Loaded new mass and inertial characteristics into sim, ported sim arch into arduino code

This commit is contained in:
2026-02-26 12:45:27 -06:00
parent 725f227943
commit 010d997eef
16 changed files with 450 additions and 473 deletions

View File

@@ -4,43 +4,40 @@
#include "ADC.hpp" #include "ADC.hpp"
#include "FastPWM.hpp" #include "FastPWM.hpp"
// K, Ki, Kd Constants // ── PID Gains (Kp, Ki, Kd) ──────────────────────────────────
Constants repelling = {250, 0, 1000}; // Height loop: controls average gap → additive PWM on all coils
Constants attracting = {250, 0, 1000}; PIDGains heightGains = { 100.0f, 0.0f, 8.0f };
Constants RollLeftUp = {0, 0, 100}; // Roll loop: corrects left/right tilt → differential L/R
Constants RollLeftDown = {0, 0, 100}; PIDGains rollGains = { 0.6f, 0.0f, -0.1f };
Constants RollFrontUp = {0, 0, 500}; // Pitch loop: corrects front/back tilt → differential F/B
Constants RollFrontDown = {0, 0, 500}; PIDGains pitchGains = { 50.0f, 0.0f, 1.9f };
// Reference values for average dist, // ── Reference ────────────────────────────────────────────────
float avgRef = 11.0; // TBD: what is our equilibrium height with this testrig? float avgRef = 12.36f; // Target gap height (mm) — 9.4 kg equilibrium
float LRDiffRef = -2.0; // TBD: what is our left-right balance equilibrium? Positive -> left is above right
float FBDiffRef = 0.0; // TBD: what is front-back balance equilibrium? Positive -> front above back.
// Might be useful for things like jitter or lag. // ── Feedforward ──────────────────────────────────────────────
#define sampling_rate 1000 // Hz bool useFeedforward = true; // Set false to disable feedforward LUT
// EMA filter alpha value (all sensors use same alpha) // ── Sampling ─────────────────────────────────────────────────
#define alphaVal 0.3f #define SAMPLING_RATE 200 // Hz (controller tick rate)
// ── EMA filter alpha (all sensors) ───────────────────────────
#define ALPHA_VAL 1.0f
// ═══════════════════════════════════════════════════════════════
// ABOVE THIS LINE IS TUNING VALUES ONLY, BELOW IS ACTUAL CODE. // ABOVE THIS LINE IS TUNING VALUES ONLY, BELOW IS ACTUAL CODE.
// ═══════════════════════════════════════════════════════════════
unsigned long tprior; unsigned long tprior;
unsigned int tDiffMicros; unsigned int tDiffMicros;
FullConsts fullConsts = { FullController controller(indL, indR, indF, indB,
{repelling, attracting}, heightGains, rollGains, pitchGains,
{RollLeftDown, RollLeftUp}, avgRef, useFeedforward);
{RollFrontDown, RollFrontUp}
};
FullController controller(indL, indR, indF, indB, fullConsts, avgRef, LRDiffRef, FBDiffRef); const int dt_micros = 1000000 / SAMPLING_RATE;
const int dt_micros = 1e6/sampling_rate;
#define LEV_ON
int ON = 0; int ON = 0;
@@ -49,10 +46,10 @@ void setup() {
setupADC(); setupADC();
setupFastPWM(); setupFastPWM();
indL.alpha = alphaVal; indL.alpha = ALPHA_VAL;
indR.alpha = alphaVal; indR.alpha = ALPHA_VAL;
indF.alpha = alphaVal; indF.alpha = ALPHA_VAL;
indB.alpha = alphaVal; indB.alpha = ALPHA_VAL;
tprior = micros(); tprior = micros();
@@ -71,106 +68,72 @@ void loop() {
String cmd = Serial.readStringUntil('\n'); String cmd = Serial.readStringUntil('\n');
cmd.trim(); cmd.trim();
// Check if it's a reference update command (format: REF,avgRef,lrDiffRef,fbDiffRef) // REF,avgRef — update target gap height
if (cmd.startsWith("REF,")) { if (cmd.startsWith("REF,")) {
int firstComma = cmd.indexOf(','); float newRef = cmd.substring(4).toFloat();
int secondComma = cmd.indexOf(',', firstComma + 1); avgRef = newRef;
int thirdComma = cmd.indexOf(',', secondComma + 1); controller.updateReference(avgRef);
Serial.print("Updated Ref: ");
if (firstComma > 0 && secondComma > 0 && thirdComma > 0) { Serial.println(avgRef);
float newAvgRef = cmd.substring(firstComma + 1, secondComma).toFloat();
float newLRDiffRef = cmd.substring(secondComma + 1, thirdComma).toFloat();
float newFBDiffRef = cmd.substring(thirdComma + 1).toFloat();
avgRef = newAvgRef;
LRDiffRef = newLRDiffRef;
FBDiffRef = newFBDiffRef;
controller.updateReferences(avgRef, LRDiffRef, FBDiffRef);
Serial.print("Updated References: Avg=");
Serial.print(avgRef);
Serial.print(", LR=");
Serial.print(LRDiffRef);
Serial.print(", FB=");
Serial.println(FBDiffRef);
}
} }
// Check if it's a PID tuning command (format: PID,mode,kp,ki,kd) // PID,loop,kp,ki,kd — update gains (loop: 0=height, 1=roll, 2=pitch)
else if (cmd.startsWith("PID,")) { else if (cmd.startsWith("PID,")) {
int firstComma = cmd.indexOf(','); int c1 = cmd.indexOf(',');
int secondComma = cmd.indexOf(',', firstComma + 1); int c2 = cmd.indexOf(',', c1 + 1);
int thirdComma = cmd.indexOf(',', secondComma + 1); int c3 = cmd.indexOf(',', c2 + 1);
int fourthComma = cmd.indexOf(',', thirdComma + 1); int c4 = cmd.indexOf(',', c3 + 1);
if (firstComma > 0 && secondComma > 0 && thirdComma > 0 && fourthComma > 0) { if (c1 > 0 && c2 > 0 && c3 > 0 && c4 > 0) {
int mode = cmd.substring(firstComma + 1, secondComma).toInt(); int loop = cmd.substring(c1 + 1, c2).toInt();
float kp = cmd.substring(secondComma + 1, thirdComma).toFloat(); float kp = cmd.substring(c2 + 1, c3).toFloat();
float ki = cmd.substring(thirdComma + 1, fourthComma).toFloat(); float ki = cmd.substring(c3 + 1, c4).toFloat();
float kd = cmd.substring(fourthComma + 1).toFloat(); float kd = cmd.substring(c4 + 1).toFloat();
Constants newConst = {kp, ki, kd}; PIDGains g = { kp, ki, kd };
// Mode mapping: switch (loop) {
// 0: Repelling case 0:
// 1: Attracting heightGains = g;
// 2: RollLeftDown controller.updateHeightPID(g);
// 3: RollLeftUp Serial.println("Updated Height PID");
// 4: RollFrontDown
// 5: RollFrontUp
switch(mode) {
case 0: // Repelling
repelling = newConst;
controller.updateAvgPID(repelling, attracting);
Serial.println("Updated Repelling PID");
break; break;
case 1: // Attracting case 1:
attracting = newConst; rollGains = g;
controller.updateAvgPID(repelling, attracting); controller.updateRollPID(g);
Serial.println("Updated Attracting PID"); Serial.println("Updated Roll PID");
break; break;
case 2: // RollLeftDown case 2:
RollLeftDown = newConst; pitchGains = g;
controller.updateLRPID(RollLeftDown, RollLeftUp); controller.updatePitchPID(g);
Serial.println("Updated RollLeftDown PID"); Serial.println("Updated Pitch PID");
break;
case 3: // RollLeftUp
RollLeftUp = newConst;
controller.updateLRPID(RollLeftDown, RollLeftUp);
Serial.println("Updated RollLeftUp PID");
break;
case 4: // RollFrontDown
RollFrontDown = newConst;
controller.updateFBPID(RollFrontDown, RollFrontUp);
Serial.println("Updated RollFrontDown PID");
break;
case 5: // RollFrontUp
RollFrontUp = newConst;
controller.updateFBPID(RollFrontDown, RollFrontUp);
Serial.println("Updated RollFrontUp PID");
break; break;
default: default:
Serial.println("Invalid mode"); Serial.println("Invalid loop (0=height, 1=roll, 2=pitch)");
break; break;
} }
} }
} else { }
// Original control on/off command // FF,0 or FF,1 — toggle feedforward
else if (cmd.startsWith("FF,")) {
bool en = (cmd.charAt(3) != '0');
useFeedforward = en;
controller.setFeedforward(en);
Serial.print("Feedforward: ");
Serial.println(en ? "ON" : "OFF");
}
else {
// Original on/off command (any char except '0' turns on)
controller.outputOn = (cmd.charAt(0) != '0'); controller.outputOn = (cmd.charAt(0) != '0');
} }
} }
tDiffMicros = micros() - tprior; tDiffMicros = micros() - tprior;
if (tDiffMicros >= dt_micros){ if (tDiffMicros >= dt_micros) {
controller.update(); controller.update();
controller.report(); controller.report();
controller.sendOutputs(); controller.sendOutputs();
// this and the previous line can be switched if you want the PWMs to display 0 when controller off.
tprior = micros(); // maybe we have to move this line to before the update commands? tprior = micros();
// since the floating point arithmetic may take a while...
} }
//Serial.println(telapsed);
} }

View File

@@ -2189,14 +2189,14 @@
"id": "21babeb3", "id": "21babeb3",
"metadata": {}, "metadata": {},
"source": [ "source": [
"### Now, let's find the equilibrium height for our pod, given mass of 5.8 kg. \n", "### Now, let's find the equilibrium height for our pod, given mass of 9.4 kg. \n",
"\n", "\n",
"5.8 kg * 9.81 $m/s^2$ = 56.898 N" "9.4 kg * 9.81 $m/s^2$ = 56.898 N"
] ]
}, },
{ {
"cell_type": "code", "cell_type": "code",
"execution_count": 50, "execution_count": 1,
"id": "badbc379", "id": "badbc379",
"metadata": {}, "metadata": {},
"outputs": [ "outputs": [
@@ -2204,23 +2204,27 @@
"name": "stdout", "name": "stdout",
"output_type": "stream", "output_type": "stream",
"text": [ "text": [
"Loading maglev model from /Users/adipu/Documents/guadaloop_lev_control/RL Testing/maglev_model.pkl...\n",
"Model loaded. Degree: 6\n",
"Force R2: 1.0000\n",
"Torque R2: 0.9999\n",
"======================================================================\n", "======================================================================\n",
"EQUILIBRIUM GAP HEIGHT FINDER (Analytical Solution)\n", "EQUILIBRIUM GAP HEIGHT FINDER (Analytical Solution)\n",
"======================================================================\n", "======================================================================\n",
"Pod mass: 5.8 kg\n", "Pod mass: 9.4 kg\n",
"Total weight: 56.898 N\n", "Total weight: 92.214 N\n",
"Target force per yoke: 28.449 N\n", "Target force per yoke: 46.107 N\n",
"Parameters: currL = 0 A, currR = 0 A, roll = 0°\n", "Parameters: currL = 0 A, currR = 0 A, roll = 0°\n",
"\n", "\n",
"using scipy.optimize.fsolve:\n", "using scipy.optimize.fsolve:\n",
" Gap: 16.491742 mm → Force: 28.449000 N\n", " Gap: 11.857530 mm → Force: 46.107000 N\n",
"\n" "\n"
] ]
} }
], ],
"source": [ "source": [
"# The following was generated by AI - see [13]\n", "# The following was generated by AI - see [13]\n",
"# Find equilibrium gap height for 5.8 kg pod using polynomial root finding\n", "# Find equilibrium gap height for 9.4 kg pod using polynomial root finding\n",
"import numpy as np\n", "import numpy as np\n",
"from maglev_predictor import MaglevPredictor\n", "from maglev_predictor import MaglevPredictor\n",
"from scipy.optimize import fsolve\n", "from scipy.optimize import fsolve\n",
@@ -2228,15 +2232,15 @@
"# Initialize predictor\n", "# Initialize predictor\n",
"predictor = MaglevPredictor()\n", "predictor = MaglevPredictor()\n",
"\n", "\n",
"# Target force for 5.8 kg pod (total force = weight)\n", "# Target force for 9.4 kg pod (total force = weight)\n",
"# Since we have TWO yokes (front and back), each produces this force\n", "# Since we have TWO yokes (front and back), each produces this force\n",
"target_force_per_yoke = 5.8 * 9.81 / 2 # 28.449 N per yoke\n", "target_force_per_yoke = 9.4 * 9.81 / 2 # 28.449 N per yoke\n",
"\n", "\n",
"print(\"=\" * 70)\n", "print(\"=\" * 70)\n",
"print(\"EQUILIBRIUM GAP HEIGHT FINDER (Analytical Solution)\")\n", "print(\"EQUILIBRIUM GAP HEIGHT FINDER (Analytical Solution)\")\n",
"print(\"=\" * 70)\n", "print(\"=\" * 70)\n",
"print(f\"Pod mass: 5.8 kg\")\n", "print(f\"Pod mass: 9.4 kg\")\n",
"print(f\"Total weight: {5.8 * 9.81:.3f} N\")\n", "print(f\"Total weight: {9.4 * 9.81:.3f} N\")\n",
"print(f\"Target force per yoke: {target_force_per_yoke:.3f} N\")\n", "print(f\"Target force per yoke: {target_force_per_yoke:.3f} N\")\n",
"print(f\"Parameters: currL = 0 A, currR = 0 A, roll = 0°\")\n", "print(f\"Parameters: currL = 0 A, currR = 0 A, roll = 0°\")\n",
"print()\n", "print()\n",

View File

@@ -217,7 +217,7 @@ class MaglevStateSpace:
""" """
def __init__(self, linearizer, def __init__(self, linearizer,
mass=5.8, mass=9.4,
I_roll=0.0192942414, # Ixx from pod.xml [kg·m²] I_roll=0.0192942414, # Ixx from pod.xml [kg·m²]
I_pitch=0.130582305, # Iyy from pod.xml [kg·m²] I_pitch=0.130582305, # Iyy from pod.xml [kg·m²]
coil_R=1.1, # from MagLevCoil in lev_pod_env.py coil_R=1.1, # from MagLevCoil in lev_pod_env.py

File diff suppressed because one or more lines are too long

View File

@@ -8,7 +8,7 @@ from datetime import datetime
from mag_lev_coil import MagLevCoil from mag_lev_coil import MagLevCoil
from maglev_predictor import MaglevPredictor from maglev_predictor import MaglevPredictor
TARGET_GAP = 16.491741 / 1000 # target gap height for 5.8 kg pod in meters TARGET_GAP = 11.86 / 1000 # target gap height for 9.4 kg pod in meters
class LevPodEnv(gym.Env): class LevPodEnv(gym.Env):
def __init__(self, use_gui=False, initial_gap_mm=10.0, max_steps=2000, disturbance_force_std=0.0, def __init__(self, use_gui=False, initial_gap_mm=10.0, max_steps=2000, disturbance_force_std=0.0,
@@ -385,8 +385,8 @@ class LevPodEnv(gym.Env):
obs = self._get_obs() obs = self._get_obs()
# --- 8. Calculate Reward --- # --- 8. Calculate Reward ---
# Goal: Hover at target gap (16.5mm), minimize roll/pitch, minimize power # Goal: Hover at target gap (11.8mm), minimize roll/pitch, minimize power
target_gap = TARGET_GAP # 16.5mm in meters target_gap = TARGET_GAP # 11.8mm in meters
avg_gap = (avg_gap_front + avg_gap_back) / 2 avg_gap = (avg_gap_front + avg_gap_back) / 2
gap_error = abs(avg_gap - target_gap) gap_error = abs(avg_gap - target_gap)
@@ -656,7 +656,7 @@ class LevPodEnv(gym.Env):
t = {k: np.array(v) for k, v in self._telemetry.items()} t = {k: np.array(v) for k, v in self._telemetry.items()}
time = t['time'] time = t['time']
target_mm = TARGET_GAP * 1000 target_mm = TARGET_GAP * 1000
weight = 5.8 * 9.81 # Pod weight in N weight = 9.4 * 9.81 # Pod weight in N
fig, axes = plt.subplots(4, 1, figsize=(12, 14), sharex=True) fig, axes = plt.subplots(4, 1, figsize=(12, 14), sharex=True)
fig.suptitle(f'Simulation Telemetry | gap₀={self.initial_gap_mm}mm target={target_mm:.1f}mm', fig.suptitle(f'Simulation Telemetry | gap₀={self.initial_gap_mm}mm target={target_mm:.1f}mm',

View File

@@ -27,7 +27,7 @@ _SCRIPT_DIR = os.path.dirname(os.path.abspath(__file__))
# Default optimization config: long enough to see late instability (~8s+), not so long that optimizer goes ultra-conservative # Default optimization config: long enough to see late instability (~8s+), not so long that optimizer goes ultra-conservative
DEFAULT_MAX_STEPS = 1500 DEFAULT_MAX_STEPS = 1500
DEFAULT_INITIAL_GAPS_MM = [12.0, 18.0] # Two conditions for robustness DEFAULT_INITIAL_GAPS_MM = [8.0, 15.0] # Two conditions for robustness (bracket 11.86mm target)
DEFAULT_N_TRIALS = 200 DEFAULT_N_TRIALS = 200
DEFAULT_TIMEOUT_S = 3600 DEFAULT_TIMEOUT_S = 3600
TARGET_GAP_MM = TARGET_GAP * 1000 TARGET_GAP_MM = TARGET_GAP * 1000

View File

@@ -1,11 +1,11 @@
{ {
"height_kp": 80.05607483893696, "height_kp": 100.962395560374814,
"height_ki": 0, "height_ki": 0.0,
"height_kd": 7.09266287860531, "height_kd": 8.1738092637166575,
"roll_kp": -0.600856607986966, "roll_kp": 0.600856607986966,
"roll_ki": 0, "roll_ki": 0.0,
"roll_kd": -0.1, "roll_kd": -0.1,
"pitch_kp": 50.3415835489009009, "pitch_kp": 50.0114708799258271,
"pitch_ki": 0.02319184022898008, "pitch_ki": 0,
"pitch_kd": 0.017632648760979346 "pitch_kd": 1.8990306608320433
} }

View File

@@ -1,11 +1,11 @@
{ {
"height_kp": 112.05607483893696, "height_kp": 61.34660453658844,
"height_ki": 1.3231206601751908, "height_ki": 5.337339965349835,
"height_kd": 14.09266287860531, "height_kd": 12.13071554123404,
"roll_kp": 3.600856607986966, "roll_kp": 5.838881924776812,
"roll_ki": 0.10314962498074487, "roll_ki": 0.11040111644948386,
"roll_kd": 0.013792861414632316, "roll_kd": 0.0401383180893775,
"pitch_kp": 0.1415835489009009, "pitch_kp": 0.10114651080341679,
"pitch_ki": 0.02319184022898008, "pitch_ki": 0.06948994902747452,
"pitch_kd": 0.017632648760979346 "pitch_kd": 0.16948986671689478
} }

View File

@@ -1,11 +1,11 @@
{ {
"height_kp": 7.886377342450826, "height_kp": 6.79952358593656,
"height_ki": 0.5011631292801424, "height_ki": 2.7199339229214856,
"height_kd": 6.281854346104332, "height_kd": 12.166576111298163,
"roll_kp": 0.5834114273785317, "roll_kp": 1.7073146141313746,
"roll_ki": 4.958217971237515, "roll_ki": 0.026221209129363342,
"roll_kd": 0.020111264395006163, "roll_kd": 0.018353603438859525,
"pitch_kp": 1.7442062254360877, "pitch_kp": 1.2333241666054757,
"pitch_ki": 0.03376218829632256, "pitch_ki": 0.03544610305322942,
"pitch_kd": 2.7713413800138587 "pitch_kd": 0.3711162924888727
} }

View File

@@ -1,11 +1,11 @@
{ {
"height_kp": 6.387288593598476, "height_kp": 5.962395560374814,
"height_ki": 3.8692474098125285, "height_ki": 0.5381137743695537,
"height_kd": 8.326592570264028, "height_kd": 1.1738092637166575,
"roll_kp": 2.5896160034319817, "roll_kp": 0.48249575996443006,
"roll_ki": 0.26391970508131646, "roll_ki": 0.016923890033141546,
"roll_kd": 0.10133339760273202, "roll_kd": 0.013609429509460135,
"pitch_kp": 0.5612446354489615, "pitch_kp": 0.10114708799258271,
"pitch_ki": 0.014113041384510265, "pitch_ki": 1.906050976563914,
"pitch_kd": 1.100684970603034 "pitch_kd": 1.8990306608320433
} }

View File

@@ -14,7 +14,7 @@ _FF_PWM_LUT = None
def build_feedforward_lut( def build_feedforward_lut(
pod_mass: float = 5.8, pod_mass: float = 9.4,
coil_r: float = 1.1, coil_r: float = 1.1,
v_supply: float = 12.0, v_supply: float = 12.0,
gap_min: float = 3.0, gap_min: float = 3.0,

View File

@@ -2,8 +2,8 @@
<robot name="lev_pod"> <robot name="lev_pod">
<link name="base_link"> <link name="base_link">
<inertial> <inertial>
<mass value="5.8"/> <mass value="9.4"/>
<inertia ixx="0.0192942414" ixy="0.0" ixz="0.0" iyy="0.130582305" iyz="0.0" izz="0.13760599326"/> <inertia ixx="0.03162537654" ixy="0.0" ixz="0.0" iyy="0.21929017831" iyz="0.0" izz="0.21430205089"/>
</inertial> </inertial>
<collision> <collision>
@@ -13,19 +13,19 @@
Bolts Bolts
<collision> <collision>
<origin rpy="0 0 0" xyz="0.285 0.03 0.09585"/> <origin rpy="0 0 0" xyz="0.285 0.03 0.09085"/>
<geometry><box size="0.01 0.01 0.01"/></geometry> <geometry><box size="0.01 0.01 0.01"/></geometry>
</collision> </collision>
<collision> <collision>
<origin rpy="0 0 0" xyz="0.285 -0.03 0.09585"/> <origin rpy="0 0 0" xyz="0.285 -0.03 0.09085"/>
<geometry><box size="0.01 0.01 0.01"/></geometry> <geometry><box size="0.01 0.01 0.01"/></geometry>
</collision> </collision>
<collision> <collision>
<origin rpy="0 0 0" xyz="-0.285 0.03 0.09585"/> <origin rpy="0 0 0" xyz="-0.285 0.03 0.09085"/>
<geometry><box size="0.01 0.01 0.01"/></geometry> <geometry><box size="0.01 0.01 0.01"/></geometry>
</collision> </collision>
<collision> <collision>
<origin rpy="0 0 0" xyz="-0.285 -0.03 0.09585"/> <origin rpy="0 0 0" xyz="-0.285 -0.03 0.09085"/>
<geometry><box size="0.01 0.01 0.01"/></geometry> <geometry><box size="0.01 0.01 0.01"/></geometry>
</collision> </collision>

View File

@@ -1,11 +1,11 @@
{ {
"height_kp": 6.387288593598476, "height_kp": 80.05607483893696,
"height_ki": 3.8692474098125285, "height_ki": 0,
"height_kd": 8.326592570264028, "height_kd": 7.09266287860531,
"roll_kp": 2.5896160034319817, "roll_kp": -0.600856607986966,
"roll_ki": 0.26391970508131646, "roll_ki": 0,
"roll_kd": 0.10133339760273202, "roll_kd": -0.1,
"pitch_kp": 0.5612446354489615, "pitch_kp": 50.3415835489009009,
"pitch_ki": 0.014113041384510265, "pitch_ki": 0.02319184022898008,
"pitch_kd": 1.100684970603034 "pitch_kd": 0.017632648760979346
} }

View File

@@ -1,32 +1,132 @@
#include "Controller.hpp" #include "Controller.hpp"
#include <Arduino.h> #include <Arduino.h>
#include <math.h>
// CONTROLLER CONSTANTS // ── Integral windup limit ────────────────────────────────────
float MAX_INTEGRAL_TERM = 1e4; static const float MAX_INTEGRAL = 1e4f;
// ── Feedforward LUT in PROGMEM ───────────────────────────────
// Generated by gen_ff_lut.py (pod 9.4 kg, R=1.1Ω, V=12V, 320 mm)
// Positive = repelling, Negative = attracting
static const int16_t FF_PWM_LUT[FF_LUT_SIZE] PROGMEM = {
238, 238, 238, 238, 238, 238, 238, 238,
238, 238, 238, 238, 238, 238, 238, 238,
238, 238, 234, 219, 204, 188, 172, 157,
141, 125, 109, 93, 77, 61, 45, 29,
13, -3, -19, -35, -51, -67, -84, -100,
-116, -133, -150, -166, -183, -200, -217, -234,
-250, -250, -250, -250, -250, -250, -250, -250,
-250, -250, -250, -250, -250, -250, -250, -250
};
// ── Constructor ──────────────────────────────────────────────
FullController::FullController(
IndSensor& l, IndSensor& r, IndSensor& f, IndSensor& b,
PIDGains hGains, PIDGains rGains, PIDGains pGains,
float avgRef, bool useFeedforward)
: Left(l), Right(r), Front(f), Back(b),
heightGains(hGains), rollGains(rGains), pitchGains(pGains),
heightErr({0,0,0}), rollErr({0,0,0}), pitchErr({0,0,0}),
AvgRef(avgRef), avg(0), ffEnabled(useFeedforward),
oor(false), outputOn(false),
FLPWM(0), BLPWM(0), FRPWM(0), BRPWM(0)
{}
// ── Main update (called each control tick) ───────────────────
void FullController::update() { void FullController::update() {
// 1. Read all sensors (updates mmVal, oor)
Left.readMM(); Left.readMM();
Right.readMM(); Right.readMM();
Front.readMM(); Front.readMM();
Back.readMM(); // read and update dists/oor for all sensors. Back.readMM();
oor = Left.oor || Right.oor || Front.oor || Back.oor; oor = Left.oor || Right.oor || Front.oor || Back.oor;
avgControl(); // 2. Compute average gap (mm)
LRControl(); // run pwm functions. avg = (Left.mmVal + Right.mmVal + Front.mmVal + Back.mmVal) * 0.25f;
FBControl();
FLPWM = constrain(avgPWM + LDiffPWM + FDiffPWM, -CAP, CAP); // 3. Feedforward: base PWM from equilibrium LUT
BLPWM = constrain(avgPWM + LDiffPWM + BDiffPWM, -CAP, CAP); int16_t ffPWM = ffEnabled ? feedforward(avg) : 0;
FRPWM = constrain(avgPWM + RDiffPWM + FDiffPWM, -CAP, CAP);
BRPWM = constrain(avgPWM + RDiffPWM + BDiffPWM, -CAP, CAP);
// FLPWM = avgPWM; // 4. Height PID: error = reference - average gap
// BLPWM = avgPWM; float heightE = AvgRef - avg;
// FRPWM = avgPWM; heightErr.eDiff = heightE - heightErr.e;
// BRPWM = avgPWM; if (!oor) {
heightErr.eInt += heightE;
heightErr.eInt = constrain(heightErr.eInt, -MAX_INTEGRAL, MAX_INTEGRAL);
}
heightErr.e = heightE;
int16_t heightPWM = pidCompute(heightGains, heightErr, CAP);
// 5. Roll PID: angle-based error (matches simulation)
// roll_angle = asin((left - right) / y_distance)
// error = -roll_angle (drive roll toward zero)
float rollRatio = (Left.mmVal - Right.mmVal) / Y_DISTANCE_MM;
rollRatio = constrain(rollRatio, -1.0f, 1.0f);
float rollAngle = asinf(rollRatio);
float rollE = -rollAngle;
rollErr.eDiff = rollE - rollErr.e;
if (!oor) {
rollErr.eInt += rollE;
rollErr.eInt = constrain(rollErr.eInt, -MAX_INTEGRAL, MAX_INTEGRAL);
}
rollErr.e = rollE;
int16_t rollPWM = pidCompute(rollGains, rollErr, CAP / 2);
// 6. Pitch PID: angle-based error (matches simulation)
// pitch_angle = asin((back - front) / x_distance)
// error = -pitch_angle (drive pitch toward zero)
float pitchRatio = (Back.mmVal - Front.mmVal) / X_DISTANCE_MM;
pitchRatio = constrain(pitchRatio, -1.0f, 1.0f);
float pitchAngle = asinf(pitchRatio);
float pitchE = -pitchAngle;
pitchErr.eDiff = pitchE - pitchErr.e;
if (!oor) {
pitchErr.eInt += pitchE;
pitchErr.eInt = constrain(pitchErr.eInt, -MAX_INTEGRAL, MAX_INTEGRAL);
}
pitchErr.e = pitchE;
int16_t pitchPWM = pidCompute(pitchGains, pitchErr, CAP / 2);
// 7. Mix outputs (same sign convention as simulation)
// FL: ff + height - roll - pitch
// FR: ff + height + roll - pitch
// BL: ff + height - roll + pitch
// BR: ff + height + roll + pitch
FLPWM = constrain(ffPWM + heightPWM - rollPWM - pitchPWM, -CAP, CAP);
FRPWM = constrain(ffPWM + heightPWM + rollPWM - pitchPWM, -CAP, CAP);
BLPWM = constrain(ffPWM + heightPWM - rollPWM + pitchPWM, -CAP, CAP);
BRPWM = constrain(ffPWM + heightPWM + rollPWM + pitchPWM, -CAP, CAP);
} }
// ── PID compute (single symmetric set of gains) ─────────────
int16_t FullController::pidCompute(PIDGains& gains, PIDState& state, float maxOutput) {
if (oor) return 0;
float out = gains.kp * state.e
+ gains.ki * state.eInt
+ gains.kd * state.eDiff;
return (int16_t)constrain(out, -maxOutput, maxOutput);
}
// ── Feedforward: linearly interpolate PROGMEM LUT ────────────
int16_t FullController::feedforward(float gapMM) {
if (gapMM <= FF_GAP_MIN) return (int16_t)pgm_read_word(&FF_PWM_LUT[0]);
if (gapMM >= FF_GAP_MAX) return (int16_t)pgm_read_word(&FF_PWM_LUT[FF_LUT_SIZE - 1]);
float idx_f = (gapMM - 1.0 - FF_GAP_MIN) / FF_GAP_STEP;
uint8_t idx = (uint8_t)idx_f;
if (idx >= FF_LUT_SIZE - 1) idx = FF_LUT_SIZE - 2;
int16_t v0 = (int16_t)pgm_read_word(&FF_PWM_LUT[idx]);
int16_t v1 = (int16_t)pgm_read_word(&FF_PWM_LUT[idx + 1]);
float frac = idx_f - (float)idx;
return (int16_t)(v0 + frac * (v1 - v0));
}
// ── Zero all PWMs ────────────────────────────────────────────
void FullController::zeroPWMs() { void FullController::zeroPWMs() {
FLPWM = 0; FLPWM = 0;
BLPWM = 0; BLPWM = 0;
@@ -34,131 +134,48 @@ void FullController::zeroPWMs() {
BRPWM = 0; BRPWM = 0;
} }
// ── Send PWM values to hardware ──────────────────────────────
void FullController::sendOutputs() { void FullController::sendOutputs() {
if (!outputOn) { if (!outputOn) {
zeroPWMs(); zeroPWMs();
} }
// The following assumes 0 direction drives repulsion and 1 direction drives // Direction: LOW = repelling (positive PWM), HIGH = attracting (negative PWM)
// attraction. Using direct register writes to maintain fast PWM mode set by // Using direct register writes for fast PWM mode set by setupFastPWM()
// setupFastPWM()
digitalWrite(dirFL, FLPWM < 0); digitalWrite(dirFL, FLPWM < 0);
OCR2A = abs(FLPWM); // Pin 11 -> Timer 2A OCR2A = abs(FLPWM); // Pin 11 Timer 2A
digitalWrite(dirBL, BLPWM < 0); digitalWrite(dirBL, BLPWM < 0);
OCR1A = abs(BLPWM); // Pin 9 -> Timer 1A OCR1A = abs(BLPWM); // Pin 9 Timer 1A
digitalWrite(dirFR, FRPWM < 0); digitalWrite(dirFR, FRPWM < 0);
OCR2B = abs(FRPWM); // Pin 3 -> Timer 2B OCR2B = abs(FRPWM); // Pin 3 Timer 2B
digitalWrite(dirBR, BRPWM < 0); digitalWrite(dirBR, BRPWM < 0);
OCR1B = abs(BRPWM); // Pin 10 -> Timer 1B OCR1B = abs(BRPWM); // Pin 10 Timer 1B
}
void FullController::avgControl() {
avg = (Left.mmVal + Right.mmVal + Front.mmVal + Back.mmVal) * 0.25f;
float eCurr = AvgRef - avg;
avgError.eDiff = eCurr - avgError.e;
if (!oor) {
avgError.eInt += eCurr;
avgError.eInt =
constrain(avgError.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM);
}
avgError.e = eCurr;
avgPWM = pwmFunc(avgConsts, avgError);
}
void FullController::LRControl() {
float diff = Right.mmVal - Left.mmVal; // how far above the right is the left?
float eCurr = diff - LRDiffRef; // how different is that from the reference?
// positive -> Left repels, Right attracts.
K_MAP rConsts = {
LConsts.attracting,
LConsts.repelling}; // apply attracting to repelling and vice versa.
LRDiffErr.eDiff = eCurr - LRDiffErr.e;
if (!oor) {
LRDiffErr.eInt += eCurr;
LRDiffErr.eInt =
constrain(LRDiffErr.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM);
}
LRDiffErr.e = eCurr;
LDiffPWM = pwmFunc(LConsts, LRDiffErr);
RDiffPWM = -pwmFunc(rConsts, LRDiffErr);
}
void FullController::FBControl() {
float diff = Back.mmVal - Front.mmVal; // how far above the back is the front?
float eCurr = diff - FBDiffRef; // how different is that from ref? pos.->Front
// must repel, Back must attract
K_MAP bConsts = {FConsts.attracting, FConsts.repelling};
FBDiffErr.eDiff = eCurr - FBDiffErr.e;
if (!oor) {
FBDiffErr.eInt += eCurr;
FBDiffErr.eInt =
constrain(FBDiffErr.eInt, -MAX_INTEGRAL_TERM, MAX_INTEGRAL_TERM);
}
FBDiffErr.e = eCurr;
FDiffPWM = pwmFunc(FConsts, FBDiffErr);
BDiffPWM = -pwmFunc(bConsts, FBDiffErr);
}
int16_t FullController::pwmFunc(K_MAP consts, Errors errs) {
if (oor)
return 0;
Constants constants = (errs.e < 0) ? consts.attracting : consts.repelling;
return (int)(constants.kp * errs.e + constants.ki * errs.eInt +
constants.kd * errs.eDiff);
} }
// ── Serial report ────────────────────────────────────────────
void FullController::report() { void FullController::report() {
// CSV Format: Left,Right,Front,Back,Avg,FLPWM,BLPWM,FRPWM,BRPWM,ControlOn // CSV: Left,Right,Front,Back,Avg,FLPWM,BLPWM,FRPWM,BRPWM,ControlOn
Serial.print(Left.mmVal); Serial.print(Left.mmVal); Serial.print(',');
Serial.print(","); Serial.print(Right.mmVal); Serial.print(',');
Serial.print(Right.mmVal); Serial.print(Front.mmVal); Serial.print(',');
Serial.print(","); Serial.print(Back.mmVal); Serial.print(',');
Serial.print(Front.mmVal); Serial.print(avg); Serial.print(',');
Serial.print(","); Serial.print(FLPWM); Serial.print(',');
Serial.print(Back.mmVal); Serial.print(BLPWM); Serial.print(',');
Serial.print(","); Serial.print(FRPWM); Serial.print(',');
Serial.print(avg); Serial.print(BRPWM); Serial.print(',');
Serial.print(",");
Serial.print(FLPWM);
Serial.print(",");
Serial.print(BLPWM);
Serial.print(",");
Serial.print(FRPWM);
Serial.print(",");
Serial.print(BRPWM);
Serial.print(",");
Serial.println(outputOn); Serial.println(outputOn);
} }
void FullController::updateAvgPID(Constants repel, Constants attract) { // ── Runtime tuning methods ───────────────────────────────────
avgConsts.repelling = repel; void FullController::updateHeightPID(PIDGains gains) { heightGains = gains; }
avgConsts.attracting = attract; void FullController::updateRollPID(PIDGains gains) { rollGains = gains; }
} void FullController::updatePitchPID(PIDGains gains) { pitchGains = gains; }
void FullController::updateLRPID(Constants down, Constants up) { void FullController::updateReference(float avgReference) {
LConsts.repelling = down;
LConsts.attracting = up;
}
void FullController::updateFBPID(Constants down, Constants up) {
FConsts.repelling = down;
FConsts.attracting = up;
}
void FullController::updateReferences(float avgReference, float lrDiffReference, float fbDiffReference) {
AvgRef = avgReference; AvgRef = avgReference;
LRDiffRef = lrDiffReference; }
FBDiffRef = fbDiffReference;
void FullController::setFeedforward(bool enabled) {
ffEnabled = enabled;
} }

View File

@@ -2,103 +2,98 @@
#define CONTROLLER_HPP #define CONTROLLER_HPP
#include <stdint.h> #include <stdint.h>
#include <avr/pgmspace.h>
#include "IndSensorMap.hpp" #include "IndSensorMap.hpp"
// PIN MAPPING // ── Pin Mapping ──────────────────────────────────────────────
#define dirFR 2 #define dirBL 2
#define pwmFR 3 #define pwmBL 3
#define dirBR 4 #define dirBR 4
#define pwmBR 10 #define pwmBR 10
#define pwmFL 11 #define pwmFL 11
#define dirFL 7 #define dirFL 7
#define dirBL 8 #define dirFR 8
#define pwmBL 9 #define pwmFR 9
#define CAP 250 // ── Output Cap ───────────────────────────────────────────────
#define CAP 250 // Max PWM magnitude (0-255 Arduino range)
typedef struct Constants { // ── PID Gains (single set per loop — matches simulation) ────
typedef struct PIDGains {
float kp; float kp;
float ki; float ki;
float kd; float kd;
} Constants; } PIDGains;
typedef struct K_MAP { // ── PID Error State ──────────────────────────────────────────
Constants repelling; typedef struct PIDState {
Constants attracting; float e; // Current error
} K_MAP; float eDiff; // Derivative of error (e[k] - e[k-1])
float eInt; // Integral of error (accumulated)
} PIDState;
typedef struct FullConsts { // ── Feedforward LUT (PROGMEM) ────────────────────────────────
K_MAP avg; // Generated by gen_ff_lut.py from MaglevPredictor model
K_MAP lColl; // repelling is applied to attracting and vice versa for the Right and Back collectives. // Pod mass: 9.4 kg, Coil R: 1.1Ω, V_supply: 12V
K_MAP fColl; // Positive = repelling, Negative = attracting
} FullConsts; // Beyond ~16mm: clamped to -CAP (no equilibrium exists)
#define FF_LUT_SIZE 64
#define FF_GAP_MIN 3.0f
#define FF_GAP_MAX 20.0f
#define FF_GAP_STEP 0.269841f
typedef struct Errors { // ── Geometry (mm, matching simulation) ───────────────────────
float e; // Sensor-to-sensor distances for angle computation
float eDiff; #define Y_DISTANCE_MM 101.6f // Left↔Right sensor spacing (mm)
float eInt; #define X_DISTANCE_MM 251.8f // Front↔Back sensor spacing (mm)
} Errors;
// ── Controller Class ─────────────────────────────────────────
class FullController { class FullController {
public: public:
bool oor; bool oor; // Any sensor out-of-range
bool outputOn; bool outputOn; // Enable/disable output
FullController(IndSensor& l, IndSensor& r, IndSensor& f, IndSensor& b, FullController(IndSensor& l, IndSensor& r, IndSensor& f, IndSensor& b,
FullConsts fullConsts, float avgRef, float lrDiffRef, float fbDiffRef) PIDGains heightGains, PIDGains rollGains, PIDGains pitchGains,
: Left(l), Right(r), Front(f), Back(b), AvgRef(avgRef), LRDiffRef(lrDiffRef), float avgRef, bool useFeedforward);
FBDiffRef(fbDiffRef), avgConsts(fullConsts.avg), LConsts(fullConsts.lColl),
FConsts(fullConsts.fColl), avgError({0,0,0}), LRDiffErr({0,0,0}),
FBDiffErr({0,0,0}), oor(false), outputOn(false) {}
void update(); void update();
void zeroPWMs(); void zeroPWMs();
void sendOutputs(); void sendOutputs();
void report(); void report();
// PID tuning methods // Runtime tuning
void updateAvgPID(Constants repel, Constants attract); void updateHeightPID(PIDGains gains);
void updateLRPID(Constants down, Constants up); void updateRollPID(PIDGains gains);
void updateFBPID(Constants down, Constants up); void updatePitchPID(PIDGains gains);
void updateReference(float avgReference);
void setFeedforward(bool enabled);
// Reference update methods private:
void updateReferences(float avgReference, float lrDiffReference, float fbDiffReference); int16_t pidCompute(PIDGains& gains, PIDState& state, float maxOutput);
int16_t feedforward(float gapMM);
private: IndSensor& Left;
void avgControl(); IndSensor& Right;
void LRControl(); IndSensor& Front;
void FBControl(); IndSensor& Back;
int16_t pwmFunc(K_MAP consts, Errors errs);
IndSensor& Front; PIDGains heightGains;
IndSensor& Back; PIDGains rollGains;
IndSensor& Right; PIDGains pitchGains;
IndSensor& Left;
K_MAP avgConsts; PIDState heightErr;
K_MAP LConsts; PIDState rollErr;
K_MAP FConsts; PIDState pitchErr;
Errors avgError; float AvgRef; // Target gap height (mm)
Errors LRDiffErr; float avg; // Current average gap (mm)
Errors FBDiffErr; bool ffEnabled; // Feedforward on/off
float AvgRef; int16_t FLPWM;
float LRDiffRef; int16_t BLPWM;
float FBDiffRef; int16_t FRPWM;
float avg; int16_t BRPWM;
int16_t avgPWM;
int16_t LDiffPWM;
int16_t RDiffPWM;
int16_t FDiffPWM;
int16_t BDiffPWM;
// Initially, I was going to make the Right and Back just the negatives,
// but having separate control functions running for each of these outputs might prove useful.
int16_t FLPWM;
int16_t BLPWM;
int16_t FRPWM;
int16_t BRPWM;
}; };
#endif // CONTROLLER_HPP #endif // CONTROLLER_HPP

View File

@@ -58,7 +58,7 @@ float IndSensor::readMM() {
} }
// Predefined sensor instances // Predefined sensor instances
IndSensor indL(ind1Map, A0); IndSensor indF(ind1Map, A0);
IndSensor indR(ind0Map, A1); IndSensor indB(ind0Map, A1);
IndSensor indF(ind3Map, A5); IndSensor indR(ind3Map, A5);
IndSensor indB(ind2Map, A4); IndSensor indL(ind2Map, A4);