data(time_data, list(data["FLPWM"]))
line_bl.set_data(time_data, list(data["BLPWM"]))
line_fr.set_data(time_data, list(data["FRPWM"]))
line_br.set_data(time_data, list(data["BRPWM"]))
# Auto-scale axes
ax1.relim()
ax1.autoscale_view()
ax2.relim()
ax2.autoscale_view()
canvas_plot.draw_idle()
def on_close():
print("Window closed. Exiting script.")
if ser:
ser.close()
root.quit()
root.destroy()
sys.exit()
root.protocol("WM_DELETE_WINDOW", on_close)
# Start animation with slower interval for smoother GUI (100ms = 10 FPS is sufficient)
ani = animation.FuncAnimation(fig, update_plot, interval=100, cache_frame_data=False, blit=False)
print("\n" + "="*60)
print("SERIAL PLOTTER - GUI MODE")
print("="*60)
print(" Use buttons to start/stop control and recording")
print(" Adjust PID values and click 'Send' to update Arduino")
print("="*60 + "\n")
root.mainloop()
if __name__ == "__main__":
main()