Loaded new mass and inertial characteristics into sim, ported sim arch into arduino code
This commit is contained in:
@@ -4,43 +4,40 @@
|
||||
#include "ADC.hpp"
|
||||
#include "FastPWM.hpp"
|
||||
|
||||
// K, Ki, Kd Constants
|
||||
Constants repelling = {250, 0, 1000};
|
||||
Constants attracting = {250, 0, 1000};
|
||||
// ── PID Gains (Kp, Ki, Kd) ──────────────────────────────────
|
||||
// Height loop: controls average gap → additive PWM on all coils
|
||||
PIDGains heightGains = { 100.0f, 0.0f, 8.0f };
|
||||
|
||||
Constants RollLeftUp = {0, 0, 100};
|
||||
Constants RollLeftDown = {0, 0, 100};
|
||||
// Roll loop: corrects left/right tilt → differential L/R
|
||||
PIDGains rollGains = { 0.6f, 0.0f, -0.1f };
|
||||
|
||||
Constants RollFrontUp = {0, 0, 500};
|
||||
Constants RollFrontDown = {0, 0, 500};
|
||||
// Pitch loop: corrects front/back tilt → differential F/B
|
||||
PIDGains pitchGains = { 50.0f, 0.0f, 1.9f };
|
||||
|
||||
// Reference values for average dist,
|
||||
float avgRef = 11.0; // TBD: what is our equilibrium height with this testrig?
|
||||
float LRDiffRef = -2.0; // TBD: what is our left-right balance equilibrium? Positive -> left is above right
|
||||
float FBDiffRef = 0.0; // TBD: what is front-back balance equilibrium? Positive -> front above back.
|
||||
// ── Reference ────────────────────────────────────────────────
|
||||
float avgRef = 12.36f; // Target gap height (mm) — 9.4 kg equilibrium
|
||||
|
||||
// Might be useful for things like jitter or lag.
|
||||
#define sampling_rate 1000 // Hz
|
||||
// ── Feedforward ──────────────────────────────────────────────
|
||||
bool useFeedforward = true; // Set false to disable feedforward LUT
|
||||
|
||||
// EMA filter alpha value (all sensors use same alpha)
|
||||
#define alphaVal 0.3f
|
||||
// ── Sampling ─────────────────────────────────────────────────
|
||||
#define SAMPLING_RATE 200 // Hz (controller tick rate)
|
||||
|
||||
// ── EMA filter alpha (all sensors) ───────────────────────────
|
||||
#define ALPHA_VAL 1.0f
|
||||
|
||||
// ═══════════════════════════════════════════════════════════════
|
||||
// ABOVE THIS LINE IS TUNING VALUES ONLY, BELOW IS ACTUAL CODE.
|
||||
// ═══════════════════════════════════════════════════════════════
|
||||
|
||||
unsigned long tprior;
|
||||
unsigned int tDiffMicros;
|
||||
|
||||
FullConsts fullConsts = {
|
||||
{repelling, attracting},
|
||||
{RollLeftDown, RollLeftUp},
|
||||
{RollFrontDown, RollFrontUp}
|
||||
};
|
||||
FullController controller(indL, indR, indF, indB,
|
||||
heightGains, rollGains, pitchGains,
|
||||
avgRef, useFeedforward);
|
||||
|
||||
FullController controller(indL, indR, indF, indB, fullConsts, avgRef, LRDiffRef, FBDiffRef);
|
||||
|
||||
const int dt_micros = 1e6/sampling_rate;
|
||||
|
||||
#define LEV_ON
|
||||
const int dt_micros = 1000000 / SAMPLING_RATE;
|
||||
|
||||
int ON = 0;
|
||||
|
||||
@@ -49,10 +46,10 @@ void setup() {
|
||||
setupADC();
|
||||
setupFastPWM();
|
||||
|
||||
indL.alpha = alphaVal;
|
||||
indR.alpha = alphaVal;
|
||||
indF.alpha = alphaVal;
|
||||
indB.alpha = alphaVal;
|
||||
indL.alpha = ALPHA_VAL;
|
||||
indR.alpha = ALPHA_VAL;
|
||||
indF.alpha = ALPHA_VAL;
|
||||
indB.alpha = ALPHA_VAL;
|
||||
|
||||
tprior = micros();
|
||||
|
||||
@@ -71,106 +68,72 @@ void loop() {
|
||||
String cmd = Serial.readStringUntil('\n');
|
||||
cmd.trim();
|
||||
|
||||
// Check if it's a reference update command (format: REF,avgRef,lrDiffRef,fbDiffRef)
|
||||
// REF,avgRef — update target gap height
|
||||
if (cmd.startsWith("REF,")) {
|
||||
int firstComma = cmd.indexOf(',');
|
||||
int secondComma = cmd.indexOf(',', firstComma + 1);
|
||||
int thirdComma = cmd.indexOf(',', secondComma + 1);
|
||||
|
||||
if (firstComma > 0 && secondComma > 0 && thirdComma > 0) {
|
||||
float newAvgRef = cmd.substring(firstComma + 1, secondComma).toFloat();
|
||||
float newLRDiffRef = cmd.substring(secondComma + 1, thirdComma).toFloat();
|
||||
float newFBDiffRef = cmd.substring(thirdComma + 1).toFloat();
|
||||
|
||||
avgRef = newAvgRef;
|
||||
LRDiffRef = newLRDiffRef;
|
||||
FBDiffRef = newFBDiffRef;
|
||||
|
||||
controller.updateReferences(avgRef, LRDiffRef, FBDiffRef);
|
||||
Serial.print("Updated References: Avg=");
|
||||
Serial.print(avgRef);
|
||||
Serial.print(", LR=");
|
||||
Serial.print(LRDiffRef);
|
||||
Serial.print(", FB=");
|
||||
Serial.println(FBDiffRef);
|
||||
}
|
||||
float newRef = cmd.substring(4).toFloat();
|
||||
avgRef = newRef;
|
||||
controller.updateReference(avgRef);
|
||||
Serial.print("Updated Ref: ");
|
||||
Serial.println(avgRef);
|
||||
}
|
||||
// Check if it's a PID tuning command (format: PID,mode,kp,ki,kd)
|
||||
// PID,loop,kp,ki,kd — update gains (loop: 0=height, 1=roll, 2=pitch)
|
||||
else if (cmd.startsWith("PID,")) {
|
||||
int firstComma = cmd.indexOf(',');
|
||||
int secondComma = cmd.indexOf(',', firstComma + 1);
|
||||
int thirdComma = cmd.indexOf(',', secondComma + 1);
|
||||
int fourthComma = cmd.indexOf(',', thirdComma + 1);
|
||||
int c1 = cmd.indexOf(',');
|
||||
int c2 = cmd.indexOf(',', c1 + 1);
|
||||
int c3 = cmd.indexOf(',', c2 + 1);
|
||||
int c4 = cmd.indexOf(',', c3 + 1);
|
||||
|
||||
if (firstComma > 0 && secondComma > 0 && thirdComma > 0 && fourthComma > 0) {
|
||||
int mode = cmd.substring(firstComma + 1, secondComma).toInt();
|
||||
float kp = cmd.substring(secondComma + 1, thirdComma).toFloat();
|
||||
float ki = cmd.substring(thirdComma + 1, fourthComma).toFloat();
|
||||
float kd = cmd.substring(fourthComma + 1).toFloat();
|
||||
if (c1 > 0 && c2 > 0 && c3 > 0 && c4 > 0) {
|
||||
int loop = cmd.substring(c1 + 1, c2).toInt();
|
||||
float kp = cmd.substring(c2 + 1, c3).toFloat();
|
||||
float ki = cmd.substring(c3 + 1, c4).toFloat();
|
||||
float kd = cmd.substring(c4 + 1).toFloat();
|
||||
|
||||
Constants newConst = {kp, ki, kd};
|
||||
PIDGains g = { kp, ki, kd };
|
||||
|
||||
// Mode mapping:
|
||||
// 0: Repelling
|
||||
// 1: Attracting
|
||||
// 2: RollLeftDown
|
||||
// 3: RollLeftUp
|
||||
// 4: RollFrontDown
|
||||
// 5: RollFrontUp
|
||||
|
||||
switch(mode) {
|
||||
case 0: // Repelling
|
||||
repelling = newConst;
|
||||
controller.updateAvgPID(repelling, attracting);
|
||||
Serial.println("Updated Repelling PID");
|
||||
switch (loop) {
|
||||
case 0:
|
||||
heightGains = g;
|
||||
controller.updateHeightPID(g);
|
||||
Serial.println("Updated Height PID");
|
||||
break;
|
||||
case 1: // Attracting
|
||||
attracting = newConst;
|
||||
controller.updateAvgPID(repelling, attracting);
|
||||
Serial.println("Updated Attracting PID");
|
||||
case 1:
|
||||
rollGains = g;
|
||||
controller.updateRollPID(g);
|
||||
Serial.println("Updated Roll PID");
|
||||
break;
|
||||
case 2: // RollLeftDown
|
||||
RollLeftDown = newConst;
|
||||
controller.updateLRPID(RollLeftDown, RollLeftUp);
|
||||
Serial.println("Updated RollLeftDown PID");
|
||||
break;
|
||||
case 3: // RollLeftUp
|
||||
RollLeftUp = newConst;
|
||||
controller.updateLRPID(RollLeftDown, RollLeftUp);
|
||||
Serial.println("Updated RollLeftUp PID");
|
||||
break;
|
||||
case 4: // RollFrontDown
|
||||
RollFrontDown = newConst;
|
||||
controller.updateFBPID(RollFrontDown, RollFrontUp);
|
||||
Serial.println("Updated RollFrontDown PID");
|
||||
break;
|
||||
case 5: // RollFrontUp
|
||||
RollFrontUp = newConst;
|
||||
controller.updateFBPID(RollFrontDown, RollFrontUp);
|
||||
Serial.println("Updated RollFrontUp PID");
|
||||
case 2:
|
||||
pitchGains = g;
|
||||
controller.updatePitchPID(g);
|
||||
Serial.println("Updated Pitch PID");
|
||||
break;
|
||||
default:
|
||||
Serial.println("Invalid mode");
|
||||
Serial.println("Invalid loop (0=height, 1=roll, 2=pitch)");
|
||||
break;
|
||||
}
|
||||
}
|
||||
} else {
|
||||
// Original control on/off command
|
||||
}
|
||||
// FF,0 or FF,1 — toggle feedforward
|
||||
else if (cmd.startsWith("FF,")) {
|
||||
bool en = (cmd.charAt(3) != '0');
|
||||
useFeedforward = en;
|
||||
controller.setFeedforward(en);
|
||||
Serial.print("Feedforward: ");
|
||||
Serial.println(en ? "ON" : "OFF");
|
||||
}
|
||||
else {
|
||||
// Original on/off command (any char except '0' turns on)
|
||||
controller.outputOn = (cmd.charAt(0) != '0');
|
||||
}
|
||||
}
|
||||
|
||||
tDiffMicros = micros() - tprior;
|
||||
|
||||
if (tDiffMicros >= dt_micros){
|
||||
if (tDiffMicros >= dt_micros) {
|
||||
controller.update();
|
||||
controller.report();
|
||||
controller.sendOutputs();
|
||||
// this and the previous line can be switched if you want the PWMs to display 0 when controller off.
|
||||
controller.sendOutputs();
|
||||
|
||||
tprior = micros(); // maybe we have to move this line to before the update commands?
|
||||
// since the floating point arithmetic may take a while...
|
||||
tprior = micros();
|
||||
}
|
||||
|
||||
//Serial.println(telapsed);
|
||||
}
|
||||
@@ -2189,14 +2189,14 @@
|
||||
"id": "21babeb3",
|
||||
"metadata": {},
|
||||
"source": [
|
||||
"### Now, let's find the equilibrium height for our pod, given mass of 5.8 kg. \n",
|
||||
"### Now, let's find the equilibrium height for our pod, given mass of 9.4 kg. \n",
|
||||
"\n",
|
||||
"5.8 kg * 9.81 $m/s^2$ = 56.898 N"
|
||||
"9.4 kg * 9.81 $m/s^2$ = 56.898 N"
|
||||
]
|
||||
},
|
||||
{
|
||||
"cell_type": "code",
|
||||
"execution_count": 50,
|
||||
"execution_count": 1,
|
||||
"id": "badbc379",
|
||||
"metadata": {},
|
||||
"outputs": [
|
||||
@@ -2204,23 +2204,27 @@
|
||||
"name": "stdout",
|
||||
"output_type": "stream",
|
||||
"text": [
|
||||
"Loading maglev model from /Users/adipu/Documents/guadaloop_lev_control/RL Testing/maglev_model.pkl...\n",
|
||||
"Model loaded. Degree: 6\n",
|
||||
"Force R2: 1.0000\n",
|
||||
"Torque R2: 0.9999\n",
|
||||
"======================================================================\n",
|
||||
"EQUILIBRIUM GAP HEIGHT FINDER (Analytical Solution)\n",
|
||||
"======================================================================\n",
|
||||
"Pod mass: 5.8 kg\n",
|
||||
"Total weight: 56.898 N\n",
|
||||
"Target force per yoke: 28.449 N\n",
|
||||
"Pod mass: 9.4 kg\n",
|
||||
"Total weight: 92.214 N\n",
|
||||
"Target force per yoke: 46.107 N\n",
|
||||
"Parameters: currL = 0 A, currR = 0 A, roll = 0°\n",
|
||||
"\n",
|
||||
"using scipy.optimize.fsolve:\n",
|
||||
" Gap: 16.491742 mm → Force: 28.449000 N\n",
|
||||
" Gap: 11.857530 mm → Force: 46.107000 N\n",
|
||||
"\n"
|
||||
]
|
||||
}
|
||||
],
|
||||
"source": [
|
||||
"# The following was generated by AI - see [13]\n",
|
||||
"# Find equilibrium gap height for 5.8 kg pod using polynomial root finding\n",
|
||||
"# Find equilibrium gap height for 9.4 kg pod using polynomial root finding\n",
|
||||
"import numpy as np\n",
|
||||
"from maglev_predictor import MaglevPredictor\n",
|
||||
"from scipy.optimize import fsolve\n",
|
||||
@@ -2228,15 +2232,15 @@
|
||||
"# Initialize predictor\n",
|
||||
"predictor = MaglevPredictor()\n",
|
||||
"\n",
|
||||
"# Target force for 5.8 kg pod (total force = weight)\n",
|
||||
"# Target force for 9.4 kg pod (total force = weight)\n",
|
||||
"# Since we have TWO yokes (front and back), each produces this force\n",
|
||||
"target_force_per_yoke = 5.8 * 9.81 / 2 # 28.449 N per yoke\n",
|
||||
"target_force_per_yoke = 9.4 * 9.81 / 2 # 28.449 N per yoke\n",
|
||||
"\n",
|
||||
"print(\"=\" * 70)\n",
|
||||
"print(\"EQUILIBRIUM GAP HEIGHT FINDER (Analytical Solution)\")\n",
|
||||
"print(\"=\" * 70)\n",
|
||||
"print(f\"Pod mass: 5.8 kg\")\n",
|
||||
"print(f\"Total weight: {5.8 * 9.81:.3f} N\")\n",
|
||||
"print(f\"Pod mass: 9.4 kg\")\n",
|
||||
"print(f\"Total weight: {9.4 * 9.81:.3f} N\")\n",
|
||||
"print(f\"Target force per yoke: {target_force_per_yoke:.3f} N\")\n",
|
||||
"print(f\"Parameters: currL = 0 A, currR = 0 A, roll = 0°\")\n",
|
||||
"print()\n",
|
||||
|
||||
@@ -217,7 +217,7 @@ class MaglevStateSpace:
|
||||
"""
|
||||
|
||||
def __init__(self, linearizer,
|
||||
mass=5.8,
|
||||
mass=9.4,
|
||||
I_roll=0.0192942414, # Ixx from pod.xml [kg·m²]
|
||||
I_pitch=0.130582305, # Iyy from pod.xml [kg·m²]
|
||||
coil_R=1.1, # from MagLevCoil in lev_pod_env.py
|
||||
|
||||
File diff suppressed because one or more lines are too long
@@ -8,7 +8,7 @@ from datetime import datetime
|
||||
from mag_lev_coil import MagLevCoil
|
||||
from maglev_predictor import MaglevPredictor
|
||||
|
||||
TARGET_GAP = 16.491741 / 1000 # target gap height for 5.8 kg pod in meters
|
||||
TARGET_GAP = 11.86 / 1000 # target gap height for 9.4 kg pod in meters
|
||||
|
||||
class LevPodEnv(gym.Env):
|
||||
def __init__(self, use_gui=False, initial_gap_mm=10.0, max_steps=2000, disturbance_force_std=0.0,
|
||||
@@ -385,8 +385,8 @@ class LevPodEnv(gym.Env):
|
||||
obs = self._get_obs()
|
||||
|
||||
# --- 8. Calculate Reward ---
|
||||
# Goal: Hover at target gap (16.5mm), minimize roll/pitch, minimize power
|
||||
target_gap = TARGET_GAP # 16.5mm in meters
|
||||
# Goal: Hover at target gap (11.8mm), minimize roll/pitch, minimize power
|
||||
target_gap = TARGET_GAP # 11.8mm in meters
|
||||
avg_gap = (avg_gap_front + avg_gap_back) / 2
|
||||
|
||||
gap_error = abs(avg_gap - target_gap)
|
||||
@@ -656,7 +656,7 @@ class LevPodEnv(gym.Env):
|
||||
t = {k: np.array(v) for k, v in self._telemetry.items()}
|
||||
time = t['time']
|
||||
target_mm = TARGET_GAP * 1000
|
||||
weight = 5.8 * 9.81 # Pod weight in N
|
||||
weight = 9.4 * 9.81 # Pod weight in N
|
||||
|
||||
fig, axes = plt.subplots(4, 1, figsize=(12, 14), sharex=True)
|
||||
fig.suptitle(f'Simulation Telemetry | gap₀={self.initial_gap_mm}mm target={target_mm:.1f}mm',
|
||||
|
||||
@@ -27,7 +27,7 @@ _SCRIPT_DIR = os.path.dirname(os.path.abspath(__file__))
|
||||
|
||||
# Default optimization config: long enough to see late instability (~8s+), not so long that optimizer goes ultra-conservative
|
||||
DEFAULT_MAX_STEPS = 1500
|
||||
DEFAULT_INITIAL_GAPS_MM = [12.0, 18.0] # Two conditions for robustness
|
||||
DEFAULT_INITIAL_GAPS_MM = [8.0, 15.0] # Two conditions for robustness (bracket 11.86mm target)
|
||||
DEFAULT_N_TRIALS = 200
|
||||
DEFAULT_TIMEOUT_S = 3600
|
||||
TARGET_GAP_MM = TARGET_GAP * 1000
|
||||
|
||||
@@ -1,11 +1,11 @@
|
||||
{
|
||||
"height_kp": 80.05607483893696,
|
||||
"height_ki": 0,
|
||||
"height_kd": 7.09266287860531,
|
||||
"roll_kp": -0.600856607986966,
|
||||
"roll_ki": 0,
|
||||
"height_kp": 100.962395560374814,
|
||||
"height_ki": 0.0,
|
||||
"height_kd": 8.1738092637166575,
|
||||
"roll_kp": 0.600856607986966,
|
||||
"roll_ki": 0.0,
|
||||
"roll_kd": -0.1,
|
||||
"pitch_kp": 50.3415835489009009,
|
||||
"pitch_ki": 0.02319184022898008,
|
||||
"pitch_kd": 0.017632648760979346
|
||||
"pitch_kp": 50.0114708799258271,
|
||||
"pitch_ki": 0,
|
||||
"pitch_kd": 1.8990306608320433
|
||||
}
|
||||
@@ -1,11 +1,11 @@
|
||||
{
|
||||
"height_kp": 112.05607483893696,
|
||||
"height_ki": 1.3231206601751908,
|
||||
"height_kd": 14.09266287860531,
|
||||
"roll_kp": 3.600856607986966,
|
||||
"roll_ki": 0.10314962498074487,
|
||||
"roll_kd": 0.013792861414632316,
|
||||
"pitch_kp": 0.1415835489009009,
|
||||
"pitch_ki": 0.02319184022898008,
|
||||
"pitch_kd": 0.017632648760979346
|
||||
"height_kp": 61.34660453658844,
|
||||
"height_ki": 5.337339965349835,
|
||||
"height_kd": 12.13071554123404,
|
||||
"roll_kp": 5.838881924776812,
|
||||
"roll_ki": 0.11040111644948386,
|
||||
"roll_kd": 0.0401383180893775,
|
||||
"pitch_kp": 0.10114651080341679,
|
||||
"pitch_ki": 0.06948994902747452,
|
||||
"pitch_kd": 0.16948986671689478
|
||||
}
|
||||
@@ -1,11 +1,11 @@
|
||||
{
|
||||
"height_kp": 7.886377342450826,
|
||||
"height_ki": 0.5011631292801424,
|
||||
"height_kd": 6.281854346104332,
|
||||
"roll_kp": 0.5834114273785317,
|
||||
"roll_ki": 4.958217971237515,
|
||||
"roll_kd": 0.020111264395006163,
|
||||
"pitch_kp": 1.7442062254360877,
|
||||
"pitch_ki": 0.03376218829632256,
|
||||
"pitch_kd": 2.7713413800138587
|
||||
"height_kp": 6.79952358593656,
|
||||
"height_ki": 2.7199339229214856,
|
||||
"height_kd": 12.166576111298163,
|
||||
"roll_kp": 1.7073146141313746,
|
||||
"roll_ki": 0.026221209129363342,
|
||||
"roll_kd": 0.018353603438859525,
|
||||
"pitch_kp": 1.2333241666054757,
|
||||
"pitch_ki": 0.03544610305322942,
|
||||
"pitch_kd": 0.3711162924888727
|
||||
}
|
||||
@@ -1,11 +1,11 @@
|
||||
{
|
||||
"height_kp": 6.387288593598476,
|
||||
"height_ki": 3.8692474098125285,
|
||||
"height_kd": 8.326592570264028,
|
||||
"roll_kp": 2.5896160034319817,
|
||||
"roll_ki": 0.26391970508131646,
|
||||
"roll_kd": 0.10133339760273202,
|
||||
"pitch_kp": 0.5612446354489615,
|
||||
"pitch_ki": 0.014113041384510265,
|
||||
"pitch_kd": 1.100684970603034
|
||||
"height_kp": 5.962395560374814,
|
||||
"height_ki": 0.5381137743695537,
|
||||
"height_kd": 1.1738092637166575,
|
||||
"roll_kp": 0.48249575996443006,
|
||||
"roll_ki": 0.016923890033141546,
|
||||
"roll_kd": 0.013609429509460135,
|
||||
"pitch_kp": 0.10114708799258271,
|
||||
"pitch_ki": 1.906050976563914,
|
||||
"pitch_kd": 1.8990306608320433
|
||||
}
|
||||
@@ -14,7 +14,7 @@ _FF_PWM_LUT = None
|
||||
|
||||
|
||||
def build_feedforward_lut(
|
||||
pod_mass: float = 5.8,
|
||||
pod_mass: float = 9.4,
|
||||
coil_r: float = 1.1,
|
||||
v_supply: float = 12.0,
|
||||
gap_min: float = 3.0,
|
||||
|
||||
@@ -2,8 +2,8 @@
|
||||
<robot name="lev_pod">
|
||||
<link name="base_link">
|
||||
<inertial>
|
||||
<mass value="5.8"/>
|
||||
<inertia ixx="0.0192942414" ixy="0.0" ixz="0.0" iyy="0.130582305" iyz="0.0" izz="0.13760599326"/>
|
||||
<mass value="9.4"/>
|
||||
<inertia ixx="0.03162537654" ixy="0.0" ixz="0.0" iyy="0.21929017831" iyz="0.0" izz="0.21430205089"/>
|
||||
</inertial>
|
||||
|
||||
<collision>
|
||||
@@ -13,19 +13,19 @@
|
||||
|
||||
Bolts
|
||||
<collision>
|
||||
<origin rpy="0 0 0" xyz="0.285 0.03 0.09585"/>
|
||||
<origin rpy="0 0 0" xyz="0.285 0.03 0.09085"/>
|
||||
<geometry><box size="0.01 0.01 0.01"/></geometry>
|
||||
</collision>
|
||||
<collision>
|
||||
<origin rpy="0 0 0" xyz="0.285 -0.03 0.09585"/>
|
||||
<origin rpy="0 0 0" xyz="0.285 -0.03 0.09085"/>
|
||||
<geometry><box size="0.01 0.01 0.01"/></geometry>
|
||||
</collision>
|
||||
<collision>
|
||||
<origin rpy="0 0 0" xyz="-0.285 0.03 0.09585"/>
|
||||
<origin rpy="0 0 0" xyz="-0.285 0.03 0.09085"/>
|
||||
<geometry><box size="0.01 0.01 0.01"/></geometry>
|
||||
</collision>
|
||||
<collision>
|
||||
<origin rpy="0 0 0" xyz="-0.285 -0.03 0.09585"/>
|
||||
<origin rpy="0 0 0" xyz="-0.285 -0.03 0.09085"/>
|
||||
<geometry><box size="0.01 0.01 0.01"/></geometry>
|
||||
</collision>
|
||||
|
||||
|
||||
@@ -1,11 +1,11 @@
|
||||
{
|
||||
"height_kp": 6.387288593598476,
|
||||
"height_ki": 3.8692474098125285,
|
||||
"height_kd": 8.326592570264028,
|
||||
"roll_kp": 2.5896160034319817,
|
||||
"roll_ki": 0.26391970508131646,
|
||||
"roll_kd": 0.10133339760273202,
|
||||
"pitch_kp": 0.5612446354489615,
|
||||
"pitch_ki": 0.014113041384510265,
|
||||
"pitch_kd": 1.100684970603034
|
||||
"height_kp": 80.05607483893696,
|
||||
"height_ki": 0,
|
||||
"height_kd": 7.09266287860531,
|
||||
"roll_kp": -0.600856607986966,
|
||||
"roll_ki": 0,
|
||||
"roll_kd": -0.1,
|
||||
"pitch_kp": 50.3415835489009009,
|
||||
"pitch_ki": 0.02319184022898008,
|
||||
"pitch_kd": 0.017632648760979346
|
||||
}
|
||||
@@ -1,32 +1,132 @@
|
||||
#include "Controller.hpp"
|
||||
#include <Arduino.h>
|
||||
#include <math.h>
|
||||
|
||||
// CONTROLLER CONSTANTS
|
||||
float MAX_INTEGRAL_TERM = 1e4;
|
||||
// ── Integral windup limit ────────────────────────────────────
|
||||
static const float MAX_INTEGRAL = 1e4f;
|
||||
|
||||
// ── Feedforward LUT in PROGMEM ───────────────────────────────
|
||||
// Generated by gen_ff_lut.py (pod 9.4 kg, R=1.1Ω, V=12V, 3–20 mm)
|
||||
// Positive = repelling, Negative = attracting
|
||||
static const int16_t FF_PWM_LUT[FF_LUT_SIZE] PROGMEM = {
|
||||
238, 238, 238, 238, 238, 238, 238, 238,
|
||||
238, 238, 238, 238, 238, 238, 238, 238,
|
||||
238, 238, 234, 219, 204, 188, 172, 157,
|
||||
141, 125, 109, 93, 77, 61, 45, 29,
|
||||
13, -3, -19, -35, -51, -67, -84, -100,
|
||||
-116, -133, -150, -166, -183, -200, -217, -234,
|
||||
-250, -250, -250, -250, -250, -250, -250, -250,
|
||||
-250, -250, -250, -250, -250, -250, -250, -250
|
||||
};
|
||||
|
||||
// ── Constructor ──────────────────────────────────────────────
|
||||
FullController::FullController(
|
||||
IndSensor& l, IndSensor& r, IndSensor& f, IndSensor& b,
|
||||
PIDGains hGains, PIDGains rGains, PIDGains pGains,
|
||||
float avgRef, bool useFeedforward)
|
||||
: Left(l), Right(r), Front(f), Back(b),
|
||||
heightGains(hGains), rollGains(rGains), pitchGains(pGains),
|
||||
heightErr({0,0,0}), rollErr({0,0,0}), pitchErr({0,0,0}),
|
||||
AvgRef(avgRef), avg(0), ffEnabled(useFeedforward),
|
||||
oor(false), outputOn(false),
|
||||
FLPWM(0), BLPWM(0), FRPWM(0), BRPWM(0)
|
||||
{}
|
||||
|
||||
// ── Main update (called each control tick) ───────────────────
|
||||
void FullController::update() {
|
||||
// 1. Read all sensors (updates mmVal, oor)
|
||||
Left.readMM();
|
||||
Right.readMM();
|
||||
Front.readMM();
|
||||
Back.readMM(); // read and update dists/oor for all sensors.
|
||||
Back.readMM();
|
||||
|
||||
oor = Left.oor || Right.oor || Front.oor || Back.oor;
|
||||
|
||||
avgControl();
|
||||
LRControl(); // run pwm functions.
|
||||
FBControl();
|
||||
// 2. Compute average gap (mm)
|
||||
avg = (Left.mmVal + Right.mmVal + Front.mmVal + Back.mmVal) * 0.25f;
|
||||
|
||||
FLPWM = constrain(avgPWM + LDiffPWM + FDiffPWM, -CAP, CAP);
|
||||
BLPWM = constrain(avgPWM + LDiffPWM + BDiffPWM, -CAP, CAP);
|
||||
FRPWM = constrain(avgPWM + RDiffPWM + FDiffPWM, -CAP, CAP);
|
||||
BRPWM = constrain(avgPWM + RDiffPWM + BDiffPWM, -CAP, CAP);
|
||||
// 3. Feedforward: base PWM from equilibrium LUT
|
||||
int16_t ffPWM = ffEnabled ? feedforward(avg) : 0;
|
||||
|
||||
// FLPWM = avgPWM;
|
||||
// BLPWM = avgPWM;
|
||||
// FRPWM = avgPWM;
|
||||
// BRPWM = avgPWM;
|
||||
// 4. Height PID: error = reference - average gap
|
||||
float heightE = AvgRef - avg;
|
||||
heightErr.eDiff = heightE - heightErr.e;
|
||||
if (!oor) {
|
||||
heightErr.eInt += heightE;
|
||||
heightErr.eInt = constrain(heightErr.eInt, -MAX_INTEGRAL, MAX_INTEGRAL);
|
||||
}
|
||||
heightErr.e = heightE;
|
||||
int16_t heightPWM = pidCompute(heightGains, heightErr, CAP);
|
||||
|
||||
// 5. Roll PID: angle-based error (matches simulation)
|
||||
// roll_angle = asin((left - right) / y_distance)
|
||||
// error = -roll_angle (drive roll toward zero)
|
||||
float rollRatio = (Left.mmVal - Right.mmVal) / Y_DISTANCE_MM;
|
||||
rollRatio = constrain(rollRatio, -1.0f, 1.0f);
|
||||
float rollAngle = asinf(rollRatio);
|
||||
float rollE = -rollAngle;
|
||||
|
||||
rollErr.eDiff = rollE - rollErr.e;
|
||||
if (!oor) {
|
||||
rollErr.eInt += rollE;
|
||||
rollErr.eInt = constrain(rollErr.eInt, -MAX_INTEGRAL, MAX_INTEGRAL);
|
||||
}
|
||||
rollErr.e = rollE;
|
||||
int16_t rollPWM = pidCompute(rollGains, rollErr, CAP / 2);
|
||||
|
||||
// 6. Pitch PID: angle-based error (matches simulation)
|
||||
// pitch_angle = asin((back - front) / x_distance)
|
||||
// error = -pitch_angle (drive pitch toward zero)
|
||||
float pitchRatio = (Back.mmVal - Front.mmVal) / X_DISTANCE_MM;
|
||||
pitchRatio = constrain(pitchRatio, -1.0f, 1.0f);
|
||||
float pitchAngle = asinf(pitchRatio);
|
||||
float pitchE = -pitchAngle;
|
||||
|
||||
pitchErr.eDiff = pitchE - pitchErr.e;
|
||||
if (!oor) {
|
||||
pitchErr.eInt += pitchE;
|
||||
pitchErr.eInt = constrain(pitchErr.eInt, -MAX_INTEGRAL, MAX_INTEGRAL);
|
||||
}
|
||||
pitchErr.e = pitchE;
|
||||
int16_t pitchPWM = pidCompute(pitchGains, pitchErr, CAP / 2);
|
||||
|
||||
// 7. Mix outputs (same sign convention as simulation)
|
||||
// FL: ff + height - roll - pitch
|
||||
// FR: ff + height + roll - pitch
|
||||
// BL: ff + height - roll + pitch
|
||||
// BR: ff + height + roll + pitch
|
||||
FLPWM = constrain(ffPWM + heightPWM - rollPWM - pitchPWM, -CAP, CAP);
|
||||
FRPWM = constrain(ffPWM + heightPWM + rollPWM - pitchPWM, -CAP, CAP);
|
||||
BLPWM = constrain(ffPWM + heightPWM - rollPWM + pitchPWM, -CAP, CAP);
|
||||
BRPWM = constrain(ffPWM + heightPWM + rollPWM + pitchPWM, -CAP, CAP);
|
||||
}
|
||||
|
||||
// ── PID compute (single symmetric set of gains) ─────────────
|
||||
int16_t FullController::pidCompute(PIDGains& gains, PIDState& state, float maxOutput) {
|
||||
if (oor) return 0;
|
||||
float out = gains.kp * state.e
|
||||
+ gains.ki * state.eInt
|
||||
+ gains.kd * state.eDiff;
|
||||
return (int16_t)constrain(out, -maxOutput, maxOutput);
|
||||
}
|
||||
|
||||
// ── Feedforward: linearly interpolate PROGMEM LUT ────────────
|
||||
int16_t FullController::feedforward(float gapMM) {
|
||||
if (gapMM <= FF_GAP_MIN) return (int16_t)pgm_read_word(&FF_PWM_LUT[0]);
|
||||
if (gapMM >= FF_GAP_MAX) return (int16_t)pgm_read_word(&FF_PWM_LUT[FF_LUT_SIZE - 1]);
|
||||
|
||||
float idx_f = (gapMM - 1.0 - FF_GAP_MIN) / FF_GAP_STEP;
|
||||
uint8_t idx = (uint8_t)idx_f;
|
||||
if (idx >= FF_LUT_SIZE - 1) idx = FF_LUT_SIZE - 2;
|
||||
|
||||
int16_t v0 = (int16_t)pgm_read_word(&FF_PWM_LUT[idx]);
|
||||
int16_t v1 = (int16_t)pgm_read_word(&FF_PWM_LUT[idx + 1]);
|
||||
float frac = idx_f - (float)idx;
|
||||
|
||||
return (int16_t)(v0 + frac * (v1 - v0));
|
||||
}
|
||||
|
||||
// ── Zero all PWMs ────────────────────────────────────────────
|
||||
void FullController::zeroPWMs() {
|
||||
FLPWM = 0;
|
||||
BLPWM = 0;
|
||||
@@ -34,131 +134,48 @@ void FullController::zeroPWMs() {
|
||||
BRPWM = 0;
|
||||
}
|
||||
|
||||
// ── Send PWM values to hardware ──────────────────────────────
|
||||
void FullController::sendOutputs() {
|
||||
if (!outputOn) {
|
||||
zeroPWMs();
|
||||
}
|
||||
|
||||
// The following assumes 0 direction drives repulsion and 1 direction drives
|
||||
// attraction. Using direct register writes to maintain fast PWM mode set by
|
||||
// setupFastPWM()
|
||||
// Direction: LOW = repelling (positive PWM), HIGH = attracting (negative PWM)
|
||||
// Using direct register writes for fast PWM mode set by setupFastPWM()
|
||||
digitalWrite(dirFL, FLPWM < 0);
|
||||
OCR2A = abs(FLPWM); // Pin 11 -> Timer 2A
|
||||
OCR2A = abs(FLPWM); // Pin 11 → Timer 2A
|
||||
digitalWrite(dirBL, BLPWM < 0);
|
||||
OCR1A = abs(BLPWM); // Pin 9 -> Timer 1A
|
||||
OCR1A = abs(BLPWM); // Pin 9 → Timer 1A
|
||||
digitalWrite(dirFR, FRPWM < 0);
|
||||
OCR2B = abs(FRPWM); // Pin 3 -> Timer 2B
|
||||
OCR2B = abs(FRPWM); // Pin 3 → Timer 2B
|
||||
digitalWrite(dirBR, BRPWM < 0);
|
||||
OCR1B = abs(BRPWM); // Pin 10 -> Timer 1B
|
||||
}
|
||||
|
||||
void FullController::avgControl() {
|
||||
avg = (Left.mmVal + Right.mmVal + Front.mmVal + Back.mmVal) * 0.25f;
|
||||
float eCurr = AvgRef - avg;
|
||||
|
||||
avgError.eDiff = eCurr - avgError.e;
|
||||
if (!oor) {
|
||||
avgError.eInt += eCurr;
|
||||
avgError.eInt =
|
||||
constrain(avgError.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM);
|
||||
}
|
||||
avgError.e = eCurr;
|
||||
|
||||
avgPWM = pwmFunc(avgConsts, avgError);
|
||||
}
|
||||
|
||||
void FullController::LRControl() {
|
||||
float diff = Right.mmVal - Left.mmVal; // how far above the right is the left?
|
||||
float eCurr = diff - LRDiffRef; // how different is that from the reference?
|
||||
// positive -> Left repels, Right attracts.
|
||||
K_MAP rConsts = {
|
||||
LConsts.attracting,
|
||||
LConsts.repelling}; // apply attracting to repelling and vice versa.
|
||||
|
||||
LRDiffErr.eDiff = eCurr - LRDiffErr.e;
|
||||
|
||||
if (!oor) {
|
||||
LRDiffErr.eInt += eCurr;
|
||||
LRDiffErr.eInt =
|
||||
constrain(LRDiffErr.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM);
|
||||
}
|
||||
|
||||
LRDiffErr.e = eCurr;
|
||||
|
||||
LDiffPWM = pwmFunc(LConsts, LRDiffErr);
|
||||
RDiffPWM = -pwmFunc(rConsts, LRDiffErr);
|
||||
}
|
||||
|
||||
void FullController::FBControl() {
|
||||
float diff = Back.mmVal - Front.mmVal; // how far above the back is the front?
|
||||
float eCurr = diff - FBDiffRef; // how different is that from ref? pos.->Front
|
||||
// must repel, Back must attract
|
||||
K_MAP bConsts = {FConsts.attracting, FConsts.repelling};
|
||||
|
||||
FBDiffErr.eDiff = eCurr - FBDiffErr.e;
|
||||
|
||||
if (!oor) {
|
||||
FBDiffErr.eInt += eCurr;
|
||||
FBDiffErr.eInt =
|
||||
constrain(FBDiffErr.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM);
|
||||
}
|
||||
|
||||
FBDiffErr.e = eCurr;
|
||||
|
||||
FDiffPWM = pwmFunc(FConsts, FBDiffErr);
|
||||
BDiffPWM = -pwmFunc(bConsts, FBDiffErr);
|
||||
}
|
||||
|
||||
int16_t FullController::pwmFunc(K_MAP consts, Errors errs) {
|
||||
if (oor)
|
||||
return 0;
|
||||
Constants constants = (errs.e < 0) ? consts.attracting : consts.repelling;
|
||||
return (int)(constants.kp * errs.e + constants.ki * errs.eInt +
|
||||
constants.kd * errs.eDiff);
|
||||
OCR1B = abs(BRPWM); // Pin 10 → Timer 1B
|
||||
}
|
||||
|
||||
// ── Serial report ────────────────────────────────────────────
|
||||
void FullController::report() {
|
||||
// CSV Format: Left,Right,Front,Back,Avg,FLPWM,BLPWM,FRPWM,BRPWM,ControlOn
|
||||
Serial.print(Left.mmVal);
|
||||
Serial.print(",");
|
||||
Serial.print(Right.mmVal);
|
||||
Serial.print(",");
|
||||
Serial.print(Front.mmVal);
|
||||
Serial.print(",");
|
||||
Serial.print(Back.mmVal);
|
||||
Serial.print(",");
|
||||
Serial.print(avg);
|
||||
Serial.print(",");
|
||||
|
||||
Serial.print(FLPWM);
|
||||
Serial.print(",");
|
||||
Serial.print(BLPWM);
|
||||
Serial.print(",");
|
||||
Serial.print(FRPWM);
|
||||
Serial.print(",");
|
||||
Serial.print(BRPWM);
|
||||
Serial.print(",");
|
||||
|
||||
// CSV: Left,Right,Front,Back,Avg,FLPWM,BLPWM,FRPWM,BRPWM,ControlOn
|
||||
Serial.print(Left.mmVal); Serial.print(',');
|
||||
Serial.print(Right.mmVal); Serial.print(',');
|
||||
Serial.print(Front.mmVal); Serial.print(',');
|
||||
Serial.print(Back.mmVal); Serial.print(',');
|
||||
Serial.print(avg); Serial.print(',');
|
||||
Serial.print(FLPWM); Serial.print(',');
|
||||
Serial.print(BLPWM); Serial.print(',');
|
||||
Serial.print(FRPWM); Serial.print(',');
|
||||
Serial.print(BRPWM); Serial.print(',');
|
||||
Serial.println(outputOn);
|
||||
}
|
||||
|
||||
void FullController::updateAvgPID(Constants repel, Constants attract) {
|
||||
avgConsts.repelling = repel;
|
||||
avgConsts.attracting = attract;
|
||||
}
|
||||
// ── Runtime tuning methods ───────────────────────────────────
|
||||
void FullController::updateHeightPID(PIDGains gains) { heightGains = gains; }
|
||||
void FullController::updateRollPID(PIDGains gains) { rollGains = gains; }
|
||||
void FullController::updatePitchPID(PIDGains gains) { pitchGains = gains; }
|
||||
|
||||
void FullController::updateLRPID(Constants down, Constants up) {
|
||||
LConsts.repelling = down;
|
||||
LConsts.attracting = up;
|
||||
}
|
||||
|
||||
void FullController::updateFBPID(Constants down, Constants up) {
|
||||
FConsts.repelling = down;
|
||||
FConsts.attracting = up;
|
||||
}
|
||||
|
||||
void FullController::updateReferences(float avgReference, float lrDiffReference, float fbDiffReference) {
|
||||
void FullController::updateReference(float avgReference) {
|
||||
AvgRef = avgReference;
|
||||
LRDiffRef = lrDiffReference;
|
||||
FBDiffRef = fbDiffReference;
|
||||
}
|
||||
|
||||
void FullController::setFeedforward(bool enabled) {
|
||||
ffEnabled = enabled;
|
||||
}
|
||||
@@ -2,103 +2,98 @@
|
||||
#define CONTROLLER_HPP
|
||||
|
||||
#include <stdint.h>
|
||||
#include <avr/pgmspace.h>
|
||||
#include "IndSensorMap.hpp"
|
||||
|
||||
// PIN MAPPING
|
||||
#define dirFR 2
|
||||
#define pwmFR 3
|
||||
// ── Pin Mapping ──────────────────────────────────────────────
|
||||
#define dirBL 2
|
||||
#define pwmBL 3
|
||||
#define dirBR 4
|
||||
#define pwmBR 10
|
||||
#define pwmFL 11
|
||||
#define dirFL 7
|
||||
#define dirBL 8
|
||||
#define pwmBL 9
|
||||
#define dirFR 8
|
||||
#define pwmFR 9
|
||||
|
||||
#define CAP 250
|
||||
// ── Output Cap ───────────────────────────────────────────────
|
||||
#define CAP 250 // Max PWM magnitude (0-255 Arduino range)
|
||||
|
||||
typedef struct Constants {
|
||||
// ── PID Gains (single set per loop — matches simulation) ────
|
||||
typedef struct PIDGains {
|
||||
float kp;
|
||||
float ki;
|
||||
float kd;
|
||||
} Constants;
|
||||
} PIDGains;
|
||||
|
||||
typedef struct K_MAP {
|
||||
Constants repelling;
|
||||
Constants attracting;
|
||||
} K_MAP;
|
||||
// ── PID Error State ──────────────────────────────────────────
|
||||
typedef struct PIDState {
|
||||
float e; // Current error
|
||||
float eDiff; // Derivative of error (e[k] - e[k-1])
|
||||
float eInt; // Integral of error (accumulated)
|
||||
} PIDState;
|
||||
|
||||
typedef struct FullConsts {
|
||||
K_MAP avg;
|
||||
K_MAP lColl; // repelling is applied to attracting and vice versa for the Right and Back collectives.
|
||||
K_MAP fColl;
|
||||
} FullConsts;
|
||||
// ── Feedforward LUT (PROGMEM) ────────────────────────────────
|
||||
// Generated by gen_ff_lut.py from MaglevPredictor model
|
||||
// Pod mass: 9.4 kg, Coil R: 1.1Ω, V_supply: 12V
|
||||
// Positive = repelling, Negative = attracting
|
||||
// Beyond ~16mm: clamped to -CAP (no equilibrium exists)
|
||||
#define FF_LUT_SIZE 64
|
||||
#define FF_GAP_MIN 3.0f
|
||||
#define FF_GAP_MAX 20.0f
|
||||
#define FF_GAP_STEP 0.269841f
|
||||
|
||||
typedef struct Errors {
|
||||
float e;
|
||||
float eDiff;
|
||||
float eInt;
|
||||
} Errors;
|
||||
// ── Geometry (mm, matching simulation) ───────────────────────
|
||||
// Sensor-to-sensor distances for angle computation
|
||||
#define Y_DISTANCE_MM 101.6f // Left↔Right sensor spacing (mm)
|
||||
#define X_DISTANCE_MM 251.8f // Front↔Back sensor spacing (mm)
|
||||
|
||||
// ── Controller Class ─────────────────────────────────────────
|
||||
class FullController {
|
||||
public:
|
||||
bool oor;
|
||||
bool outputOn;
|
||||
public:
|
||||
bool oor; // Any sensor out-of-range
|
||||
bool outputOn; // Enable/disable output
|
||||
|
||||
FullController(IndSensor& l, IndSensor& r, IndSensor& f, IndSensor& b,
|
||||
FullConsts fullConsts, float avgRef, float lrDiffRef, float fbDiffRef)
|
||||
: Left(l), Right(r), Front(f), Back(b), AvgRef(avgRef), LRDiffRef(lrDiffRef),
|
||||
FBDiffRef(fbDiffRef), avgConsts(fullConsts.avg), LConsts(fullConsts.lColl),
|
||||
FConsts(fullConsts.fColl), avgError({0,0,0}), LRDiffErr({0,0,0}),
|
||||
FBDiffErr({0,0,0}), oor(false), outputOn(false) {}
|
||||
FullController(IndSensor& l, IndSensor& r, IndSensor& f, IndSensor& b,
|
||||
PIDGains heightGains, PIDGains rollGains, PIDGains pitchGains,
|
||||
float avgRef, bool useFeedforward);
|
||||
|
||||
void update();
|
||||
void zeroPWMs();
|
||||
void sendOutputs();
|
||||
void report();
|
||||
|
||||
// PID tuning methods
|
||||
void updateAvgPID(Constants repel, Constants attract);
|
||||
void updateLRPID(Constants down, Constants up);
|
||||
void updateFBPID(Constants down, Constants up);
|
||||
|
||||
// Reference update methods
|
||||
void updateReferences(float avgReference, float lrDiffReference, float fbDiffReference);
|
||||
void update();
|
||||
void zeroPWMs();
|
||||
void sendOutputs();
|
||||
void report();
|
||||
|
||||
private:
|
||||
void avgControl();
|
||||
void LRControl();
|
||||
void FBControl();
|
||||
int16_t pwmFunc(K_MAP consts, Errors errs);
|
||||
// Runtime tuning
|
||||
void updateHeightPID(PIDGains gains);
|
||||
void updateRollPID(PIDGains gains);
|
||||
void updatePitchPID(PIDGains gains);
|
||||
void updateReference(float avgReference);
|
||||
void setFeedforward(bool enabled);
|
||||
|
||||
IndSensor& Front;
|
||||
IndSensor& Back;
|
||||
IndSensor& Right;
|
||||
IndSensor& Left;
|
||||
private:
|
||||
int16_t pidCompute(PIDGains& gains, PIDState& state, float maxOutput);
|
||||
int16_t feedforward(float gapMM);
|
||||
|
||||
K_MAP avgConsts;
|
||||
K_MAP LConsts;
|
||||
K_MAP FConsts;
|
||||
IndSensor& Left;
|
||||
IndSensor& Right;
|
||||
IndSensor& Front;
|
||||
IndSensor& Back;
|
||||
|
||||
Errors avgError;
|
||||
Errors LRDiffErr;
|
||||
Errors FBDiffErr;
|
||||
PIDGains heightGains;
|
||||
PIDGains rollGains;
|
||||
PIDGains pitchGains;
|
||||
|
||||
float AvgRef;
|
||||
float LRDiffRef;
|
||||
float FBDiffRef;
|
||||
float avg;
|
||||
PIDState heightErr;
|
||||
PIDState rollErr;
|
||||
PIDState pitchErr;
|
||||
|
||||
int16_t avgPWM;
|
||||
int16_t LDiffPWM;
|
||||
int16_t RDiffPWM;
|
||||
int16_t FDiffPWM;
|
||||
int16_t BDiffPWM;
|
||||
// Initially, I was going to make the Right and Back just the negatives,
|
||||
// but having separate control functions running for each of these outputs might prove useful.
|
||||
float AvgRef; // Target gap height (mm)
|
||||
float avg; // Current average gap (mm)
|
||||
bool ffEnabled; // Feedforward on/off
|
||||
|
||||
int16_t FLPWM;
|
||||
int16_t BLPWM;
|
||||
int16_t FRPWM;
|
||||
int16_t BRPWM;
|
||||
int16_t FLPWM;
|
||||
int16_t BLPWM;
|
||||
int16_t FRPWM;
|
||||
int16_t BRPWM;
|
||||
};
|
||||
|
||||
#endif // CONTROLLER_HPP
|
||||
@@ -58,7 +58,7 @@ float IndSensor::readMM() {
|
||||
}
|
||||
|
||||
// Predefined sensor instances
|
||||
IndSensor indL(ind1Map, A0);
|
||||
IndSensor indR(ind0Map, A1);
|
||||
IndSensor indF(ind3Map, A5);
|
||||
IndSensor indB(ind2Map, A4);
|
||||
IndSensor indF(ind1Map, A0);
|
||||
IndSensor indB(ind0Map, A1);
|
||||
IndSensor indR(ind3Map, A5);
|
||||
IndSensor indL(ind2Map, A4);
|
||||
Reference in New Issue
Block a user